minecraft server init

config/AdvGenerators/client.config

@@ -0,0 +1,17 @@
+# Configuration file
+
+display {
+    # Units to use when displaying power. Valid values: MJ, EU, RF, T
+    S:PowerShowUnits=RF
+}
+
+
+tooltips {
+    # If false will only show tooltip in Syngas Producer GUI
+    B:AlwaysShowCarbonTooltip=true
+
+    # If false will only show tooltip in Turbine GUI
+    B:AlwaysShowFuelTooltip=true
+}
+
+

config/AdvGenerators/readme.txt

@@ -0,0 +1,2 @@
+Any .cfg files in this directory will be loaded after the internal configuration, in alphabetic order
+Files in 'overrides' directory with matching names cab be used to override internal configuration

config/AdvGenerators/turbine.cfg

@@ -0,0 +1,7 @@
+recipes {
+
+    // Default is 51.2 MJ/mB, bump to match Simple Generators
+    // https://github.com/bdew/generators/blob/2a14f2d63/resources/assets/advgenerators/config/turbine.cfg#L171
+    turbine-fuel: gasoline 120 MJ/mB
+
+}

config/AppliedEnergistics2/AppliedEnergistics2.cfg

@@ -0,0 +1,492 @@
+# Configuration file
+
+automation {
+    I:formationPlaneEntityLimit=0
+}
+
+
+battery {
+    I:chargedStaff=8000
+    I:colorApplicator=20000
+    I:entropyManipulator=200000
+    I:matterCannon=200000
+    I:portableCell=20000
+    I:wirelessTerminal=1600000
+}
+
+
+client {
+    # Possible Values: AE, EU, RF
+    S:PowerUnit=RF
+
+    # Possible Values: AUTOSEARCH, AUTOSEARCH_KEEP, MANUAL_SEARCH, MANUAL_SEARCH_KEEP, JEI_AUTOSEARCH, JEI_AUTOSEARCH_KEEP, JEI_MANUAL_SEARCH, JEI_MANUAL_SEARCH_KEEP
+    S:SEARCH_MODE=MANUAL_SEARCH_KEEP
+
+    # Possible Values: YES, NO, UNDECIDED
+    S:SEARCH_TOOLTIPS=YES
+
+    # Possible Values: TALL, FULL, SMALL
+    S:TERMINAL_STYLE=TALL
+
+    # Controls buttons on Crafting Screen : Capped at 9
+    I:craftAmtButton1=1
+
+    # Controls buttons on Crafting Screen : Capped at 99
+    I:craftAmtButton2=10
+
+    # Controls buttons on Crafting Screen : Capped at 999
+    I:craftAmtButton3=100
+
+    # Controls buttons on Crafting Screen : Capped at 9999
+    I:craftAmtButton4=1000
+    B:disableColoredCableRecipesInJEI=true
+    B:enableEffects=true
+
+    # Controls buttons on Level Emitter Screen : Capped at 9
+    I:levelAmtButton1=1
+
+    # Controls buttons on Level Emitter Screen : Capped at 99
+    I:levelAmtButton2=10
+
+    # Controls buttons on Level Emitter Screen : Capped at 999
+    I:levelAmtButton3=100
+
+    # Controls buttons on Level Emitter Screen : Capped at 9999
+    I:levelAmtButton4=1000
+
+    # Controls buttons on Priority Screen : Capped at 9
+    I:priorityAmtButton1=1
+
+    # Controls buttons on Priority Screen : Capped at 99
+    I:priorityAmtButton2=10
+
+    # Controls buttons on Priority Screen : Capped at 999
+    I:priorityAmtButton3=100
+
+    # Controls buttons on Priority Screen : Capped at 9999
+    I:priorityAmtButton4=1000
+    B:rememberTerminalSearchOnClose=false
+    B:useColoredCraftingStatus=true
+    B:useTerminalUseLargeFont=false
+}
+
+
+condenser {
+    I:MatterBalls=256
+    I:Singularity=256000
+}
+
+
+craftingcpu {
+    I:craftingCalculationTimePerTick=5
+}
+
+
+##########################################################################################################
+# features
+#--------------------------------------------------------------------------------------------------------#
+# Warning: Disabling a feature may disable other features depending on it.
+##########################################################################################################
+
+features {
+
+    world {
+        B:CertusOre=true
+        B:CertusQuartzWorldGen=false
+        B:ChargedCertusOre=true
+        B:Charger=true
+        B:ChestLoot=false
+        B:CrystalGrowthAccelerator=true
+
+        # Blocks that are not used in any essential recipes, also slabs and stairs.
+        B:DecorativeBlocks=true
+        B:DecorativeLights=true
+        B:DecorativeQuartzBlocks=true
+        B:Flour=false
+        B:GrindStone=true
+        B:Inscriber=true
+        B:MeteoriteWorldGen=false
+        B:SkyStoneChests=false
+        B:SpawnPressesInMeteorites=false
+        B:TinyTNT=true
+        B:VillagerTrading=false
+        B:VillagerTradingPresses=false
+    }
+
+    toolsclassifications {
+        B:CertusQuartzTools=true
+        B:NetherQuartzTools=true
+        B:PoweredTools=true
+    }
+
+    tools {
+        B:ChargedStaff=true
+        B:ColorApplicator=true
+        B:EntropyManipulator=true
+        B:MatterCannon=true
+        B:MeteoriteCompass=false
+        B:PaintBalls=true
+        B:QuartzAxe=true
+        B:QuartzHoe=true
+        B:QuartzKnife=true
+        B:QuartzPickaxe=true
+        B:QuartzSpade=true
+        B:QuartzSword=true
+        B:QuartzWrench=true
+        B:WirelessAccessTerminal=true
+    }
+
+    networkfeatures {
+        B:Channels=true
+        B:PowerGen=true
+        B:QuantumNetworkBridge=true
+        B:Security=true
+        B:SpatialIO=true
+    }
+
+    networkbuses {
+        B:AnnihilationPlane=true
+        B:CableAnchor=true
+        B:CraftingTerminal=true
+        B:ExportBus=true
+        B:FluidAnnihilationPlane=true
+        B:FluidExportBus=true
+        B:FluidFormationPlane=true
+        B:FluidImportBus=true
+        B:FluidInterface=true
+        B:FluidLevelEmitter=true
+        B:FluidStorageBus=true
+        B:FluidTerminal=true
+        B:FormationPlane=true
+        B:IdentityAnnihilationPlane=true
+        B:ImportBus=true
+        B:Interface=true
+        B:LevelEmitter=true
+        B:P2PTunnel=true
+        B:Panels=true
+        B:PartConversionMonitor=true
+        B:QuartzFiber=true
+        B:StorageBus=true
+        B:StorageMonitor=true
+        B:Terminal=true
+        B:ToggleBus=true
+    }
+
+    portablecell {
+        B:PortableCell=true
+    }
+
+    storage {
+        B:Condenser=true
+        B:IOPort=true
+        B:MEChest=true
+        B:MEDrive=true
+        B:StorageCells=true
+    }
+
+    networktool {
+        B:MemoryCard=true
+        B:NetworkTool=true
+    }
+
+    cables {
+        B:CoveredCables=true
+        B:DenseCables=true
+        B:GlassCables=true
+        B:SmartCables=true
+    }
+
+    energy {
+        B:DenseEnergyCells=true
+        B:EnergyAcceptor=true
+        B:EnergyCells=true
+    }
+
+    highercapacity {
+        B:DenseCables=true
+        B:DenseEnergyCells=true
+    }
+
+    p2ptunnels {
+        B:P2PTunnelEU=true
+        B:P2PTunnelFE=true
+        B:P2PTunnelFluids=true
+        B:P2PTunnelItems=true
+        B:P2PTunnelLight=true
+        B:P2PTunnelME=true
+        B:P2PTunnelOpenComputers=true
+        B:P2PTunnelPressure=true
+        B:P2PTunnelRF=true
+        B:P2PTunnelRedstone=true
+    }
+
+    blockfeatures {
+        B:MassCannonBlockDamage=true
+        B:TinyTNTBlockDamage=true
+    }
+
+    facades {
+        B:Facades=true
+    }
+
+    misc {
+        B:Achievements=true
+        B:CraftingLog=false
+        B:Creative=true
+        B:DebugLogging=false
+        B:GrinderLogging=false
+        B:IntegrationLogging=false
+        B:LightDetector=true
+        B:LogSecurityAudits=false
+        B:Logging=true
+        B:PacketLogging=false
+        B:UnsupportedDeveloperTools=false
+        B:UpdateLogging=false
+        B:WebsiteRecipes=false
+    }
+
+    crafting {
+        B:EnableDisassemblyCrafting=true
+        B:EnableFacadeCrafting=true
+        B:InWorldFluix=true
+        B:InWorldPurification=true
+        B:InWorldSingularity=true
+        B:InterfaceTerminal=true
+    }
+
+    rendering {
+        B:AlphaPass=true
+    }
+
+    craftingfeatures {
+        B:CraftingCPU=true
+
+        # Use CraftingManager to find an alternative recipe, after a pattern rejected an ingredient. Should be enabled to avoid issues, but can have a minor performance impact.
+        B:CraftingManagerFallback=true
+        B:MolecularAssembler=true
+        B:Patterns=true
+    }
+
+    upgrades {
+        B:AdvancedCards=true
+        B:BasicCards=true
+        B:ViewCell=true
+    }
+
+    materials {
+        B:Certus=true
+        B:Cores=true
+        B:CrystalSeeds=true
+        B:Dusts=true
+        B:Fluix=true
+        B:MatterBall=true
+        B:Nuggets=true
+        B:Presses=true
+        B:PrintedCircuits=true
+        B:Processors=true
+        B:PureCrystals=true
+        B:QuartzGlass=true
+        B:Silicon=true
+        B:SkyStone=true
+    }
+
+    commands {
+        B:ChunkLoggerTrace=false
+    }
+
+    machines {
+        B:Charger=true
+        B:CrystalGrowthAccelerator=true
+        B:GrindStone=true
+        B:Inscriber=true
+        B:VibrationChamber=true
+    }
+
+    craftingcomponents {
+        B:Cores=true
+        B:MatterBall=true
+        B:Presses=true
+        B:PrintedCircuits=true
+        B:Processors=true
+    }
+
+}
+
+
+general {
+    B:patternTermRequiresItems=true
+
+    # Will auto-remove items that crash when being loaded from storage. This will destroy those items instead of crashing the game!
+    B:removeCrashingItemsOnLoad=false
+}
+
+
+##########################################################################################################
+# grindstone
+#--------------------------------------------------------------------------------------------------------#
+# Creates recipe of the following pattern automatically: '1 oreTYPE => 2 dustTYPE' and '(1 ingotTYPE or 1 crystalTYPE or 1 gemTYPE) => 1 dustTYPE'
+##########################################################################################################
+
+grindstone {
+    # Blacklists the exact oredict name from being handled by any recipe.
+    S:blacklist <
+     >
+
+    # The list of types to handle. Specify without a prefix like ore or dust.
+    S:grinderOres <
+        Obsidian
+        Ender
+        EnderPearl
+        Coal
+        Gold
+        Charcoal
+        NetherQuartz
+        CertusQuartz
+        Wheat
+        Fluix
+        Copper
+        Tin
+        Silver
+        Lead
+        Bronze
+        Brass
+        Platinum
+        Nickel
+        Invar
+        Aluminium
+        Electrum
+        Osmium
+        Zinc
+     >
+
+    # Chance to actually get an output with stacksize > 1.
+    D:oreDoublePercentage=90.0
+}
+
+
+##########################################################################################################
+# modintegration
+#--------------------------------------------------------------------------------------------------------#
+# Valid Values are 'AUTO', 'ON', or 'OFF' - defaults to 'AUTO' ; Suggested that you leave this alone unless your experiencing an issue, or wish to disable the integration for a reason.
+##########################################################################################################
+
+modintegration {
+    S:Buildcraft=AUTO
+    S:Chisel=AUTO
+    S:CraftTweaker=AUTO
+    S:IndustrialCraft2=OFF
+    S:InventoryTweaks=AUTO
+    S:JustEnoughItems=AUTO
+    S:Mekanism=OFF
+    S:MineFactoryReloaded=OFF
+    S:OpenComputers=OFF
+    S:Railcraft=OFF
+    S:RedstoneFluxPower-Items=AUTO
+    S:RedstoneFluxPower-Tiles=AUTO
+    S:TFHammer=OFF
+    S:Tesla=AUTO
+    S:TheOneProbe=OFF
+    S:Waila=AUTO
+}
+
+
+orecamouflage {
+    B:ENDER_DUST=true
+    B:GOLD_DUST=true
+    B:IRON_DUST=true
+    B:NETHER_QUARTZ_DUST=true
+    B:SILICON=true
+    B:WOODEN_GEAR=true
+}
+
+
+powerratios {
+    D:"Forge Energy"=0.5
+    D:ForgeEnergy=0.5
+    D:IC2=2.0
+    D:UsageMultiplier=1.0
+}
+
+
+spatialio {
+    D:spatialPowerExponent=1.35
+    D:spatialPowerMultiplier=1250.0
+    I:storageBiomeID=59
+    I:storageDimensionID=2
+    I:storageProviderID=-11
+}
+
+
+##########################################################################################################
+# tickrates
+#--------------------------------------------------------------------------------------------------------#
+#  Min / Max Tickrates for dynamic ticking, most of these components also use sleeping, to prevent constant ticking, adjust with care, non standard rates are not supported or tested.
+##########################################################################################################
+
+tickrates {
+    I:AnnihilationPlane.max=120
+    I:AnnihilationPlane.min=2
+    I:Charger.max=120
+    I:Charger.min=10
+    I:ExportBus.max=60
+    I:ExportBus.min=5
+    I:FluidExportBus.max=60
+    I:FluidExportBus.min=5
+    I:FluidImportBus.max=40
+    I:FluidImportBus.min=5
+    I:FluidStorageBus.max=60
+    I:FluidStorageBus.min=5
+    I:IOPort.max=5
+    I:IOPort.min=1
+    I:ImportBus.max=40
+    I:ImportBus.min=5
+    I:Inscriber.max=1
+    I:Inscriber.min=1
+    I:Interface.max=120
+    I:Interface.min=5
+    I:ItemTunnel.max=60
+    I:ItemTunnel.min=5
+    I:LightTunnel.max=120
+    I:LightTunnel.min=5
+    I:METunnel.max=20
+    I:METunnel.min=5
+    I:OpenComputersTunnel.max=5
+    I:OpenComputersTunnel.min=1
+    I:PressureTunnel.max=120
+    I:PressureTunnel.min=1
+    I:StorageBus.max=60
+    I:StorageBus.min=5
+    I:VibrationChamber.max=40
+    I:VibrationChamber.min=10
+}
+
+
+##########################################################################################################
+# wireless
+#--------------------------------------------------------------------------------------------------------#
+# Range= wirelessBaseRange + wirelessBoosterRangeMultiplier * Math.pow( boosters, wirelessBoosterExp )
+# PowerDrain= wirelessBaseCost + wirelessCostMultiplier * Math.pow( boosters, 1 + boosters / wirelessHighWirelessCount )
+##########################################################################################################
+
+wireless {
+    D:wirelessBaseCost=8.0
+    D:wirelessBaseRange=16.0
+    D:wirelessBoosterExp=1.5
+    D:wirelessBoosterRangeMultiplier=1.0
+    D:wirelessCostMultiplier=1.0
+    D:wirelessTerminalDrainMultiplier=1.0
+}
+
+
+worldgen {
+    D:meteoriteClusterChance=0.1
+    I:meteoriteDimensionWhitelist <
+     >
+    I:meteoriteMaximumSpawnHeight=256
+    I:minMeteoriteDistance=707
+    I:quartzOresClusterAmount=15
+    I:quartzOresPerCluster=4
+    D:spawnChargedChance=0.07999998331069946
+}
+
+

config/AppliedEnergistics2/CustomRecipes.cfg

@@ -0,0 +1,25 @@
+# Configuration file
+
+cache {
+    S:digest=35be480fcae22376bc84ea31d11e4627
+
+    # Caching can save processing time, if there are a lot of items. [default: true]
+    B:enableCache=false
+}
+
+
+general {
+    # Will output more detailed information into the CSV like corresponding items [default: false]
+    B:enableAdditionalInfo=false
+
+    # If true, the CSV exporting will always happen. This will not use the cache to reduce the computation. [default: false]
+    B:enableForceRefresh=false
+
+    # If true, the custom recipes are enabled. Acts as a master switch. [default: true]
+    B:enabled=true
+
+    # If true, all registered items will be exported containing the internal minecraft name and the localized name to actually find the item you are using. This also contains the item representation of the blocks, but are missing items, which are too much to display e.g. FMP. [default: true]
+    B:exportItemNames=true
+}
+
+

config/AppliedEnergistics2/Facades.cfg

@@ -0,0 +1,45 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+##########################################################################################################
+# common
+#--------------------------------------------------------------------------------------------------------#
+# Settings applied to all facades.
+# 
+# By default full blocks with no tile entity and a model do not need whitelisting.
+# This will only be read once during client startup.
+##########################################################################################################
+
+common {
+    # Unsupported: Allows whitelisting TileEntity as facades. Could work, have render issues, or corrupt your world. USE AT YOUR OWN RISK.
+    B:allowTileEntityFacades=false
+}
+
+
+##########################################################################################################
+# facades
+#--------------------------------------------------------------------------------------------------------#
+# A way to explicitly handle certain blocks as facades.
+# 
+# Blocks can be added by their resource location under the following rules.
+#  - One category per domain like minecraft or appliedenergistics2
+#  - One key per id. E.g. glass in case of minecraft:glass
+#  - An integer value ranging from 0 to 16 representing the metadata 0-15 and 16 as wildcard for all - Multiple entries for the same id but different metadata are possible when needed
+##########################################################################################################
+
+facades {
+
+    minecraft {
+        I:glass=16
+        I:stained_glass=16
+    }
+
+    appliedenergistics2 {
+        I:quartz_glass=16
+        I:quartz_vibrant_glass=16
+    }
+
+}
+
+

config/AppliedEnergistics2/VersionChecker.cfg

@@ -0,0 +1,30 @@
+# Configuration file
+
+cache {
+    # Waits as many hours, until it checks again. [range: 0 ~ 168, default: 24]
+    I:interval=24
+    S:lastCheck=1501773110066
+}
+
+
+channel {
+    # Determines the channel level which should be checked for updates. Can be either Stable, Beta or Alpha. [default: Beta]
+    S:level=Beta
+}
+
+
+client {
+    # If true, the player is getting a notification including changelog. Only happens if notification are enabled. [default: true]
+    B:changelog=true
+
+    # If true, the player is getting a notification, that a new version is available. [default: true]
+    B:notify=false
+}
+
+
+general {
+    # If true, the version checker is enabled. Acts as a master switch. [default: true]
+    B:enabled=false
+}
+
+

config/BNBGamingCore.cfg

@@ -0,0 +1,9 @@
+# Configuration file
+
+modules {
+    # Specify ASM modules here that you do not want to run. [default: ]
+    S:"disabled modules" <
+     >
+}
+
+

config/BetterBedrock.cfg

@@ -0,0 +1,38 @@
+# Configuration file
+
+##########################################################################################################
+# dimensions
+#--------------------------------------------------------------------------------------------------------#
+# Dimension Configuration
+##########################################################################################################
+
+dimensions {
+    # Dimentions to generate flat bedrock in
+    I:whitelist <
+        -1
+        0
+        7
+        10
+        28885
+     >
+}
+
+
+##########################################################################################################
+# retrogen
+#--------------------------------------------------------------------------------------------------------#
+# Retro-Generation Config
+##########################################################################################################
+
+retrogen {
+    # Enabled chunks to be regenerated. This will probability cause lag until chunks are done. [default: false]
+    B:enabled=false
+
+    # Marker for marking chunks that have been generated. Must be a number. [range: 1 ~ 2147483647, default: 1]
+    I:marker=1
+
+    # Enable this only to rebuild the Bedrock at y level 0. Retrogen must be enabled to work. [default: false]
+    B:rebuild=false
+}
+
+

config/Building Gadgets.cfg

@@ -0,0 +1,204 @@
+# Configuration file
+
+general {
+    # Disable absolute coords-mode for the Copy-Paste gadget
+    B:"Allow absolute Coord-Mode"=true
+
+    # Whether the Building / CopyPaste Gadget can overwrite blocks like water, lava, grass, etc (like a player can).
+    # False will only allow it to overwrite air blocks.
+    B:"Allow non-Air-Block-Overwrite"=true
+
+    # The maximum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Max"=3
+
+    # The minimum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Min"=1
+
+    # Determines if the Copy/Paste GUI's coordinate mode starts in 'Absolute' mode by default.
+    # Set to true for Absolute, set to False for Relative.
+    B:"Default to absolute Coord-Mode"=false
+
+    # Set to false to disable the recipe for construction paste.
+    B:"Enable Construction Paste"=true
+
+    # Set to false to disable the Destruction Gadget.
+    B:"Enable Destruction Gadget"=true
+
+    # Defines how far away you can build
+    # Min: 1.0
+    # Max: 48.0
+    D:"Max Build Distance"=32.0
+
+    # Set to true for Forge Energy Support, set to False for vanilla Item Damage
+    B:"Powered by Forge Energy"=true
+
+    ##########################################################################################################
+    # blacklist settings
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure your Blacklist-Settings here
+    ##########################################################################################################
+
+    "blacklist settings" {
+        # All Blocks added to this will be treated similar to TileEntities. Not at all.
+        # Notice that you can use Regular Expressions as defined by Java Patterns to express more complex name combinations.
+        # Use for example "awfulmod:.*" to blacklist all awfulmod Blocks.
+        S:"Blacklisted Blocks" <
+            minecraft:.*_door.*
+            minecraft:piston_head
+         >
+    }
+
+    ##########################################################################################################
+    # gadgets
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Gadgets here
+    ##########################################################################################################
+
+    gadgets {
+        # The max energy of Building, Exchanging & Copy-Paste Gadget
+        # Min: 0
+        # Max: 2147483647
+        I:"Maximum Energy"=500000
+
+        # The max range of the Gadgets
+        # Min: 1
+        # Max: 25
+        I:"Maximum allowed Range"=15
+
+        ##########################################################################################################
+        # building gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Building Gadget
+        ##########################################################################################################
+
+        "building gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+        ##########################################################################################################
+        # exchanging gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Exchanging Gadget
+        ##########################################################################################################
+
+        "exchanging gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=2
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=100
+        }
+
+        ##########################################################################################################
+        # destruction gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost, Durability & Maximum Energy of the Destruction Gadget
+        ##########################################################################################################
+
+        "destruction gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=4
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=200
+
+            # The max energy of the Destruction Gadget
+            # Min: 0
+            # Max: 2147483647
+            I:"Maximum Energy"=1000000
+
+            # If enabled, the Destruction Gadget can be taken out of fuzzy mode, allowing only instances of the block clicked to be removed (at a higher cost)
+            B:"Non-Fuzzy Mode Enabled"=false
+
+            # The cost in energy/durability will increase by this amount when not in fuzzy mode
+            # Min: 0.0
+            # Max: 1.7976931348623157E308
+            D:"Non-Fuzzy Mode Multiplier"=2.0
+        }
+
+        ##########################################################################################################
+        # copy-paste gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Copy-Paste Gadget
+        ##########################################################################################################
+
+        "copy-paste gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+    }
+
+    ##########################################################################################################
+    # paste containers
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Paste Containers here
+    ##########################################################################################################
+
+    "paste containers" {
+        # The maximum capacity of a tier 1 (iron) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T1 Container Capacity"=512
+
+        # The maximum capacity of a tier 2 (gold) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T2 Container Capacity"=2048
+
+        # The maximum capacity of a tier 3 (diamond) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T3 Container Capacity"=8192
+    }
+
+}
+
+

config/CookingForBlockheadsCompat/actuallyadditions.json

@@ -0,0 +1,28 @@
+{
+    "modid": "actuallyadditions",
+    "foods": {
+        "INGREDIENTS": [
+            "food_meatballs",
+            "item_food",
+            {
+                "item": "item_food",
+                "data": 8
+            },
+            {
+                "item": "item_food",
+                "data": 12
+            },
+            {
+                "item": "item_food",
+                "data": 14
+            },
+            {
+                "item": "item_food",
+                "data": 20
+            }
+        ]
+    },
+    "oven_recipes": {
+        "item_food:14": "cooked_omelet"
+    }
+}

config/CookingForBlockheadsCompat/betterwithaddons.json

@@ -0,0 +1,27 @@
+{
+    "modid": "betterwithaddons",
+    "foods": {
+        "INGREDIENTS": [
+            "food_ground_meat",
+            "unbaked",
+            {
+                "item": "unbaked",
+                "data": 1
+            },
+            {
+                "item": "unbaked",
+                "data": 2
+            },
+            {
+                "item": "unbaked",
+                "data": 3
+            }
+        ]
+    },
+    "oven_recipes": {
+        "unbaked": "food_pie_melon",
+        "unbaked:1": "food_pie_meat",
+        "unbaked:2": "food_pie_mushroom",
+        "unbaked:3": "food_pie_amanita"
+    }
+}

config/CookingForBlockheadsCompat/betterwithmods.json

@@ -0,0 +1,24 @@
+{
+    "modid": "betterwithmods",
+    "foods": {
+        "INGREDIENTS": [
+            "raw_egg",
+            "raw_kebab",
+            "raw_omelet",
+            "raw_pastry",
+            "raw_scrambled_egg",
+            {
+                "item": "raw_pastry",
+                "data": 1
+            },
+            {
+                "item": "raw_pastry",
+                "data": 2
+            }
+        ]
+    },
+    "oven_recipes": {
+        "raw_omelet": "cooked_omelet",
+        "raw_pastry:4": "apple_pie"
+    }
+}

config/CookingForBlockheadsCompat/horsepower.json

@@ -0,0 +1,15 @@
+{
+  "modid": "horsepower",
+  "foods": {
+    "INGREDIENTS": [
+      "flour",
+      "dough"
+    ]
+  },
+  "oven_fuel": [
+    {
+      "item": "hand_grindstone",
+      "value": 100
+    }
+  ]
+}

config/CookingForBlockheadsCompat/rustic.json

@@ -0,0 +1,9 @@
+{
+    "modid": "rustic",
+    "foods": {
+        "INGREDIENTS": [
+            "chili_pepper",
+            "tomato"
+        ]
+    }
+}

config/CustomMainMenu/mainmenu.json

@@ -0,0 +1,145 @@
+{
+    "images":
+    {
+        "title":
+        {
+            "image" : "test:textures/gui/title/background/alpha.png",
+            "posX" : -137,
+            "posY" : 30,
+            "width" : 512,
+            "height" : 512,
+            "alignment" : "top_center"
+        }
+    },
+    
+    "buttons":
+    {
+        "singleplayer":
+        {
+            "text" : "menu.singleplayer",
+            "texture" : "test:textures/gui/title/background/longbutton.png",
+            "posX" : -100,
+            "posY" : 25,
+            "width" : 200,
+            "height" : 20,
+            "alignment" : "center",
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "singleplayer"
+            }
+        },
+        
+        "multiplayer":
+        {
+            "text" : "menu.multiplayer",
+            "texture" : "test:textures/gui/title/background/longbutton.png",            
+            "posX" : -100,
+            "posY" : 48,
+            "width" : 200,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "multiplayer"
+            }
+        },
+        
+        "mods":
+        {
+            "text" : "fml.menu.mods",
+            "texture" : "test:textures/gui/title/background/longbutton.png",            
+            "posX" : -100,
+            "posY" : 71,
+            "width" : 200,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "mods"
+            }
+        },
+            
+        "options":
+        {
+            "text" : "menu.options",
+            "texture" : "test:textures/gui/title/background/shortbutton.png",            
+            "posX" : -100,
+            "posY" : 94,
+            "width" : 98,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "options"
+            }
+        },
+        
+        "quit":
+        {
+            "text" : "menu.quit",
+            "texture" : "test:textures/gui/title/background/shortbutton.png",            
+            "posX" : 2,
+            "posY" : 94,
+            "width" : 98,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "quit"
+            }
+        },
+        
+        "language":
+        {
+            "text" : " ",
+            "texture" : "test:textures/gui/title/background/lang.png",            
+            "posX" : -124,
+            "posY" : 94,
+            "width" : 20,
+            "height" : 20,
+            "alignment" : "center",            
+            "imageWidth": "40",
+            "imageHeight": "40",
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "languages"
+            }
+        }
+    },
+    
+    "labels":
+    {
+        "mojang":
+        {
+            "text" : "Copyright Mojang AB. Do not distribute!",
+            "posX" : -197,
+            "posY" : -10,
+            "color" : -1,
+            "alignment" : "bottom_right"
+        },
+        
+        "fml":
+        {
+            "text" : "",
+            "posX" : 2,
+            "posY" : -40,
+            "color" : -1,
+            "alignment" : "bottom_left"
+        }
+    },
+        
+    "other":
+    {
+        "background":
+        {
+            "image" : "test:textures/gui/title/background/background.png",
+            "mode" : "stretch"
+            }
+        }
+    }
+}

config/ElevatorMod/ElevatorMod.cfg

@@ -0,0 +1,14 @@
+# Configuration file
+
+general {
+    # Can mobs spawn in elevators ? [default: true]
+    B:mobSpawn=true
+
+    # Realign players after teleporting to the center of elevator ? [default: true]
+    B:precisionTarget=true
+
+    # Should elevators have the same color to teleport ? [default: true]
+    B:sameColor=true
+}
+
+

config/FBP/AnimBlockExceptions.txt

@@ -0,0 +1,21 @@
+minecraft:vine
+minecraft:barrier
+minecraft:standing_banner
+minecraft:cobblestone_wall
+minecraft:chest
+minecraft:ender_chest
+minecraft:trapped_chest
+minecraft:wooden_door
+minecraft:birch_door
+minecraft:spruce_door
+minecraft:dark_oak_door
+minecraft:jungle_door
+minecraft:stone
+minecraft:skull
+minecraft:wall_banner
+minecraft:air
+minecraft:standing_sign
+minecraft:wall_sign
+minecraft:iron_door
+minecraft:acacia_door
+minecraft:bed

config/FBP/FloatingMaterials.txt

@@ -0,0 +1,35 @@
+grass=false
+ground=false
+wood=true
+rock=false
+iron=false
+anvil=false
+water=false
+lava=false
+leaves=true
+plants=true
+vine=false
+sponge=false
+cloth=false
+fire=false
+sand=false
+circuits=false
+carpet=true
+glass=false
+redstone_light=false
+tnt=false
+coral=false
+ice=true
+packed_ice=false
+snow=false
+crafted_snow=false
+cactus=false
+clay=false
+gourd=false
+dragon_egg=false
+portal=false
+cake=false
+web=true
+piston=false
+barrier=false
+structure_void=false

config/FBP/Particle.properties

@@ -0,0 +1,29 @@
+enabled=true
+weatherParticleDensity=1.0
+particlesPerAxis=4
+restOnFloor=true
+waterPhysics=true
+fancyFlame=true
+fancySmoke=true
+fancyRain=false
+fancySnow=true
+spawnPlaceParticles=true
+fancyPlaceAnim=false
+animSmoothLighting=false
+smartBreaking=true
+lowTraction=false
+bounceOffWalls=true
+showInMillis=false
+randomRotation=true
+cartoonMode=false
+entityCollision=false
+randomizedScale=true
+randomFadingSpeed=true
+spawnRedstoneBlockParticles=false
+spawnWhileFrozen=true
+infiniteDuration=false
+minAge=10
+maxAge=55
+scaleMult=0.75
+gravityMult=1.0
+rotationMult=1.0

config/FarmingForBlockheads/Market.json

@@ -0,0 +1,49 @@
+{
+  "defaults": {
+    "__comment": "You can disable defaults by setting these to false. Do *NOT* try to add additional entries here. You can add additional entries in the custom section.",
+    "Vanilla Seeds": true,
+    "Natura Saplings": true,
+    "Vanilla Saplings": true,
+    "Bonemeal": true,
+    "Animal Eggs": false,
+    "Natura Seeds": true,
+    "Vanilla Flowers": false,
+    "Natura Bushes": false,
+    "Vanilla Mushrooms": false,
+    "Natura Nether Bushes": false
+  },
+  "defaults payment": {
+    "__comment": "You can define custom payment items for the default entries here.",
+    "Vanilla Seeds": "1*minecraft:gold_ingot:0",
+    "Natura Saplings": "1*minecraft:gold_ingot:0",
+    "Vanilla Saplings": "1*minecraft:gold_ingot:0",
+    "Bonemeal": "1*minecraft:gold_ingot:0",
+    "Animal Eggs": "1*minecraft:gold_ingot:0",
+    "Natura Seeds": "1*minecraft:emerald:0",
+    "Vanilla Flowers": "1*minecraft:emerald:0",
+    "Natura Bushes": "2*minecraft:emerald:0",
+    "Vanilla Mushrooms": "1*minecraft:emerald:0",
+    "Natura Nether Bushes": "3*minecraft:emerald:0"
+  },
+  "defaults blacklist": [
+    "examplemod:example_item"
+  ],
+  "custom entries": {
+    "__comment": "You can define additional items to be sold by the Market here. Defaults can be overridden. Prefix with ! to blacklist instead.",
+    "immersiveengineering:seed": "2*minecraft:gold_ingot",
+    "abyssalcraft:shoggothflesh": "24*abyssalcraft:stone:7",
+    "primal:corn_seeds": "8*actuallyadditions:item_fertilizer"
+  },
+  "defaults amount": {
+    "Vanilla Seeds": 1,
+    "Natura Saplings": 1,
+    "Vanilla Saplings": 1,
+    "Bonemeal": 1,
+    "Animal Eggs": 1,
+    "Natura Seeds": 1,
+    "Vanilla Flowers": 1,
+    "Natura Bushes": 1,
+    "Vanilla Mushrooms": 1,
+    "Natura Nether Bushes": 1
+  }
+}

config/Galacticraft/chunkloading.conf

@@ -0,0 +1,8 @@
+# Configuration file
+
+chunkloading {
+    # If you don't want each player's chunks to load when they log in, set to false.
+    B:LoadOnLogin=true
+}
+
+

config/Galacticraft/core.conf

@@ -0,0 +1,458 @@
+# Configuration file
+
+achievements {
+    # Base Achievement ID. All achievement IDs will start at this number.
+    I:idAchievBase=1784
+}
+
+
+client {
+    # Setting this to false will revert night skies back to default minecraft star count
+    B:"More Stars"=true
+
+    # If you have FPS problems, setting this to true will help if rocket particles are in your sights
+    B:"Disable Spaceship Particles"=false
+
+    # If you're using this mod in virtual reality, or if you don't want the camera changes when entering a Galacticraft vehicle, set this to true.
+    B:"Disable Vehicle Third-Person and Zoom"=false
+
+    # If true, this will move the Oxygen Indicator to the left side. You can combine this with "Minimap Bottom"
+    B:"Minimap Left"=false
+
+    # If true, this will move the Oxygen Indicator to the bottom. You can combine this with "Minimap Left"
+    B:"Minimap Bottom"=true
+
+    # By default, Galacticraft will override capes with the mod's donor cape. Set to false to disable.
+    B:"Override Capes"=true
+}
+
+
+compatibility {
+    # Set to true to make Galacticraft oil register as oilgc, for backwards compatibility with previously generated worlds.
+    B:"Use legacy oilgc fluid registration"=false
+
+    # Set to true to make Galacticraft fuel register as fuelgc, for backwards compatibility with previously generated worlds.
+    B:"Use legacy fuelgc fluid registration"=false
+
+    # List non-opaque blocks from other mods (for example, special types of glass) that the Oxygen Sealer should recognize as solid seals. Format is BlockName or BlockName:metadata
+    S:"External Sealable IDs" <
+        actuallyadditions:block_greenhouse_glass:0
+        chisel:glass:0
+        chisel:glass:1
+        chisel:glass:2
+        chisel:glass:3
+        chisel:glass:4
+        chisel:glass:5
+        chisel:glass:6
+        chisel:glass:7
+        chisel:glass:8
+        chisel:glass:9
+        chisel:glass:10
+        chisel:glass:11
+        chisel:glass:12
+        chisel:glass:13
+        chisel:glass:14
+        chisel:glass:15
+        chisel:glassdyedblack:0
+        chisel:glassdyedblack:1
+        chisel:glassdyedblack:2
+        chisel:glassdyedblack:3
+        chisel:glassdyedblack:4
+        chisel:glassdyedblack:5
+        chisel:glassdyedblue:0
+        chisel:glassdyedblue:1
+        chisel:glassdyedblue:2
+        chisel:glassdyedblue:3
+        chisel:glassdyedblue:4
+        chisel:glassdyedblue:5
+        chisel:glassdyedbrown:0
+        chisel:glassdyedbrown:1
+        chisel:glassdyedbrown:2
+        chisel:glassdyedbrown:3
+        chisel:glassdyedbrown:4
+        chisel:glassdyedbrown:5
+        chisel:glassdyedcyan:0
+        chisel:glassdyedcyan:1
+        chisel:glassdyedcyan:2
+        chisel:glassdyedcyan:3
+        chisel:glassdyedcyan:4
+        chisel:glassdyedcyan:5
+        chisel:glassdyedgray:0
+        chisel:glassdyedgray:1
+        chisel:glassdyedgray:2
+        chisel:glassdyedgray:3
+        chisel:glassdyedgray:4
+        chisel:glassdyedgray:5
+        chisel:glassdyedgreen:0
+        chisel:glassdyedgreen:1
+        chisel:glassdyedgreen:2
+        chisel:glassdyedgreen:3
+        chisel:glassdyedgreen:4
+        chisel:glassdyedgreen:5
+        chisel:glassdyedlightblue:0
+        chisel:glassdyedlightblue:1
+        chisel:glassdyedlightblue:2
+        chisel:glassdyedlightblue:3
+        chisel:glassdyedlightblue:4
+        chisel:glassdyedlightblue:5
+        chisel:glassdyedlightgray:0
+        chisel:glassdyedlightgray:1
+        chisel:glassdyedlightgray:2
+        chisel:glassdyedlightgray:3
+        chisel:glassdyedlightgray:4
+        chisel:glassdyedlightgray:5
+        chisel:glassdyedlime:0
+        chisel:glassdyedlime:1
+        chisel:glassdyedlime:2
+        chisel:glassdyedlime:3
+        chisel:glassdyedlime:4
+        chisel:glassdyedlime:5
+        chisel:glassdyedmagenta:0
+        chisel:glassdyedmagenta:1
+        chisel:glassdyedmagenta:2
+        chisel:glassdyedmagenta:3
+        chisel:glassdyedmagenta:4
+        chisel:glassdyedmagenta:5
+        chisel:glassdyedorange:0
+        chisel:glassdyedorange:1
+        chisel:glassdyedorange:2
+        chisel:glassdyedorange:3
+        chisel:glassdyedorange:4
+        chisel:glassdyedorange:5
+        chisel:glassdyedpink:0
+        chisel:glassdyedpink:1
+        chisel:glassdyedpink:2
+        chisel:glassdyedpink:3
+        chisel:glassdyedpink:4
+        chisel:glassdyedpink:5
+        chisel:glassdyedpurple:0
+        chisel:glassdyedpurple:1
+        chisel:glassdyedpurple:2
+        chisel:glassdyedpurple:3
+        chisel:glassdyedpurple:4
+        chisel:glassdyedpurple:5
+        chisel:glassdyedred:0
+        chisel:glassdyedred:1
+        chisel:glassdyedred:2
+        chisel:glassdyedred:3
+        chisel:glassdyedred:4
+        chisel:glassdyedred:5
+        chisel:glassdyedwhite:0
+        chisel:glassdyedwhite:1
+        chisel:glassdyedwhite:2
+        chisel:glassdyedwhite:3
+        chisel:glassdyedwhite:4
+        chisel:glassdyedwhite:5
+        chisel:glassdyedyellow:0
+        chisel:glassdyedyellow:1
+        chisel:glassdyedyellow:2
+        chisel:glassdyedyellow:3
+        chisel:glassdyedyellow:4
+        chisel:glassdyedyellow:5
+        chisel:ice:0
+        chisel:ice:1
+        chisel:ice:2
+        chisel:ice:3
+        chisel:ice:4
+        chisel:ice:5
+        chisel:ice:6
+        chisel:ice:7
+        chisel:ice:8
+        chisel:ice:9
+        chisel:ice:10
+        chisel:ice:11
+        chisel:ice:12
+        chisel:ice:13
+        chisel:ice:14
+        chisel:ice:15
+        chisel:ice1:0
+        chisel:ice1:1
+        chisel:ice1:2
+        chisel:ice1:3
+        chisel:ice1:4
+        chisel:ice1:5
+        chisel:ice1:6
+        chisel:ice1:7
+        chisel:ice1:8
+        chisel:ice1:9
+        chisel:ice1:10
+        chisel:ice1:11
+        chisel:ice1:12
+        chisel:ice1:13
+        chisel:ice1:14
+        chisel:ice1:15
+        chisel:ice2:0
+        chisel:icepillar:0
+        chisel:icepillar:1
+        chisel:icepillar:2
+        chisel:icepillar:3
+        chisel:icepillar:4
+        chisel:icepillar:5
+        chisel:icepillar:6
+        ferdinandsflowers:block_dye_glass:0
+        ferdinandsflowers:block_dye_glass:1
+        ferdinandsflowers:block_dye_glass:2
+        ferdinandsflowers:block_dye_glass:3
+        ferdinandsflowers:block_dye_glass:4
+        ferdinandsflowers:block_dye_glass:5
+        ferdinandsflowers:block_dye_glass:6
+        ferdinandsflowers:block_dye_glass:7
+        ferdinandsflowers:block_dye_glass:8
+        ferdinandsflowers:block_dye_glass:9
+        ferdinandsflowers:block_dye_glass:10
+        ferdinandsflowers:block_dye_glass:11
+        ferdinandsflowers:block_dye_glass:12
+        ferdinandsflowers:block_dye_glass:13
+        ferdinandsflowers:block_dye_glass:14
+        ferdinandsflowers:block_dye_glass:15
+        galacticraftplanets:dense_ice:0
+        immersiveengineering:stone_decoration:8
+        mekanism:basicblock:10
+        minecraft:ice:0
+        natura:nether_glass:0
+        natura:nether_glass:1
+        nex:soul_glass:0
+        primal:soulglass:0
+        tconstruct:clear_glass:0
+        tconstruct:clear_stained_glass:0
+        tconstruct:clear_stained_glass:1
+        tconstruct:clear_stained_glass:2
+        tconstruct:clear_stained_glass:3
+        tconstruct:clear_stained_glass:4
+        tconstruct:clear_stained_glass:5
+        tconstruct:clear_stained_glass:6
+        tconstruct:clear_stained_glass:7
+        tconstruct:clear_stained_glass:8
+        tconstruct:clear_stained_glass:9
+        tconstruct:clear_stained_glass:10
+        tconstruct:clear_stained_glass:11
+        tconstruct:clear_stained_glass:12
+        tconstruct:clear_stained_glass:13
+        tconstruct:clear_stained_glass:14
+        tconstruct:clear_stained_glass:15
+        tconstruct:seared_glass:0
+     >
+
+    # List blocks from other mods that the Sensor Glasses should recognize as solid blocks. Format is BlockName or BlockName:metadata.
+    S:"External Detectable IDs" <
+        coal_ore
+        diamond_ore
+        gold_ore
+        iron_ore
+        lapis_ore
+        lit_redstone_ore
+        redstone_ore
+     >
+
+    # Enable this if the standard canister recipe causes a conflict.
+    B:"Alternate recipe for canisters"=false
+
+    # This needs to match the OreDictionary name used in the other mod. Set a nonsense name to disable.
+    S:"OreDict name of other mod's silicon"=itemSilicon
+
+    # Should normally be true. If you set this to false, in a modpack with other mods with the same metals, players may be able to craft advanced GC items without travelling to Moon, Mars, Asteroids etc.
+    B:"Must use GC's own space metals in recipes"=true
+
+    # The normal factor is 1.  Increase this to 2 - 5 if other mods with a lot of oil (e.g. BuildCraft) are installed to increase GC rocket fuel requirement.
+    I:"Rocket fuel factor"=1
+}
+
+
+controls {
+    # Increase to make the mouse drag scroll more sensitive, decrease to lower sensitivity.
+    D:"Map Scroll Mouse Sensitivity"=1.0
+
+    # Set to true to invert the mouse scroll feature on the galaxy map.
+    B:"Map Scroll Mouse Invert"=false
+}
+
+
+difficulty {
+    # Spaceships will not explode on contact if set to true.
+    B:"Disable Spaceship Explosion"=true
+
+    # Solar panels will work (default 2x) more effective on space stations.
+    D:"Space Station Solar Energy Multiplier"=2.0
+
+    # Set this to true for less metal use in Galacticraft recipes (makes the game easier).
+    B:"Quick Game Mode"=true
+
+    # Set this to true for increased difficulty in modpacks (see forum for more info).
+    B:"Harder Difficulty"=false
+
+    # Set this to true for a challenging adventure where the player starts the game stranded in the Asteroids dimension with low resources (only effective if Galacticraft Planets installed).
+    B:"Adventure Game Mode"=false
+
+    # Add together flags 8, 4, 2, 1 to enable the four elements of adventure game mode. Default 15.  1 = extended compressor recipes.  2 = mob drops and spawning.  4 = more trees in hollow asteroids.  8 = start stranded in Asteroids.
+    I:"Adventure Game Mode Flags"=15
+
+    # Lower/Raise this value to change time between suffocation damage ticks (allowed range 50-250)
+    I:"Suffocation Cooldown"=100
+
+    # Change this value to modify the damage taken per suffocation tick
+    I:"Suffocation Damage"=2
+
+    # Change this if you wish to balance the mod (if you have more powerful weapon mods).
+    D:"Dungeon Boss Health Modifier"=1.0
+
+    # Set to a value between 0.0 and 1.0 to decrease meteor spawn chance (all dimensions).
+    D:"Meteor Spawn Modifier"=8.5
+
+    # Set to false to stop meteors from breaking blocks on contact.
+    B:"Meteor Block Damage Enabled"=true
+}
+
+
+dimensions {
+    # Dimension ID for the Overworld (as seen in the Celestial Map)
+    I:idDimensionOverworld=0
+
+    # Dimension ID for the Moon
+    I:idDimensionMoon=-28
+
+    # WorldProvider ID for Overworld Space Stations (advanced: do not change unless you have conflicts)
+    I:idDimensionOverworldOrbit=-27
+
+    # WorldProvider ID for Static Space Stations (advanced: do not change unless you have conflicts)
+    I:idDimensionOverworldOrbitStatic=-26
+
+    # Biome ID for Moon (Mars will be this + 1, Asteroids + 2 etc). Allowed range 40-250.
+    I:biomeIDBase=102
+
+    # IDs to load at startup, and keep loaded until server stops. Can be added via /gckeeploaded
+    I:"Static Loaded Dimensions" <
+     >
+
+    # Set this to true to have an automatic /gckeeploaded for any new Space Station created.
+    B:"Set new Space Stations to be static loaded"=false
+
+    # IDs of dimensions where rockets should not launch - this should always include the Nether.
+    S:"Dimensions where rockets cannot launch" <
+        1
+        -1
+        144
+        10
+     >
+
+    # If true, rockets will be unable to reach the Overworld (only use this in special modpacks!)
+    B:"Disable rockets from returning to Overworld"=false
+}
+
+
+general {
+    # If this is enabled, debug messages will appear in the console. This is useful for finding bugs in the mod.
+    B:"Enable Debug Messages"=false
+
+    # By default, you will respawn on Galacticraft dimensions if you die. If you are dying over and over on a planet, set this to true, and you will respawn back on the Overworld.
+    B:"Force Overworld Spawn"=false
+
+    # If this is true, the player will parachute onto the Moon instead - use only in debug situations.
+    B:"Disable lander on Moon and other planets"=false
+
+    # Update check will not run if this is set to true.
+    B:"Disable Update Check"=true
+
+    # Liquids will not flow into Grating block if this is set to false.
+    B:"Allow liquids into Gratings"=true
+
+    # Space Race Manager will show on-screen after login, if enabled.
+    B:"Enable Space Race Manager Popup"=false
+}
+
+
+keybindings_initial {
+    # Default Map key on first Galacticraft run only. After first run, change keys by Minecraft in-game Controls menu.  Valid settings: KEY_ followed by 0-9 or A-Z.
+    S:"Open Galaxy Map"=KEY_M
+
+    # Default Rocket/Fuel key on first Galacticraft run only. After first run, change keys by Minecraft in-game Controls menu.  Valid settings: KEY_ followed by 0-9 or A-Z.
+    S:"Open Rocket GUI"=KEY_G
+
+    # Default Goggles key on first Galacticraft run only. After first run, change keys by Minecraft in-game Controls menu.  Valid settings: KEY_ followed by 0-9 or A-Z.
+    S:"Toggle Advanced Goggles"=KEY_K
+}
+
+
+schematic {
+    # Schematic ID for Tier 1 Rocket, must be unique.
+    I:idSchematicRocketT1=0
+
+    # Schematic ID for Moon Buggy, must be unique.
+    I:idSchematicMoonBuggy=1
+
+    # Schematic ID for "Add Schematic" Page, must be unique
+    I:idSchematicAddSchematic=2147483647
+}
+
+
+server {
+    # Set this to 0 for no borders (default).  If set to e.g. 2000, players will land on the Moon inside the x,z range -2000 to 2000.)
+    I:"World border for landing location on other planets (Moon, Mars, etc)"=0
+
+    # While true, space stations require you to invite other players using /ssinvite <playername>
+    B:"Space Stations Require Permission"=true
+
+    # If set to true on a server, players will be completely unable to create space stations.
+    B:"Disable Space Station creation"=false
+
+    # If this is enabled, areas sealed by Oxygen Sealers will run a seal check when the player breaks or places a block (or on block updates).  This should be enabled for a 100% accurate sealed status, but can be disabled on servers for performance reasons.
+    B:"Enable Sealed edge checks"=true
+}
+
+
+worldgen {
+    # Increasing this will increase amount of oil that will generate in each chunk.
+    D:"Oil Generation Factor"=1.8
+
+    # List of non-galacticraft dimension IDs to generate oil in.
+    I:"Oil gen in external dimensions" <
+     >
+
+    # If this is enabled, GC oil will be added to existing Overworld maps where possible.
+    B:"Retro Gen of GC Oil in existing map chunks"=false
+
+    # If this is enabled, copper ore will generate on the overworld.
+    B:"Enable Copper Ore Gen"=false
+
+    # If this is enabled, tin ore will generate on the overworld.
+    B:"Enable Tin Ore Gen"=false
+
+    # If this is enabled, aluminum ore will generate on the overworld.
+    B:"Enable Aluminum Ore Gen"=false
+
+    # If this is enabled, silicon ore will generate on the overworld.
+    B:"Enable Silicon Ore Gen"=false
+
+    # Disable Cheese Ore Gen on Moon.
+    B:"Disable Cheese Ore Gen on Moon"=false
+
+    # Disable Tin Ore Gen on Moon.
+    B:"Disable Tin Ore Gen on Moon"=false
+
+    # Disable Copper Ore Gen on Moon.
+    B:"Disable Copper Ore Gen on Moon"=false
+
+    # Disable Sapphire Ore Gen on Moon.
+    B:"Disable Sapphire Ore Gen on Moon"=false
+
+    # If true, moon villages will not generate.
+    B:"Disable Moon Village Gen"=false
+
+    # If this is enabled, other mods' standard ores and all other features (eg. plants) can generate on the Moon and planets. Apart from looking wrong, this make cause 'Already Decorating!' type crashes.  NOT RECOMMENDED!  See Wiki.
+    B:"Generate all other mods features on planets"=false
+
+    # If generate other mods features is disabled as recommended, this setting can whitelist CoFHCore custom worldgen on planets.
+    B:"Whitelist CoFHCore worldgen to generate its ores and lakes on planets"=false
+
+    # If ThaumCraft is installed, ThaumCraft wild nodes can generate on the Moon and planets.
+    B:"Generate ThaumCraft wild nodes on planetary surfaces"=false
+
+    # Enter IDs of other mods' ores here for Galacticraft to generate them on the Moon and other planets. Format is BlockName or BlockName:metadata. Use optional parameters at end of each line: /RARE /UNCOMMON or /COMMON for rarity in a chunk; /DEEP /SHALLOW or /BOTH for height; /SINGLE /STANDARD or /LARGE for clump size; /XTRARANDOM for ores sometimes there sometimes not at all.  /ONLYMOON or /ONLYMARS if wanted on one planet only.  If nothing specified, defaults are /COMMON, /BOTH and /STANDARD.  Repeat lines to generate a huge quantity of ores.
+    S:"Other mods ores for GC to generate on the Moon and planets" <
+        contenttweaker:sub_block_holder_0:7 /ONLYMARS /DEEP /LARGE
+     >
+
+    # Biome Types will not be registered in the BiomeDictionary if this is set to true.
+    B:"Disable Biome Type Registrations"=false
+}
+
+

config/Galacticraft/miccore.conf

@@ -0,0 +1,11 @@
+# Configuration file
+
+general {
+    # Enable debug messages during Galacticraft bytecode injection at startup.
+    B:"Enable Debug messages"=false
+
+    # This will cause some dimensions to appear round, disable if render transformations cause a conflict.
+    B:"Enable Small Moons"=true
+}
+
+

config/Galacticraft/planets.conf

@@ -0,0 +1,92 @@
+# Configuration file
+
+dimensions {
+    # Dimension ID for Mars
+    I:dimensionIDMars=-29
+
+    # Dimension ID for Asteroids
+    I:dimensionIDAsteroids=-30
+
+    # Dimension ID for Venus
+    I:dimensionIDVenus=-31
+}
+
+
+general {
+    # Whether or not the launch controller acts as a chunk loader. Will cause issues if disabled!
+    B:launchControllerChunkLoad=true
+
+    # May rarely cause issues if enabled, depends on how the other mod's dimensions are.
+    B:launchControllerAllDims=false
+
+    # Option to disable Helium gas in Galacticraft (because it will be registered by another mod eg GregTech).
+    B:disableGalacticraftHelium=false
+
+    # Maximum number of Astro Miners each player is allowed to have active (default 6).
+    I:maximumAstroMiners=6
+
+    # Option to disable small asteroids from spawning in the Asteroids Dimension.
+    B:disableSmallAsteroids=false
+
+    # Disables background thunder and lightning.
+    B:disableAmbientLightning=false
+}
+
+
+schematic {
+    # Schematic ID for Tier 2 Rocket, must be unique.
+    I:idSchematicRocketT2=2
+
+    # Schematic ID for Cargo Rocket, must be unique.
+    I:idSchematicCargoRocket=3
+
+    # Schematic ID for Tier 3 Rocket, must be unique.
+    I:idSchematicRocketT3=4
+}
+
+
+worldgen {
+    # Disable Iron Ore Gen on Mars.
+    B:"Disable Iron Ore Gen on Mars"=false
+
+    # Disable Copper Ore Gen on Mars.
+    B:"Disable Copper Ore Gen on Mars"=false
+
+    # Disable Tin Ore Gen on Mars.
+    B:"Disable Tin Ore Gen on Mars"=false
+
+    # Disable Desh Ore Gen on Mars.
+    B:"Disable Desh Ore Gen on Mars"=false
+
+    # Disable Iron Ore Gen on Asteroids.
+    B:"Disable Iron Ore Gen on Asteroids"=false
+
+    # Disable Aluminum Ore Gen on Asteroids.
+    B:"Disable Aluminum Ore Gen on Asteroids"=false
+
+    # Disable Ilmenite Ore Gen on Asteroids.
+    B:"Disable Ilmenite Ore Gen on Asteroids"=false
+
+    # Disable Aluminum Ore Gen on Venus.
+    B:"Disable Aluminum Ore Gen on Venus"=false
+
+    # Disable Copper Ore Gen on Venus.
+    B:"Disable Copper Ore Gen on Venus"=false
+
+    # Disable Galena Ore Gen on Venus.
+    B:"Disable Galena Ore Gen on Venus"=false
+
+    # Disable Quartz Ore Gen on Venus.
+    B:"Disable Quartz Ore Gen on Venus"=false
+
+    # Disable Silicon Ore Gen on Venus.
+    B:"Disable Silicon Ore Gen on Venus"=false
+
+    # Disable Tin Ore Gen on Venus.
+    B:"Disable Tin Ore Gen on Venus"=false
+
+    # Disable Solar Ore Gen on Venus.
+    B:"Disable Solar Ore Gen on Venus"=false
+}
+
+

config/Galacticraft/power-GC3.conf

@@ -0,0 +1,30 @@
+# Configuration file
+
+compatibility {
+    D:"BuildCraft Conversion Ratio"=16.0
+    B:"Disable INPUT of BuildCraft energy"=false
+    B:"Disable INPUT of Forge Energy to GC machines"=false
+    B:"Disable INPUT of IC2 energy"=false
+    B:"Disable INPUT of Mekanism energy"=false
+    B:"Disable INPUT of RF energy"=false
+    B:"Disable OUTPUT of BuildCraft energy"=false
+    B:"Disable OUTPUT of Forge Energy from GC machines"=false
+    B:"Disable OUTPUT of IC2 energy"=false
+    B:"Disable OUTPUT of Mekanism energy"=false
+    B:"Disable OUTPUT of RF energy"=false
+    B:"Disable old Buildcraft API (MJ) interfacing completely?"=false
+    D:"IndustrialCraft Conversion Ratio"=6.557376861572266
+    I:"Loss factor when converting energy as a percentage (100 = no loss, 90 = 10% loss ...)"=100
+    D:"Mekanism Conversion Ratio"=0.6557376980781555
+    D:"RF Conversion Ratio"=1.600000023841858
+}
+
+
+display {
+    B:"If BuildCraft is loaded, show Galacticraft machines energy as MJ instead of gJ?"=false
+    B:"If IndustrialCraft2 is loaded, show Galacticraft machines energy as EU instead of gJ?"=false
+    B:"If Mekanism is loaded, show Galacticraft machines energy as Joules (J) instead of gJ?"=false
+    B:"Show Galacticraft machines energy in RF instead of gJ?"=true
+}
+
+

config/Guide-API/Guide-API.cfg

@@ -0,0 +1,48 @@
+# Configuration file
+
+##########################################################################################################
+# books
+#--------------------------------------------------------------------------------------------------------#
+# All settings related to Books.
+##########################################################################################################
+
+books {
+    # Allows books to spawn with new players.
+    # This is a global override for all books. [default: true]
+    B:canSpawnWithBooks=false
+
+    ##########################################################################################################
+    # spawn
+    #--------------------------------------------------------------------------------------------------------#
+    # If true, the user will spawn with the book.
+    # This defaults to the value the book owner has set and is overridden by this config.
+    ##########################################################################################################
+
+    spawn {
+        #  [default: false]
+        B:"bloodmagic:guide"=false
+        B:"crossroads:crossroadsmainguide"=false
+        B:"crossroads:info_guide"=false
+
+        #  [default: true]
+        B:"cyclicmagic:guide"=false
+
+        #  [default: false]
+        B:"modularrouters:guidebook"=false
+    }
+
+}
+
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# Miscellaneous settings.
+##########################################################################################################
+
+general {
+    # Enables extra information being printed to the console. [default: true]
+    B:enableLogging=false
+}
+
+

config/InvTweaks/InvTweaks.cfg

@@ -0,0 +1,23 @@
+#Inventory Tweaks Configuration
+#(Regarding shortcuts, all key names can be found at: http://legacy.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html)
+#Mon Dec 13 19:08:47 EST 2021
+enableMiddleClick=true
+showChestButtons=true
+enableSortingOnPickup=false
+enableAutoRefill=true
+autoRefillBeforeBreak=false
+autoRefillDamageThreshhold=5
+enableSounds=true
+enableShortcuts=true
+enableAutoEquipArmor=false
+enableServerItemSwap=true
+enableConfigLoadedMesssage=false
+invertToolDamageSorting=true
+shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT
+shortcutKeyEverything=SPACE
+shortcutKeyOneItem=LCONTROL, RCONTROL
+shortcutKeyToUpperSection=UP
+shortcutKeyToLowerSection=DOWN
+shortcutKeyDrop=LALT, RALT
+enableToolTipTreePath=false
+version=1.64+dev.151.822d839

config/InvTweaks/InvTweaksRules.txt

@@ -0,0 +1,31 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can add it there.

config/InvTweaks/trees/readme.txt

@@ -0,0 +1,5 @@
+You may add additional ".tree" files to this folder and they will be merged into either the "minecraft.tree" file if it is in this folder or the normal InvTweakTree.txt file if "minecraft.tree" does not exist.  These tree files have the same structure as the InvTweakTree.txt file, and matching categories will be merged into one with nodes from the new tree file being added to the end of the matching category.
+
+You can find tree files maintained by IMarvinTPA at https://github.com/IMarvinTPA/InventoryTweaksTrees
+
+

config/InvTweaksRules.txt

@@ -0,0 +1,31 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can add it there.

config/Mercurius.cfg

@@ -0,0 +1,448 @@
+# Configuration file
+
+general {
+    S:modPack=SevTech-Ages
+    S:modPackVersion=3.2.1
+    B:spammyLogs=false
+
+    optout {
+        B:OS=false
+        B:clientTime=false
+        B:environment=false
+        B:installID=false
+        B:javaVersion=false
+        B:minecraftVersion=false
+        B:modPack=false
+        B:modPackVersion=false
+        B:ramAllocated=false
+        B:ramMax=false
+        B:sessionID=false
+
+        mods {
+            B:FML=false
+            B:abyssalcraft=false
+            B:acintegration=false
+            B:actuallyadditions=false
+            B:actuallybaubles=false
+            B:adchimneys=false
+            B:advancedmortars=false
+            B:advancedrocketry=false
+            B:advancedrocketrycore=false
+            B:advgenerators=false
+            B:ae2stuff=false
+            B:animalium=false
+            B:animania=false
+            B:antiqueatlas=false
+            B:antiqueatlasoverlay=false
+            B:applecore=false
+            B:appleskin=false
+            B:appliedenergistics2=false
+            B:appliedenergistics2-core=false
+            B:aquamunda=false
+            B:arcanum=false
+            B:armoreablemobs=false
+            B:aroma1997core=false
+            B:aromabackup=false
+            B:aromabackuprecovery=false
+            B:astikoor=false
+            B:astikorcarts=false
+            B:astralsorcery=false
+            B:atmlib=false
+            B:autoreglib=false
+            B:autoverse=false
+            B:base=false
+            B:baubles=false
+            B:bdlib=false
+            B:bedbugs=false
+            B:bedrockbgone=false
+            B:bedrockores=false
+            B:beneath=false
+            B:betteradvancements=false
+            B:betterbedrock=false
+            B:betterbedrockgen=false
+            B:betterbuilderswands=false
+            B:betterfoliage=false
+            B:betterfonts=false
+            B:betterplacement=false
+            B:betterunderground=false
+            B:betterwithaddons=false
+            B:betterwithlib=false
+            B:betterwithmods=false
+            B:bibliocraft=false
+            B:bibliotheca=false
+            B:bloodmagic=false
+            B:blur=false
+            B:bnbgamingcore=false
+            B:bnbgaminglib=false
+            B:bonsaitrees=false
+            B:bookshelf=false
+            B:bottledmilk=false
+            B:bringbedrockback=false
+            B:buildcraftbuilders=false
+            B:buildcraftcore=false
+            B:buildcraftenergy=false
+            B:buildcraftfactory=false
+            B:buildcraftlib=false
+            B:buildcraftrobotics=false
+            B:buildcraftsilicon=false
+            B:buildcrafttransport=false
+            B:buildinggadgets=false
+            B:caliper=false
+            B:car=false
+            B:caravans=false
+            B:carryon=false
+            B:cavern=false
+            B:cd4017be_lib=false
+            B:ceramics=false
+            B:chameleon=false
+            B:charcoalblock=false
+            B:chargers=false
+            B:chesttransporter=false
+            B:chisel=false
+            B:chiselsandbits=false
+            B:chopdown=false
+            B:chunkanimator=false
+            B:clienttweaks=false
+            B:clumps=false
+            B:codechickenlib=false
+            B:coloredtooltips=false
+            B:colouredtooltips=false
+            B:com.elytradev.movingworld.common.asm.coremod=false
+            B:commoncapabilities=false
+            B:compactmachines3=false
+            B:compressions=false
+            B:conarm=false
+            B:containerfix=false
+            B:contenttweaker=false
+            B:controlling=false
+            B:cookingforblockheads=false
+            B:craftstudioapi=false
+            B:crafttweaker=false
+            B:crafttweakerjei=false
+            B:crossroads=false
+            B:csokicraftutil=false
+            B:csokicraftutil-11=false
+            B:ctgui=false
+            B:ctm=false
+            B:cucumber=false
+            B:cultivatedtech=false
+            B:custommainmenu=false
+            B:cyclicmagic=false
+            B:cyclopscore=false
+            B:darkutils=false
+            B:davincisvessels=false
+            B:death_compass=false
+            B:debugserverinfo=false
+            B:defaultoptions=false
+            B:despawningspawners=false
+            B:dimensionalcontrol=false
+            B:dimstages=false
+            B:dooglamooworlds=false
+            B:draftykites=false
+            B:dungpipe=false
+            B:ecomod=false
+            B:elevatorid=false
+            B:emberroot=false
+            B:embers=false
+            B:enchdesc=false
+            B:enderstorage=false
+            B:enderutilities=false
+            B:energyconverters=false
+            B:environmentaltech=false
+            B:examplemod=false
+            B:extendedcrafting=false
+            B:externaltweaker=false
+            B:extraplanets=false
+            B:factorytech=false
+            B:farmingforblockheads=false
+            B:farseek=false
+            B:fastbench=false
+            B:fastfurnace=false
+            B:fat_cat=false
+            B:fbp=false
+            B:fencejumper=false
+            B:ferdinandsflowers=false
+            B:ffs=false
+            B:findme=false
+            B:finite-water-control=false
+            B:flatbedrockx=false
+            B:flatcoloredblocks=false
+            B:foamfix=false
+            B:foamfixcore=false
+            B:forge=false
+            B:forgeendertech=false
+            B:forgelin=false
+            B:forgemultipartcbe=false
+            B:friendlyfire=false
+            B:fw=false
+            B:galacticraftcore=false
+            B:galacticraftplanets=false
+            B:galacticrafttweaker=false
+            B:gamestages=false
+            B:gardenstuff=false
+            B:geolosys=false
+            B:globalgamerules=false
+            B:glowing_dirtstone_reborn=false
+            B:gobblecore=false
+            B:gravestone=false
+            B:guideapi=false
+            B:hammercore=false
+            B:harvest=false
+            B:harvesttweaks=false
+            B:horsepower=false
+            B:huntingdim=false
+            B:iblis=false
+            B:ichunutil=false
+            B:igwmod=false
+            B:immcraft=false
+            B:immersiveengineering=false
+            B:immersivepetroleum=false
+            B:immersiverailroading=false
+            B:immersivetech=false
+            B:improvedbackpacks=false
+            B:incontrol=false
+            B:indlog=false
+            B:industrialforegoing=false
+            B:infinitefluids=false
+            B:infoaccessories=false
+            B:integrateddynamics=false
+            B:integrateddynamicscompat=false
+            B:integrationforegoing=false
+            B:inventorytweaks=false
+            B:ironbackpacks=false
+            B:ironchest=false
+            B:ironjetpacks=false
+            B:itemstages=false
+            B:ivtoolkit=false
+            B:jaff=false
+            B:jarm=false
+            B:jei=false
+            B:jeid=false
+            B:jeidsi=false
+            B:jeivillagers=false
+            B:jeresources=false
+            B:jmapstages=false
+            B:journeymap=false
+            B:jp.crafterkina.pipes=false
+            B:justenoughpetroleum=false
+            B:justthetips=false
+            B:keywizard=false
+            B:kleeslabs=false
+            B:laggoggles=false
+            B:legiblenei=false
+            B:lex=false
+            B:librarianlib=false
+            B:librarianliblate=false
+            B:libvulpes=false
+            B:loadingprofiler=false
+            B:loadingscreens=false
+            B:loottweaker=false
+            B:lostcities=false
+            B:lostsouls=false
+            B:lostthaumaturgy=false
+            B:lttweaker=false
+            B:magma_monsters=false
+            B:magnum=false
+            B:mantle=false
+            B:mcjtylib_ng=false
+            B:mcp=false
+            B:meecreeps=false
+            B:mekanism=false
+            B:mekatweaks=false
+            B:mercurius=false
+            B:micdoodlecore=false
+            B:microblockcbe=false
+            B:minecraft=false
+            B:minecraftmultipartcbe=false
+            B:missingtextures=false
+            B:mjrlegendslib=false
+            B:mob_grinding_utils=false
+            B:mobends=false
+            B:mobstages=false
+            B:modernconverter=false
+            B:moderncraftcore=false
+            B:modlistbuilder=false
+            B:modtweaker=false
+            B:modularmachinery=false
+            B:modularrouters=false
+            B:moreoverlays=false
+            B:morpheus=false
+            B:morphtool=false
+            B:mousetweaks=false
+            B:movillages=false
+            B:movingworld=false
+            B:mpbasic=false
+            B:mputils=false
+            B:mtlib=false
+            B:multiblockstages=false
+            B:mundaneredstone=false
+            B:mystagradcompat=false
+            B:mysticalagradditions=false
+            B:mysticalagriculture=false
+            B:natura=false
+            B:naturescompass=false
+            B:neat=false
+            B:nei=false
+            B:nex=false
+            B:nonausea=false
+            B:norecipebook=false
+            B:noworldgen5you=false
+            B:nuclearphysics=false
+            B:nutrition=false
+            B:oeintegration=false
+            B:omegacraft=false
+            B:openglider=false
+            B:oreexcavation=false
+            B:orestages=false
+            B:oretiers=false
+            B:overloaded=false
+            B:packetfilter=false
+            B:parrotpower=false
+            B:pdp=false
+            B:personalcars=false
+            B:pickletweaks=false
+            B:placebo=false
+            B:playerbosses=false
+            B:playerskins=false
+            B:pneumaticcraft=false
+            B:portalgun=false
+            B:poweradapters=false
+            B:prestige=false
+            B:primal=false
+            B:primal_tech=false
+            B:primalchests=false
+            B:progressiontweaks=false
+            B:progressivedifficulty=false
+            B:prospectors=false
+            B:quantumstorage=false
+            B:quark=false
+            B:quickleafdecay=false
+            B:randompatches=false
+            B:rangedpumps=false
+            B:realdrops=false
+            B:realtimeclock=false
+            B:reauth=false
+            B:reborncore=false
+            B:rebornstorage=false
+            B:reccomplex=false
+            B:recipestages=false
+            B:redstoneflux=false
+            B:refinedrelocation=false
+            B:refinedstorage=false
+            B:refinedstorageaddons=false
+            B:regressments=false
+            B:resourceloader=false
+            B:rftools=false
+            B:rftoolscontrol=false
+            B:roadrunner=false
+            B:roots=false
+            B:runesofwizardry=false
+            B:runesofwizardry_classics=false
+            B:rustic=false
+            B:sampler=false
+            B:samsocean=false
+            B:sasit=false
+            B:scannable=false
+            B:sev_tweaks_npc=false
+            B:sevpatches=false
+            B:sevtweaks=false
+            B:simpleautorun=false
+            B:simplegenerators=false
+            B:simpleplanes=false
+            B:simpletomb=false
+            B:simplyarrows=false
+            B:simplyconveyors=false
+            B:simplytea=false
+            B:skillable=false
+            B:smoothfont=false
+            B:smoothfontcore=false
+            B:soot=false
+            B:spartanshields=false
+            B:spatialservermod=false
+            B:stellarapi=false
+            B:stellarsky=false
+            B:stepup=false
+            B:stevescarts=false
+            B:stevesfactorymanager=false
+            B:stg=false
+            B:stickyfingers=false
+            B:storagedrawers=false
+            B:storagedrawersextra=false
+            B:storagenetwork=false
+            B:streams=false
+            B:structuredcrafting=false
+            B:sugiforest=false
+            B:supersoundmuffler=false
+            B:survivalist=false
+            B:tallgates=false
+            B:tcomplement=false
+            B:tconstruct=false
+            B:teslacorelib=false
+            B:teslacorelib_registries=false
+            B:"test mod"=false
+            B:texfix=false
+            B:thebetweenlands=false
+            B:thebomplugin=false
+            B:theoneprobe=false
+            B:thirstybottles=false
+            B:tickprofiler=false
+            B:timecontrol=false
+            B:tinker_io=false
+            B:tinkerstages=false
+            B:tinkertoolleveling=false
+            B:tips=false
+            B:tipthescales=false
+            B:toastcontrol=false
+            B:togetherforever=false
+            B:toolbelt=false
+            B:toolprogression=false
+            B:topography=false
+            B:totemic=false
+            B:tothebatpoles=false
+            B:tp=false
+            B:trackapi=false
+            B:translocator=false
+            B:translocators=false
+            B:trashslot=false
+            B:traverse=false
+            B:treechopper=false
+            B:triumph=false
+            B:trumpetskeleton=false
+            B:tumbleweed=false
+            B:twilightforest=false
+            B:unidict=false
+            B:universalmodifiers=false
+            B:uppers=false
+            B:valkyrielib=false
+            B:vc=false
+            B:vctweaker=false
+            B:vimmersion=false
+            B:vtt=false
+            B:waddles=false
+            B:waila=false
+            B:wailaharvestability=false
+            B:wailastages=false
+            B:walljump=false
+            B:wanionlib=false
+            B:watercontrolextreme=false
+            B:waterstrainer=false
+            B:wawla=false
+            B:weirdinggadget=false
+            B:wildcrops=false
+            B:witherskelefix=false
+            B:wizardry=false
+            B:wopper=false
+            B:worldstripper=false
+            B:worldutils=false
+            B:xnet=false
+            B:ynot=false
+            B:yoyos=false
+            B:zenloot=false
+            B:zenstages=false
+        }
+
+    }
+
+}
+
+

config/MoVillages/VillageDistance.cfg

@@ -0,0 +1,24 @@
+# Configuration file
+
+customization {
+    I:"Village Distance - 32 is vanilla, 16 is more common, 8 is extremely common, 4 is just insane."=23
+}
+
+
+"villages to generate" {
+    B:"Birch Forest"=true
+    B:"Cold Taiga"=true
+    B:"Extreme Hills"=true
+    B:Forest=true
+    B:"Ice Plains/Mountains"=true
+    B:Jungle=true
+    B:"Mega Taiga"=true
+    B:Mesa=true
+    B:Mushroom=true
+    B:Ocean=false
+    B:"Roofed Forest"=true
+    B:Swamp=true
+    B:Taiga=true
+}
+
+

config/MoreOverlays.cfg

@@ -0,0 +1,89 @@
+# Configuration file
+
+##########################################################################################################
+# chunkbounds
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the chunk bounds overlay
+##########################################################################################################
+
+chunkbounds {
+    # Show the middle of the current Chunk (yellow line)
+    B:middle=true
+
+    # Radius (in Chunks) to show the edges (red line)
+    I:radius=1
+}
+
+
+##########################################################################################################
+# itemsearch
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the item search feature
+##########################################################################################################
+
+itemsearch {
+    # Items where the NBT of an Item matters and should not be ignored
+    S:matchNBT <
+        minecraft:enchanted_book
+     >
+}
+
+
+##########################################################################################################
+# lightoverlay
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the light / mobspawn overlay
+##########################################################################################################
+
+lightoverlay {
+    # Range of the lightoverlay (negative Y)
+    I:downrange=16
+
+    # Range of the lightoverlay (Horizontal N,E,S,W)
+    I:hrange=16
+
+    # Ignore if there in no 2 Block space to spawn. (Less lag if true)
+    B:ignoreLayer=false
+
+    # Ignore if mobs can actually spawn and just go by light value
+    B:ignoreSpawns=false
+
+    # Minimum save light level where no mobs can spawn
+    I:saveLevel=8
+
+    # Range of the lightoverlay (positive Y)
+    I:uprange=4
+}
+
+
+##########################################################################################################
+# rendersettings
+#--------------------------------------------------------------------------------------------------------#
+# Settings for lines & colors
+# Values: 0xRRGGBB (Hex)
+##########################################################################################################
+
+rendersettings {
+    # Color for the chunk edge
+    I:chunk_edge_color=16711680
+
+    # Color for the chunk grid
+    I:chunk_grid_color=65280
+
+    # Line width for chunk boundaries
+    D:chunk_line_width=1.5
+
+    # Color for the middle chunk line
+    I:chunk_mid_color=16776960
+
+    # Color the X that marks "Spawns always possible"
+    I:spawn_always_color=16711680
+
+    # Line width for spawn indication
+    I:spawn_line_width=2
+
+    # Color the X that marks "Spawns at night possible"
+    I:spawn_night_color=16776960
+}
+
+

config/MouseTweaks.cfg

@@ -0,0 +1,9 @@
+#Wed May 09 10:47:19 EDT 2018
+WheelScrollDirection=0
+WheelTweak=0
+LMBTweakWithoutItem=1
+WheelSearchOrder=1
+LMBTweakWithItem=1
+RMBTweak=1
+OnTickMethodOrder=Forge, LiteLoader
+Debug=0

config/MovingWorld/AssemblePriority.cfg

@@ -0,0 +1,231 @@
+# Configuration file
+
+"dont touch" {
+    S:"CONFIG VERSION"=MovingWorldCFG.1.0.0
+}
+
+
+general {
+    B:"Rediscover powered blocks on next restart?"=false
+}
+
+
+mobile_chunk {
+    S:highpriorityassembly_blocks <
+        minecraft:air
+        minecraft:piston_extension
+        minecraft:piston_head
+        minecraft:sticky_piston
+        minecraft:piston
+        minecraft:air
+        minecraft:golden_rail
+        minecraft:detector_rail
+        minecraft:wooden_door
+        minecraft:lever
+        minecraft:stone_pressure_plate
+        minecraft:iron_door
+        minecraft:wooden_pressure_plate
+        minecraft:stone_button
+        minecraft:fence_gate
+        minecraft:tripwire_hook
+        minecraft:tripwire
+        minecraft:wooden_button
+        minecraft:unpowered_comparator
+        minecraft:powered_comparator
+        minecraft:activator_rail
+        minecraft:spruce_fence_gate
+        minecraft:birch_fence_gate
+        minecraft:jungle_fence_gate
+        minecraft:dark_oak_fence_gate
+        minecraft:acacia_fence_gate
+        minecraft:spruce_door
+        minecraft:birch_door
+        minecraft:jungle_door
+        minecraft:acacia_door
+        minecraft:dark_oak_door
+        minecraft:observer
+        advgenerators:control
+        rustic:fence_gate_olive
+        rustic:fence_gate_ironwood
+        rustic:olive_door
+        rustic:ironwood_door
+        tconstruct:slime_channel
+        natura:overworld_door_eucalyptus
+        natura:overworld_door_hopseed
+        natura:overworld_door_sakura
+        natura:overworld_door_redwood
+        natura:overworld_door_redwood_bark
+        natura:overworld_door_tiger
+        natura:overworld_door_maple
+        natura:overworld_door_silverbell
+        natura:nether_door_ghostwood
+        natura:nether_door_bloodwood
+        natura:nether_door_darkwood
+        natura:nether_door_fusewood
+        natura:nether_lever
+        natura:nether_button
+        natura:nether_pressure_plate
+        natura:blaze_rail_golden
+        natura:blaze_rail_activator
+        natura:blaze_rail_detector
+        natura:maple_button
+        natura:maple_pressure_plate
+        natura:maple_fence_gate
+        natura:silverbell_button
+        natura:silverbell_pressure_plate
+        natura:silverbell_fence_gate
+        natura:amaranth_button
+        natura:amaranth_pressure_plate
+        natura:amaranth_fence_gate
+        natura:tiger_button
+        natura:tiger_pressure_plate
+        natura:tiger_fence_gate
+        natura:willow_button
+        natura:willow_pressure_plate
+        natura:willow_fence_gate
+        natura:eucalyptus_button
+        natura:eucalyptus_pressure_plate
+        natura:eucalyptus_fence_gate
+        natura:hopseed_button
+        natura:hopseed_pressure_plate
+        natura:hopseed_fence_gate
+        natura:sakura_button
+        natura:sakura_pressure_plate
+        natura:sakura_fence_gate
+        natura:redwood_button
+        natura:redwood_pressure_plate
+        natura:redwood_fence_gate
+        natura:ghostwood_button
+        natura:ghostwood_pressure_plate
+        natura:ghostwood_fence_gate
+        natura:bloodwood_button
+        natura:bloodwood_pressure_plate
+        natura:bloodwood_fence_gate
+        natura:fusewood_button
+        natura:fusewood_pressure_plate
+        natura:fusewood_fence_gate
+        natura:darkwood_button
+        natura:darkwood_pressure_plate
+        natura:darkwood_fence_gate
+        traverse:fir_fence_gate
+        traverse:fir_door
+        betterwithmods:booster
+        betterwithmods:steel_pressure_plate
+        appliedenergistics2:security_station
+        appliedenergistics2:quartz_growth_accelerator
+        appliedenergistics2:crafting_unit
+        appliedenergistics2:crafting_accelerator
+        appliedenergistics2:crafting_storage_1k
+        appliedenergistics2:crafting_storage_4k
+        appliedenergistics2:crafting_storage_16k
+        appliedenergistics2:crafting_storage_64k
+        appliedenergistics2:crafting_monitor
+        appliedenergistics2:molecular_assembler
+        quark:nether_brick_fence_gate
+        quark:redstone_randomizer
+        quark:iron_button
+        quark:gold_button
+        quark:obsidian_pressure_plate
+        car:oilmill
+        car:blastfurnace
+        car:backmix_reactor
+        car:generator
+        chargers:wireless_charger
+        cookingforblockheads:oven
+        darkutils:update_detector
+        darkutils:sneaky_lever
+        darkutils:sneaky_plate
+        darkutils:sneaky_button
+        darkutils:timer
+        enderutilities:molecular_exciter
+        enderutilities:phasing
+        integrateddynamics:menril_door
+        mob_grinding_utils:fan
+        mob_grinding_utils:saw
+        mob_grinding_utils:xp_tap
+        nex:quartz_fence_gate
+        nex:nether_brick_fence_gate
+        nex:red_nether_brick_fence_gate
+        nex:basalt_fence_gate
+        nex:basalt_smooth_fence_gate
+        nex:basalt_brick_fence_gate
+        nex:basalt_pillar_fence_gate
+        nex:fiery_nether_brick_fence_gate
+        nex:icy_nether_brick_fence_gate
+        nex:lively_nether_brick_fence_gate
+        nex:gloomy_nether_brick_fence_gate
+        primal:lever_nether
+        primal:door_corypha
+        primal:door_ironwood
+        primal:door_yew
+        primal:door_lacquer
+        primal:gate_ironwood
+        primal:gate_corypha
+        primal:gate_yew
+        primal:gate_lacquer
+        stevescarts:blockdetector
+        storagedrawers:keybutton
+        tallgates:oak_tall_gate
+        tallgates:spruce_tall_gate
+        tallgates:birch_tall_gate
+        tallgates:jungle_tall_gate
+        tallgates:dark_oak_tall_gate
+        tallgates:acacia_tall_gate
+        tcomplement:alloy_tank
+        tcomplement:porcelain_alloy_tank
+        totemic:cedar_fence_gate
+        abyssalcraft:dsbutton
+        abyssalcraft:dspplate
+        abyssalcraft:dltbutton
+        abyssalcraft:dltpplate
+        abyssalcraft:abybutton
+        abyssalcraft:abypplate
+        abyssalcraft:cstonebutton
+        abyssalcraft:cstonepplate
+        abyssalcraft:door_dlt
+        abyssalcraft:door_drt
+        cyclicmagic:wireless_transmitter
+        cyclicmagic:wireless_receiver
+        cyclicmagic:clock
+        cyclicmagic:password_block
+        refinedstorage:detector
+        davincisvessels:crate_wood
+        thebetweenlands:weedwood_plank_fence_gate
+        thebetweenlands:weedwood_log_fence_gate
+        thebetweenlands:rubber_tree_plank_fence_gate
+        thebetweenlands:giant_root_plank_fence_gate
+        thebetweenlands:hearthgrove_plank_fence_gate
+        thebetweenlands:nibbletwig_plank_fence_gate
+        thebetweenlands:weedwood_plank_pressure_plate
+        thebetweenlands:betweenstone_pressure_plate
+        thebetweenlands:syrmorite_pressure_plate
+        thebetweenlands:weedwood_plank_button
+        thebetweenlands:betweenstone_button
+        thebetweenlands:weedwood_lever
+        thebetweenlands:mud_tower_beam_origin
+        thebetweenlands:mud_tower_beam_relay
+        thebetweenlands:rotten_plank_fence_gate
+        thebetweenlands:weedwood_door
+        thebetweenlands:rubber_tree_plank_door
+        thebetweenlands:giant_root_plank_door
+        thebetweenlands:hearthgrove_plank_door
+        thebetweenlands:nibbletwig_plank_door
+        thebetweenlands:syrmorite_door
+        thebetweenlands:scabyst_door
+     >
+    S:highprioritydisassembly_blocks <
+        minecraft:piston_head
+        minecraft:piston_extension
+     >
+    S:lowpriorityassembly_blocks <
+        minecraft:redstone_wire
+        minecraft:obsidian
+     >
+    S:lowprioritydisassembly_blocks <
+        minecraft:end_portal
+        minecraft:portal
+        minecraft:redstone_wire
+     >
+}
+
+

config/MovingWorld/Main.cfg

@@ -0,0 +1,200 @@
+# Configuration file
+
+general {
+    B:"Allow other mods to add to the whitelist/blacklist? NOTE: Turn off if you want to remove the default blacklist/whitelist"=true
+    B:"Assemble Diagonal Blocks NOTE: Can be overridden by mods!"=false
+    B:"Use Iterative Algorithm"=true
+}
+
+
+mobile_chunk {
+    # A list of blocks that are allowed on a Moving World.
+    S:allowed_blocks <
+        minecraft:acacia_stairs
+        minecraft:activator_rail
+        minecraft:anvil
+        minecraft:bed
+        minecraft:birch_stairs
+        minecraft:bookshelf
+        minecraft:brewing_stand
+        minecraft:brick_block
+        minecraft:brick_stairs
+        minecraft:cactus
+        minecraft:cake
+        minecraft:carpet
+        minecraft:coal_block
+        minecraft:cobblestone
+        minecraft:cobblestone_wall
+        minecraft:command_block
+        minecraft:crafting_table
+        minecraft:dark_oak_stairs
+        minecraft:detector_rail
+        minecraft:diamond_block
+        minecraft:dispenser
+        minecraft:dropper
+        minecraft:daylight_detector
+        minecraft:double_stone_slab
+        minecraft:double_wooden_slab
+        minecraft:emerald_block
+        minecraft:enchanting_table
+        minecraft:end_stone
+        minecraft:ender_chest
+        minecraft:acacia_fence
+        minecraft:birch_fence
+        minecraft:dark_oak_fence
+        minecraft:jungle_fence
+        minecraft:nether_brick_fence
+        minecraft:fence
+        minecraft:spruce_fence
+        minecraft:acacia_fence_gate
+        minecraft:birch_fence_gate
+        minecraft:dark_oak_fence_gate
+        minecraft:jungle_fence_gate
+        minecraft:fence_gate
+        minecraft:spruce_fence_gate
+        minecraft:air
+        minecraft:furnace
+        minecraft:fire
+        minecraft:glass
+        minecraft:glass_pane
+        minecraft:glowstone
+        minecraft:gold_block
+        minecraft:golden_rail
+        minecraft:hardened_clay
+        minecraft:hay_block
+        minecraft:heavy_weighted_pressure_plate
+        minecraft:hopper
+        minecraft:iron_bars
+        minecraft:iron_block
+        minecraft:iron_door
+        minecraft:jukebox
+        minecraft:jungle_stairs
+        minecraft:ladder
+        minecraft:lapis_block
+        minecraft:lever
+        minecraft:light_weighted_pressure_plate
+        minecraft:lit_furnace
+        minecraft:lit_pumpkin
+        minecraft:lit_redstone_lamp
+        minecraft:log
+        minecraft:log2
+        minecraft:melon_block
+        minecraft:mob_spawner
+        minecraft:monster_egg
+        minecraft:mossy_cobblestone
+        minecraft:nether_brick
+        minecraft:nether_brick_fence
+        minecraft:nether_brick_stairs
+        minecraft:noteblock
+        minecraft:oak_stairs
+        minecraft:obsidian
+        minecraft:planks
+        minecraft:pumpkin
+        minecraft:piston
+        minecraft:piston_extension
+        minecraft:piston_head
+        minecraft:powered_comparator
+        minecraft:powered_repeater
+        minecraft:quartz_block
+        minecraft:quartz_stairs
+        minecraft:rail
+        minecraft:redstone_block
+        minecraft:redstone_torch
+        minecraft:redstone_wire
+        minecraft:sandstone
+        minecraft:sandstone_stairs
+        minecraft:red_sandstone
+        minecraft:red_sandstone_stairs
+        minecraft:skull
+        minecraft:sponge
+        minecraft:spruce_stairs
+        minecraft:stained_hardened_clay
+        minecraft:standing_sign
+        minecraft:stone_brick_stairs
+        minecraft:stone_button
+        minecraft:stone_pressure_plate
+        minecraft:stone_stairs
+        minecraft:stonebrick
+        minecraft:stained_glass
+        minecraft:stained_glass_pane
+        minecraft:sticky_piston
+        minecraft:stone_slab
+        minecraft:stone_slab2
+        minecraft:tnt
+        minecraft:torch
+        minecraft:trapdoor
+        minecraft:trapped_chest
+        minecraft:tripwire
+        minecraft:tripwire_hook
+        minecraft:unlit_redstone_torch
+        minecraft:unpowered_comparator
+        minecraft:unpowered_repeater
+        minecraft:wall_sign
+        minecraft:web
+        minecraft:wooden_button
+        minecraft:acacia_door
+        minecraft:birch_door
+        minecraft:dark_oak_door
+        minecraft:jungle_door
+        minecraft:wooden_door
+        minecraft:spruce_door
+        minecraft:wooden_pressure_plate
+        minecraft:wool
+        minecraft:wooden_slab
+        davincisvessels:marker
+        davincisvessels:floater
+        davincisvessels:balloon
+        davincisvessels:gauge
+        davincisvessels:seat
+        davincisvessels:engine
+        davincisvessels:stickybuffer
+        davincisvessels:anchorpoint
+     >
+    S:allowed_tiles <
+     >
+    S:block_densities <
+        "DavincisVessels:floater=0.04"
+        "DavincisVessels:balloon=0.02"
+     >
+    S:forbidden_blocks <
+        minecraft:dirt
+        minecraft:grass
+        minecraft:sand
+        minecraft:gravel
+        minecraft:clay
+        minecraft:ice
+        minecraft:water
+        minecraft:flowing_water
+        minecraft:lava
+        minecraft:flowing_lava
+        minecraft:snow
+        minecraft:snow_layer
+        minecraft:waterlily
+        minecraft:netherrack
+        minecraft:soul_sand
+        minecraft:tallgrass
+        davincisvessels:buffer
+     >
+    S:forbidden_tiles <
+     >
+    S:material_densities <
+        "minecraft:air=0.0"
+        "minecraft:wool=0.1"
+     >
+    S:overwritable_blocks <
+        minecraft:tallgrass
+        minecraft:waterlily
+        minecraft:snow_layer
+     >
+    S:updatable_tiles <
+        Furnace
+        Hopper
+        Banner
+        EnchantTable
+        DLDetector
+     >
+    B:use_tile_whitelist=false
+    B:use_whitelist=false
+}
+
+

config/NaturaModules.cfg

@@ -0,0 +1,26 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+modules {
+    # Everything that's decorative for Natura. (bookshelfs, etc)
+    B:NaturaDecorative=true
+
+    # The entites added by Natura
+    B:NaturaEntities=true
+
+    # All of the nether blocks including trees
+    B:NaturaNether=true
+
+    # All of the overworld blocks including trees
+    B:NaturaOverworld=true
+
+    # All of the tools + armor added by natura
+    B:NaturaTools=false
+
+    # Everything that's found in the world and worldgen including the netherite dimension
+    B:NaturaWorld=true
+    B:craftingtweaksIntegration=true
+}
+
+

config/NetherEx/Biomes/biomesoplenty/corrupted_sands.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:corrupted_sands",
+    "weight": 8,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/fungi_forest.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:fungi_forest",
+    "weight": 4,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/phantasmagoric_inferno.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:phantasmagoric_inferno",
+    "weight": 6,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/undergarden.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:undergarden",
+    "weight": 4,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/visceral_heap.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:visceral_heap",
+    "weight": 4,
+    "enabled": true
+}

config/NetherEx/Biomes/minecraft/hell.json

@@ -0,0 +1,419 @@
+{
+  "biome": "minecraft:hell",
+  "weight": 10,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "fillerBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "wallBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "ceilingBottomBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "ceilingFillerBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:ghast",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:zombie_pigman",
+      "creatureType": "monster",
+      "weight": 100,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:magma_cube",
+      "creatureType": "monster",
+      "weight": 2,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:enderman",
+      "creatureType": "monster",
+      "weight": 1,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster_grunt",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "quark:wraith",
+      "creatureType": "monster",
+      "weight": 60,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": true
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "animalium:wild_dog",
+      "creatureType": "monster",
+      "weight": 2,
+      "minGroupCount": 1,
+      "maxGroupCount": 2,
+      "spawn": true
+    },
+    {
+      "entity": "animalium:bear",
+      "creatureType": "monster",
+      "weight": 1,
+      "minGroupCount": 1,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "animalium:rat",
+      "creatureType": "monster",
+      "weight": 2,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster_grunt",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "quark:wraith",
+      "creatureType": "monster",
+      "weight": 60,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": true
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": true
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "hidden": false,
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:fire"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "placement": "on_ground",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "minecraft:netherrack"
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "minecraft:netherrack"
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "decorate",
+      "blockToSpawn": {
+        "block": "minecraft:red_mushroom"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "placement": "on_ground",
+      "genAttempts": 1,
+      "genProbability": 0.25,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "decorate",
+      "blockToSpawn": {
+        "block": "minecraft:brown_mushroom"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "placement": "on_ground",
+      "genAttempts": 1,
+      "genProbability": 0.25,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "minecraft:quartz_ore"
+      },
+      "blockToReplace": {
+        "block": "minecraft:netherrack"
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:amethyst_ore"
+      },
+      "blockToReplace": {
+        "block": "minecraft:netherrack"
+      },
+      "veinSize": 3,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:magma"
+      },
+      "blockToReplace": {
+        "block": "minecraft:netherrack"
+      },
+      "veinSize": 32,
+      "genAttempts": 4,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 28,
+      "maxGenHeight": 38
+    },
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "hidden": true,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "lex:structure",
+      "genStage": "populate",
+      "structure": "nex:village/tiny_hell_pigtificate_village",
+      "type": "grounded",
+      "genAttempts": 1,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "mirror": "random",
+      "rotation": "random",
+      "ignoredBlock": {
+        "block": "minecraft:structure_void",
+        "properties": {}
+      },
+      "clearancePercentage": 0.75,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 116
+    }
+  ]
+}

config/NetherEx/Biomes/nex/arctic_abyss.json

@@ -0,0 +1,259 @@
+{
+  "biome": "nex:arctic_abyss",
+  "weight": 2,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "nex:frostburn_ice"
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "icy"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "icy"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:frostburn_ice"
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "icy"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:magma"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:ghast",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:zombie_pigman",
+      "creatureType": "monster",
+      "weight": 25,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:bone_spider",
+      "creatureType": "monster",
+      "weight": 35,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:wight",
+      "creatureType": "monster",
+      "weight": 75,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:brute",
+      "creatureType": "monster",
+      "weight": 15,
+      "minGroupCount": 1,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:canis_campestris",
+      "creatureType": "creature",
+      "weight": 6,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": false
+    },
+    {
+      "entity": "primal:bear_black",
+      "creatureType": "creature",
+      "weight": 4,
+      "minGroupCount": 0,
+      "maxGroupCount": 2,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:scatter",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "nex:blue_fire"
+      },
+      "blockToTarget": {
+        "block": "nex:frostburn_ice"
+      },
+      "placement": "on_ground",
+      "genAttempts": 5,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:rime_ore"
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "veinSize": 7,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:pool",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "nex:ichor"
+      },
+      "blockToSurround": {
+        "block": "nex:frostburn_ice"
+      },
+      "genAttempts": 1,
+      "genProbability": 0.125,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 36,
+      "maxGenHeight": 96
+    }
+  ]
+}

config/NetherEx/Biomes/nex/fungi_forest.json

@@ -0,0 +1,260 @@
+{
+  "biome": "nex:fungi_forest",
+  "weight": 4,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "nex:hyphae"
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "nex:mogus",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:spore",
+      "creatureType": "monster",
+      "weight": 25,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "nex:spore_creeper",
+      "creatureType": "monster",
+      "weight": 23,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 2,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "netherrack": {
+        "block": "nex:block_netherrack",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "blockToAttachTo": {
+        "block": "minecraft:barrier",
+        "properties": {}
+      },
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "netherrack": {
+        "block": "nex:block_netherrack",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "blockToAttachTo": {
+        "block": "minecraft:barrier",
+        "properties": {}
+      },
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:big_mushroom",
+      "genStage": "decorate",
+      "mushroomCap": {
+        "block": "nex:elder_mushroom_cap",
+        "properties": {
+          "type": "brown"
+        }
+      },
+      "mushroomStem": {
+        "block": "nex:elder_mushroom_stem"
+      },
+      "blockToPlaceOn": {
+        "block": "nex:hyphae"
+      },
+      "shape": "flat",
+      "genAttempts": 256,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:big_mushroom",
+      "genStage": "decorate",
+      "mushroomCap": {
+        "block": "nex:elder_mushroom_cap",
+        "properties": {
+          "type": "red"
+        }
+      },
+      "mushroomStem": {
+        "block": "nex:elder_mushroom_stem"
+      },
+      "blockToPlaceOn": {
+        "block": "nex:hyphae"
+      },
+      "shape": "bulb",
+      "genAttempts": 256,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "nex:enoki",
+      "genStage": "decorate",
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 64,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:structure",
+      "genStage": "populate",
+      "structure": "nex:ghast_queen_shrine",
+      "type": "floating",
+      "genAttempts": 1,
+      "genProbability": 0.0125,
+      "randomizeGenAttempts": false,
+      "mirror": "random",
+      "rotation": "random",
+      "ignoredBlock": {
+        "block": "minecraft:structure_void",
+        "properties": {}
+      },
+      "clearancePercentage": 1.0,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 116
+    }
+  ]
+}

config/NetherEx/Biomes/nex/ruthless_sands.json

@@ -0,0 +1,227 @@
+{
+  "biome": "nex:ruthless_sands",
+  "weight": 8,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "minecraft:soul_sand"
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:wither_skeleton",
+      "creatureType": "monster",
+      "weight": 65,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:zombie_pigman",
+      "creatureType": "monster",
+      "weight": 45,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "nex:spinout",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 1,
+      "maxGroupCount": 2,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 2,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "hidden": false,
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "hidden": true,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "nex:thornstalk",
+      "genStage": "decorate",
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 108
+    }
+  ]
+}

config/NetherEx/Biomes/nex/torrid_wasteland.json

@@ -0,0 +1,310 @@
+{
+  "biome": "nex:torrid_wasteland",
+  "weight": 6,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:magma_cube",
+      "creatureType": "monster",
+      "weight": 15,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "nex:ember",
+      "creatureType": "monster",
+      "weight": 25,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:salamander",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 20,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "hidden": false,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:fire"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "placement": "on_ground",
+      "genAttempts": 20,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "nex:basalt",
+        "properties": {
+          "type": "normal"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "veinSize": 24,
+      "genAttempts": 14,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:magma"
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "veinSize": 32,
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 28,
+      "maxGenHeight": 38
+    },
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "hidden": true,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "lex:pool",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:lava"
+      },
+      "blockToSurround": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    }
+  ]
+}

config/NetherEx/Trades/nex/armorsmith.json

@@ -0,0 +1,214 @@
+{
+    "career": "armorsmith",
+    "trades": [
+        {
+            "output": {
+                "item": "nex:salamander_hide",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:iron_ingot",
+                "meta": 0,
+                "minStackSize": 10,
+                "maxStackSize": 20
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:leather",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_nugget",
+                "meta": 0,
+                "minStackSize": 12,
+                "maxStackSize": 24
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_chestplate",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 12,
+                "maxStackSize": 20
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_boots",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 14
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_helmet",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 14
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_leggings",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 9,
+                "maxStackSize": 18
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_helmet",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_crystal",
+                "properties": {
+                    "type": "amethyst"
+                },
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_chestplate",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_crystal",
+                "properties": {
+                    "type": "amethyst"
+                },
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_leggings",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_crystal",
+                "properties": {
+                    "type": "amethyst"
+                },
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_boots",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_block",
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/brewer.json

@@ -0,0 +1,106 @@
+{
+    "career": "brewer",
+    "trades": [
+        {
+            "output": {
+                "item": "nex:spore",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 5
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:magma_cream",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:glass_bottle",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:blaze_powder",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 12
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:nether_wart",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:speckled_melon",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_block",
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/enchanter.json

@@ -0,0 +1,247 @@
+{
+    "career": "enchanter",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 10
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:glowstone_dust",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:blaze_rod",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:unbreaking",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 2
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 8,
+                "maxStackSize": 32
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:protection",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 3
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 8,
+                "maxStackSize": 32
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:sharpness",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 4
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 8,
+                "maxStackSize": 32
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:fire_protection",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 4
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 16,
+                "maxStackSize": 48
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:fortune",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 3
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 24,
+                "maxStackSize": 64
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:looting",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 1
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 24,
+                "maxStackSize": 64
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:experience_bottle",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 16
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/gatherer.json

@@ -0,0 +1,185 @@
+{
+    "career": "gatherer",
+    "trades": [
+        {
+            "output": {
+                "item": "nex:congealed_magma_cream",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputTwo": {
+                "item": "minecraft:magma_cream",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:mushroom_stew",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 12,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "itemBlock": "nex:elder_mushroom",
+                "properties": {
+                    "type": "red"
+                },
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:bone",
+                "meta": 0,
+                "minStackSize": 32,
+                "maxStackSize": 64
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:bread",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 16
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "itemBlock": "nex:elder_mushroom",
+                "properties": {
+                    "type": "brown"
+                },
+                "minStackSize": 4,
+                "maxStackSize": 7
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:enoki_mushroom",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 3
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:quartz_block",
+                "properties": {
+                    "variant": "default"
+                },
+                "minStackSize": 3,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 3,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:nether_wart",
+                "minStackSize": 3,
+                "maxStackSize": 5
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 6,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:melon_block",
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/hunter.json

@@ -0,0 +1,124 @@
+{
+    "career": "hunter",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:rotten_flesh",
+                "meta": 0,
+                "minStackSize": 9,
+                "maxStackSize": 15
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:spider_eye",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:magma_cream",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:cooked_rabbit",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 7
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:ghast_meat_raw",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:ghast_meat_cooked",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:ender_pearl",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 7
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/scavenger.json

@@ -0,0 +1,177 @@
+{
+    "career": "scavenger",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:cobblestone",
+                "minStackSize": 4,
+                "maxStackSize": 16
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:stone",
+                "properties": {
+                    "variant": "stone"
+                },
+                "minStackSize": 16,
+                "maxStackSize": 28
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:dirt",
+                "properties": {
+                    "variant": "dirt"
+                },
+                "minStackSize": 1,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:gravel",
+                "minStackSize": 8,
+                "maxStackSize": 16
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:log",
+                "properties": {
+                    "variant": "oak"
+                },
+                "minStackSize": 1,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_ingot",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:coal_ore",
+                "minStackSize": 3,
+                "maxStackSize": 7
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:diamond",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 9
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 3,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 10
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:potion",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_block",
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 3,
+            "tradeLevel": 4
+        }
+    ]
+}

config/NetherEx/Trades/nex/toolsmith.json

@@ -0,0 +1,192 @@
+{
+    "career": "toolsmith",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:iron_nugget",
+                "meta": 0,
+                "minStackSize": 10,
+                "maxStackSize": 24
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:gold_ingot",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:stone_pickaxe",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:stone_sword",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:stone_shovel",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:diamond",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_pickaxe",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_axe",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_sword",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 7
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_shovel",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:gold_nugget",
+                "meta": 0,
+                "minStackSize": 12,
+                "maxStackSize": 28
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 9
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/nex.cfg

@@ -0,0 +1,312 @@
+# Configuration file
+
+nex {
+
+    client {
+
+        visual {
+            B:disableNetherFog=true
+        }
+
+    }
+
+    compatibility {
+
+        biomesoplenty {
+            B:enableCompat=true
+        }
+
+    }
+
+    dimension {
+
+        nether {
+            B:generateGravel=false
+            B:generateSoulSand=false
+            B:isLavaInfinite=false
+            B:overrideNether=true
+        }
+
+    }
+
+    block {
+
+        nether_portal {
+            # The higher the number, the rarer it is for Pigman to spawn
+            # The lower the number, the more common it is for Pigman to spawn
+            # If set to 0, Pigman won't spawn
+            # Min: 0
+            # Max: 2147483647
+            I:pigmanSpawnRarity=2000
+        }
+
+        netherrack {
+            B:allowAllShovelsToFlatten=false
+        }
+
+        soul_sand {
+            B:allowAllHoesToTill=false
+            B:useLavaInsteadOfIchorToMoisten=false
+        }
+
+        magma {
+            B:turnIntoLava=false
+            B:turnIntoLavaWhenBroken=false
+        }
+
+        rime {
+            B:canFreezeLava=true
+            B:canFreezeMobs=true
+            B:canFreezeWater=true
+        }
+
+        thornstalk {
+            B:canDestroyItems=false
+
+            # Mobs Thornstalk won't hurt
+            S:mobBlacklist <
+                minecraft:wither_skeleton
+                minecraft:zombie_pigman
+                nex:spinout
+             >
+        }
+
+        hyphae {
+            B:shouldSpread=false
+        }
+
+        nether_wart {
+            B:growLikeCrops=true
+
+            # The higher the number, the slower Nether Wart grows
+            # The lower the number, the faster Nether Wart grows
+            # If set to 0, Nether Wart growth will default to Vanilla speed
+            # Min: 0
+            # Max: 2147483647
+            I:growthTickSpeed=0
+        }
+
+    }
+
+    potion_effect {
+
+        freeze {
+            # Mobs that won't freeze
+            S:mobBlacklist <
+                minecraft:blaze
+                minecraft:ghast
+                minecraft:wither_skeleton
+                minecraft:polar_bear
+                nex:wight
+                nex:ember
+                nex:spinout
+                nex:bone_spider
+                nex:brute
+             >
+
+            # The higher the number, the rarer it is to thaw
+            # The lower the number, the more common it is to thaw
+            # Min: 1
+            # Max: 2147483647
+            I:thawRarity=1024
+        }
+
+        spore {
+            # Mobs that shouldn't spawn Spores
+            S:mobBlacklist <
+                nex:spore_creeper
+                nex:spore
+                nex:mogus
+             >
+
+            # The higher the number, the rarer it is to spawn a Spore
+            # The lower the number, the more common it is to spawn a Spore
+            # Min: 1
+            # Max: 2147483647
+            I:sporeSpawnRarity=128
+        }
+
+        lost {
+            # The higher the number, the rarer it is to spawn a Ghastling
+            # The lower the number, the more common it is to spawn a Ghastling
+            # Min: 1
+            # Max: 2147483647
+            I:ghastlingSpawnRarity=256
+        }
+
+    }
+
+    entity {
+
+        ember {
+            # The higher the number, the rarer it is to set a player on fire
+            # The lower the number, the more common it is to set a player on fire
+            # If set to 0, Embers won't set Players on fire
+            # Min: 0
+            # Max: 2147483647
+            I:setPlayerOnFireRarity=1
+        }
+
+        nethermite {
+            # Blocks the Nethermite will spawn from
+            S:blockWhitelist <
+                minecraft:quartz_ore
+                nex:ore_quartz
+                nex:ore_amethyst
+                nex:ore_rime
+                tconstruct:ore
+                nethermetals:nether_coal_ore
+                nethermetals:nether_redstone_ore
+                nethermetals:nether_diamond_ore
+                nethermetals:nether_emerald_ore
+                nethermetals:nether_gold_ore
+                nethermetals:nether_iron_ore
+                nethermetals:nether_lapis_ore
+                nethermetals:nether_antimony_ore
+                nethermetals:nether_bismuth_ore
+                nethermetals:nether_copper_ore
+                nethermetals:nether_lead_ore
+                nethermetals:nether_mercury_ore
+                nethermetals:nether_nickel_ore
+                nethermetals:nether_platnium_ore
+                nethermetals:nether_silver_ore
+                nethermetals:nether_tin_ore
+                nethermetals:nether_zinc_ore
+                nethermetals:nether_aluminum_ore
+                nethermetals:nether_cadmium_ore
+                nethermetals:nether_chromium_ore
+                nethermetals:nether_iridium_ore
+                nethermetals:nether_magnesium_ore
+                nethermetals:nether_magnanese_ore
+                nethermetals:nether_osmium_ore
+                nethermetals:nether_plutonium_ore
+                nethermetals:nether_rutile_ore
+                nethermetals:nether_tantalum_ore
+                nethermetals:nether_titanium_ore
+                nethermetals:nether_tungsten_ore
+                nethermetals:nether_uramium_ore
+                nethermetals:nether_zirconium_ore
+             >
+
+            # The higher the number, the rarer it is for a Nethermite to spawn
+            # The lower the number, the more common it is for a Nethermite to spawn
+            # If set to 0, Nethermites won't spawn
+            # Min: 0
+            # Max: 2147483647
+            I:spawnRarity=64
+        }
+
+        spinout {
+            # The lower the number, the less time a Spinout goes without spinning
+            # The higher the number, the more time a Spinout goes without spinning
+            # Min: 1
+            # Max: 2147483647
+            I:spinCooldown=2
+
+            # The lower the number, the less time a Spinout spins
+            # The higher the number, the more time a Spinout spins
+            # Min: 1
+            # Max: 2147483647
+            I:spinTime=6
+        }
+
+        spore_creeper {
+            # The higher the number, the rarer it is for a Spore Creeper to spawn a Spore on death
+            # The lower the number, the more common it is for a Spore Creeper to spawn a Spore on death
+            # Min: 1
+            # Max: 2147483647
+            I:sporeSpawnRarity=12
+        }
+
+        spore {
+            # The lower the number, the less Spore Creepers spawn from a Spore
+            # The higher the number, the more Spore Creepers spawn from a Spore
+            # Min: 1
+            # Max: 2147483647
+            I:creeperSpawnAmount=3
+
+            # The lower the number, the less it takes a Spore to grow
+            # The higher the number, the more time it takes for a Spore to grow
+            # Min: 1
+            # Max: 2147483647
+            I:growthTime=60
+        }
+
+        brute {
+            # The lower the number, the less cooldown the Brute has after charging
+            # The higher the number, the more cooldown the Brute has after charging
+            # Min: 1
+            # Max: 2147483647
+            I:chargeCooldown=2
+        }
+
+        ghast_queen {
+            # The lower the number, the less Ghastling spawn
+            # The higher the number, the more Ghastling spawn
+            # Min: 1
+            # Max: 2147483647
+            I:ghastlingSpawnAmount=4
+
+            # The lower the number, the less cooldown the Ghast Queen has after spawning Ghastlings
+            # The higher the number, the more cooldown the Ghast Queen has after spawning Ghastlings
+            # Min: 1
+            # Max: 2147483647
+            I:ghastlingSpawnCooldown=10
+        }
+
+        ghast {
+            # The lower the number, the more common it is for Ghast Meat to drop
+            # The higher the number, the rarer it is for Ghast Meat to drop
+            # If set to 0, Ghast Meat does not drop
+            # Min: 0
+            # Max: 2147483647
+            I:meatDropRarity=1
+        }
+
+        wither_skeleton {
+            # The lower the number, the more common it is for a Bone to drop
+            # The higher the number, the rarer it is for a Bone drop
+            # If set to 0, Bones do not drop
+            # Min: 0
+            # Max: 2147483647
+            I:boneDropRarity=4
+        }
+
+    }
+
+    biome {
+
+        hell {
+        }
+
+        ruthless_sands {
+            B:generateThornstalk=true
+            I:thornstalkRarity=10
+        }
+
+        fungi_forest {
+            I:elderMushroomRarity=32
+            I:enokiMushroomRarity=4
+            B:generateElderMushrooms=true
+            B:generateEnokiMushrooms=true
+        }
+
+        torrid_wasteland {
+        }
+
+        arctic_abyss {
+            # Whether or not players can freeze in the Arctic Abyss
+            B:canPlayersFreeze=false
+
+            # The higher the number, the rarer it is for mobs to freeze in the Arctic Abyss biome
+            # The lower the number, the more common it is for mobs to freeze in the Arctic Abyss biome
+            # Min: 1
+            # Max: 2147483647
+            I:mobFreezeRarity=512
+        }
+
+    }
+
+}
+
+

config/QuantumStorage.cfg

@@ -0,0 +1,17 @@
+# Configuration file
+
+recipe {
+    B:"disable default recipe for crating machine"=false
+    B:"disable default recipe for fluid trash can"=false
+    B:"disable default recipe for quantum barrel"=false
+    B:"disable default recipe for quantum battery"=false
+    B:"disable default recipe for quantum chests"=false
+    B:"disable default recipe for quantum crafter"=false
+    B:"disable default recipe for quantum disk"=false
+    B:"disable default recipe for quantum storage unit"=false
+    B:"disable default recipe for quantum tank"=false
+    B:"disable default recipe for trash can"=false
+    I:"how long in ticks it takes to craft a quantum disk"=100000
+}
+
+

config/RoadRunner.cfg

@@ -0,0 +1,109 @@
+# Configuration file
+
+##########################################################################################################
+# roadblocks
+#--------------------------------------------------------------------------------------------------------#
+# MOVEMENT_SPEED Attribute is used for more Info about Modifier Amounts and Operations:
+# https://minecraft.gamepedia.com/Attribute
+##########################################################################################################
+
+roadblocks {
+
+    ##########################################################################################################
+    # block1
+    #--------------------------------------------------------------------------------------------------------#
+    # Road Block 1
+    ##########################################################################################################
+
+    block1 {
+        # ID of Road Block [default: minecraft:stonebrick]
+        S:"Block ID"=minecraft:stonebrick
+
+        # Amound of Speed Modification [range: -1000.0 ~ 1000.0, default: 0.2]
+        S:"Modifier Amount"=0.2
+
+        # Operation of Speed Modification [range: 0 ~ 2, default: 2]
+        I:"Modifier Operation"=2
+    }
+
+    ##########################################################################################################
+    # block2
+    #--------------------------------------------------------------------------------------------------------#
+    # Road Block 2
+    ##########################################################################################################
+
+    block2 {
+        # ID of Road Block [default: minecraft:grass_path]
+        S:"Block ID"=minecraft:grass_path
+
+        # Amound of Speed Modification [range: -1000.0 ~ 1000.0, default: 0.1]
+        S:"Modifier Amount"=0.1
+
+        # Operation of Speed Modification [range: 0 ~ 2, default: 2]
+        I:"Modifier Operation"=2
+    }
+
+    ##########################################################################################################
+    # block3
+    #--------------------------------------------------------------------------------------------------------#
+    # Road Block 3
+    ##########################################################################################################
+
+    block3 {
+        # ID of Road Block [default: ]
+        S:"Block ID"=immersivepetroleum:stone_decoration
+
+        # Amound of Speed Modification [range: -1000.0 ~ 1000.0, default: 0.0]
+        S:"Modifier Amount"=0.1
+
+        # Operation of Speed Modification [range: 0 ~ 2, default: 0]
+        I:"Modifier Operation"=2
+    }
+
+    ##########################################################################################################
+    # block4
+    #--------------------------------------------------------------------------------------------------------#
+    # Road Block 4
+    ##########################################################################################################
+
+    block4 {
+        # ID of Road Block [default: ]
+        S:"Block ID"=
+
+        # Amound of Speed Modification [range: -1000.0 ~ 1000.0, default: 0.0]
+        S:"Modifier Amount"=0.0
+
+        # Operation of Speed Modification [range: 0 ~ 2, default: 0]
+        I:"Modifier Operation"=0
+    }
+
+    ##########################################################################################################
+    # block5
+    #--------------------------------------------------------------------------------------------------------#
+    # Road Block 5
+    ##########################################################################################################
+
+    block5 {
+        # ID of Road Block [default: ]
+        S:"Block ID"=
+
+        # Amound of Speed Modification [range: -1000.0 ~ 1000.0, default: 0.0]
+        S:"Modifier Amount"=0.0
+
+        # Operation of Speed Modification [range: 0 ~ 2, default: 0]
+        I:"Modifier Operation"=0
+    }
+
+}
+
+
+##########################################################################################################
+# shoes
+#--------------------------------------------------------------------------------------------------------#
+# Shoe configuration tbd
+##########################################################################################################
+
+shoes {
+}
+
+

config/TComplementModules.cfg

@@ -0,0 +1,28 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+modules {
+    # Adds casting supplies made from porcelain
+    B:CeramicsPlugin=true
+
+    # Add a Tinkers version of the Chisel Chisel
+    B:ChiselPlugin=true
+
+    # Adds an Tinkers Construct version of the Ex Nihilo hammer
+    B:ExNihiloPlugin=false
+
+    # Adds KnightSlime and Manyullyn vanilla style armors
+    B:ModuleArmor=true
+
+    # Adds the melter and alloyer: smaller components of the smeltery
+    B:ModuleMelter=true
+
+    # Adds the high oven: a new multiblock for making steel
+    B:ModuleSteelworks=false
+
+    # Add a Tinkers version of the Chisel Chisel
+    B:ToolLevelingPlugin=true
+}
+
+

config/TinkerModules.cfg

@@ -0,0 +1,28 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+modules {
+    # Debug utilities
+    B:TinkerDebug=false
+
+    # All the fun toys
+    B:TinkerGadgets=true
+
+    # The smeltery and items needed for it
+    B:TinkerSmeltery=true
+
+    # All the tools and everything related to it.
+    B:TinkerTools=true
+
+    # Everything that's found in the world and worldgen
+    B:TinkerWorld=true
+    B:WailaIntegration=true
+    B:chiselIntegration=true
+    B:chiselsandbitsIntegration=true
+    B:craftingtweaksIntegration=false
+    B:theoneprobeIntegration=false
+    B:wailaIntegration=true
+}
+
+

config/TinkerToolLeveling.cfg

@@ -0,0 +1,36 @@
+"_VERSION"=1
+general {
+    # Maximum achievable levels. If set to 0 or lower there is no upper limit
+    maximumLevels=12
+    # Reduces the amount of modifiers a newly build tool gets if the value is lower than the regular amount of modifiers the tool would have
+    newToolMinModifiers=3
+}
+toolxp {
+    # Base XP for each of the listed tools
+    baseXpForTool {
+        "tcomplement:chisel"=2000
+        "tconstruct:arrow"=2000
+        "tconstruct:battlesign"=2000
+        "tconstruct:bolt"=2000
+        "tconstruct:broadsword"=2000
+        "tconstruct:cleaver"=2000
+        "tconstruct:crossbow"=2000
+        "tconstruct:excavator"=18000
+        "tconstruct:frypan"=2000
+        "tconstruct:hammer"=18000
+        "tconstruct:hatchet"=2000
+        "tconstruct:kama"=2000
+        "tconstruct:longbow"=2000
+        "tconstruct:longsword"=2000
+        "tconstruct:lumberaxe"=18000
+        "tconstruct:mattock"=2000
+        "tconstruct:pickaxe"=2000
+        "tconstruct:rapier"=2000
+        "tconstruct:scythe"=18000
+        "tconstruct:shortbow"=2000
+        "tconstruct:shovel"=2000
+        "tconstruct:shuriken"=2000
+    }
+    # Base XP used when no more specific entry is present for the tool
+    defaultBaseXP=2000
+}

config/Waddles.cfg

@@ -0,0 +1,40 @@
+# Configuration file
+
+general {
+    B:"Enable that penguins drop fish (0 - 2 Raw fish)"=false
+    B:"Penguins should drop experience?"=true
+}
+
+
+##########################################################################################################
+# spawn chances
+#--------------------------------------------------------------------------------------------------------#
+# Configure penguins spawn weight & min/max group size. Set weight to 0 to disable.
+##########################################################################################################
+
+"spawn chances" {
+
+    adelie_penguin {
+        I:Max=4
+        I:Min=1
+        I:Weight=2
+
+        "spawnable biomes" {
+            # BiomeDictionary types to exclude [default: [FOREST], [MOUNTAIN], [NETHER]]
+            S:Exclude <
+                FOREST
+                MOUNTAIN
+                NETHER
+             >
+
+            # BiomeDictionary types to include [default: [SNOWY]]
+            S:Include <
+                SNOWY
+             >
+        }
+
+    }
+
+}
+
+

config/abyssalcraft.cfg

@@ -0,0 +1,651 @@
+# Configuration file
+
+##########################################################################################################
+# biome_generation
+#--------------------------------------------------------------------------------------------------------#
+# Biome generation configuration (whether a biome should generate). Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+biome_generation {
+    # Set true for the Coralium Infested Swamp to generate.
+    B:"Coralium Infested Swamp"=true
+
+    # Set true for the Darklands biome to generate.
+    B:Darklands=true
+
+    # Set true for the Darklands Forest biome to generate.
+    B:"Darklands Forest"=true
+
+    # Set true for the Darklands Highland biome to generate.
+    B:"Darklands Highland"=true
+
+    # Set true for the Darklands Mountain biome to generate.
+    B:"Darklands Mountain"=true
+
+    # Set true for the Darklands Plains biome to generate.
+    B:"Darklands Plains"=true
+}
+
+
+##########################################################################################################
+# biome_spawning
+#--------------------------------------------------------------------------------------------------------#
+# Biome spawning configuration (if players have a chance of spawning in the biomes). Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+biome_spawning {
+    # If true, you can spawn in the Coralium Infested Swamp biome.
+    B:"Coralium Infested Swamp"=false
+
+    # If true, you can spawn in the Darklands biome.
+    B:Darklands=false
+
+    # If true, you can spawn in the Darklands Forest biome.
+    B:"Darklands Forest"=false
+
+    # If true, you can spawn in the Darklands Highland biome.
+    B:"Darklands Highland"=false
+
+    # If true, you can spawn in the Darklands Mountain biome.
+    B:"Darklands Mountain"=false
+
+    # If true, you can spawn in the Darklands Plains biome.
+    B:"Darklands Plains"=false
+}
+
+
+##########################################################################################################
+# biome_weight
+#--------------------------------------------------------------------------------------------------------#
+# Biome weight configuration (the chance n out of 100 that a biome is picked to generate). Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+biome_weight {
+    # Biome weight for the Coralium Infested Swamp biome, controls the chance of it generating (n out of 100)
+    # [range: 0 ~ 100, default: 5]
+    I:"Coralium Infested Swamp"=4
+
+    # Biome weight for the Darklands biome, controls the chance of it generating (n out of 100).
+    # [range: 0 ~ 100, default: 5]
+    I:Darklands=4
+
+    # Biome weight for the Darklands Forest biome, controls the chance of it generating (n out of 100)
+    # [range: 0 ~ 100, default: 5]
+    I:"Darklands Forest"=4
+
+    # Biome weight for the Darklands Highland biome, controls the chance of it generating (n out of 100)
+    # [range: 0 ~ 100, default: 5]
+    I:"Darklands Highland"=4
+
+    # Biome weight for the Darklands Mountain biome, controls the chance of it generating (n out of 100)
+    # [range: 0 ~ 100, default: 5]
+    I:"Darklands Mountain"=4
+
+    # Biome weight for the Darklands Plains biome, controls the chance of it generating (n out of 100)
+    # [range: 0 ~ 100, default: 5]
+    I:"Darklands Plains"=4
+}
+
+
+##########################################################################################################
+# blocks
+#--------------------------------------------------------------------------------------------------------#
+# These settings allow you to disable specific blocks in the mod, mainly slabs, stairs and walls. Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+blocks {
+    B:"Abyssal Cobblestone Slab"=true
+    B:"Abyssal Cobblestone Stairs"=true
+    B:"Abyssal Cobblestone Wall"=true
+    B:"Abyssal Stone Brick Slab"=true
+    B:"Abyssal Stone Brick Stairs"=true
+    B:"Abyssalnite Cobblestone Slab"=true
+    B:"Abyssalnite Cobblestone Stairs"=true
+    B:"Abyssalnite Cobblestone Wall"=true
+    B:"Abyssalnite Stone Brick Slab"=true
+    B:"Abyssalnite Stone Brick Stairs"=true
+    B:"Coralium Cobblestone Slab"=true
+    B:"Coralium Cobblestone Stairs"=true
+    B:"Coralium Cobblestone Wall"=true
+    B:"Coralium Stone Brick Slab"=true
+    B:"Coralium Stone Brick Stairs"=true
+    B:"Darklands Oak Slab"=true
+    B:"Darklands Oak Stairs"=true
+    B:"Darkstone Brick Slab"=true
+    B:"Darkstone Brick Stairs"=true
+    B:"Darkstone Cobblestone Slab"=true
+    B:"Darkstone Cobblestone Stairs"=true
+    B:"Darkstone Cobblestone Wall"=true
+    B:"Darkstone Slab"=true
+    B:"Dreadstone Brick Slab"=true
+    B:"Dreadstone Brick Stairs"=true
+    B:"Dreadstone Cobblestone Slab"=true
+    B:"Dreadstone Cobblestone Stairs"=true
+    B:"Dreadstone Cobblestone Wall"=true
+    B:"Ethaxium Brick Slab"=true
+    B:"Ethaxium Brick Stairs"=true
+}
+
+
+##########################################################################################################
+# dimensions
+#--------------------------------------------------------------------------------------------------------#
+# Dimension configuration (ID configuration and dimension unloading). Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+dimensions {
+    # The third dimension, also known as §oThe Realm of J'zahar§r.
+    I:Omothol=52
+
+    # Set true to prevent Omothol from automatically unloading (might affect performance)
+    B:"Prevent unloading: Omothol"=false
+
+    # Set true to prevent The Abyssal Wasteland from automatically unloading (might affect performance)
+    B:"Prevent unloading: The Abyssal Wasteland"=false
+
+    # Set true to prevent The Dark Realm from automatically unloading (might affect performance)
+    B:"Prevent unloading: The Dark Realm"=false
+
+    # Set true to prevent The Dreadlands from automatically unloading (might affect performance)
+    B:"Prevent unloading: The Dreadlands"=false
+
+    # The first dimension, full of undead monsters.
+    I:"The Abyssal Wasteland"=50
+
+    # Hidden fourth dimension, reached by falling down from Omothol
+    I:"The Dark Realm"=53
+
+    # The second dimension, infested with mutated monsters.
+    I:"The Dreadlands"=51
+}
+
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# General configuration (misc things). Only the spawn weights require a Minecraft restart for changes to take effect.
+##########################################################################################################
+
+general {
+    # Toggles whether or not Abyssal Zombies should use the Biome Dictionary for finding biomes to spawn in (which might lead to them spawning in dimensions from other mods).
+    B:"Abyssal Zombie Biome Dictionary Spawning"=true
+
+    # Toggles any interactions where armor sets either give certain Potion Effects, or dispell others. Useful if you have another mod installed that provides similar customization to any armor set.
+    B:"Armor Potion Effects"=true
+
+    # Toggles whether blocks that emits particles should do so.
+    B:"Block particles"=true
+
+    # The range (in chunks) that will be affected by the Ritual of Cleansing (on the x and z axis)
+    # [range: 3 ~ 100, default: 32]
+    I:"Cleansing Ritual Range"=32
+
+    # Entities added to this list are considered carriers of the Coralium Plague (this also makes them immune).
+    S:"Coralium Plague Carrier List" <
+     >
+
+    # Entities added to this list are considered immune to the Coralium Plague.
+    S:"Coralium Plague Immunity List" <
+     >
+
+    # Set true to allow the Coralium Plague to spread outside The Abyssal Wasteland.
+    B:"Coralium Plague spreading"=false
+
+    # The range (in chunks) that will be affected by the Ritual of Corruption (on the x and z axis)
+    # [range: 3 ~ 100, default: 32]
+    I:"Corruption Ritual Range"=32
+
+    # Spawn weight for Dark Offspring. They spawn twice as likely in Darklands Forests and Roofed Forests.
+    # [range: 0 ~ 50, default: 5]
+    I:"Dark Offspring Spawn Weight"=5
+
+    # Mobs added to this list will have a chance of spawning a Demon Animal of choice on death.
+    # Format: entityid;demonanimal;chance 
+    # where entityid is the String used in the /summon command
+    #  demonanimal is a Integer representing the Demon Animal to spawn (0 = Demon Pig, 1 = Demon Cow, 2 = Demon Chicken, 3 = Demon Sheep)
+    # chance is a decimal number representing the chance (optional, can be left out) of the Demon Animal being spawned (0.2 would mean a 20% chance, defaults to 100% if not set [default: ]
+    S:"Demon Animal Transformations" <
+     >
+
+    # Set to false to prevent Demon Animals (Pigs, Cows, Chickens) from burning in the overworld.
+    B:"Demon Animal burning"=true
+
+    # Spawn weight for the Demon Animals (Pigs, Cows, Chickens) spawning in the Nether.
+    # [range: 0 ~ 100, default: 15]
+    I:"Demon Animal spawn weight"=0
+
+    # Toggles whether or not an Evil Animal spawns a Demon Animal on death.
+    B:"Demon Animals Spawn on Death"=true
+
+    # Toggles whether or not Depths Ghouls should use the Biome Dictionary for finding biomes to spawn in (which might lead to them spawning in dimensions from other mods).
+    B:"Depths Ghoul Biome Dictionary Spawning"=true
+
+    # Toggles whether or not to override the name locking and display item names regardless of the knowledge being obtained or not.
+    B:"Display Item Names"=false
+
+    # Entities added to this list are considered carriers of the Dread Plague (this also makes them immune).
+    S:"Dread Plague Carrier List" <
+     >
+
+    # Entities added to this list are considered immune to the Dread Plague.
+    S:"Dread Plague Immunity List" <
+     >
+
+    # Toggles whether or not Dreadlands Grass can spread onto normal grass and dirt, slowly turning them into their Dreadlands counterparts.
+    B:"Dreadlands Grass Spread"=true
+    I:"End Abyssal Zombie spawn weight"=5
+
+    # Toggles whether entities that emits particles should do so.
+    B:"Entity particles"=true
+
+    # Toggles whether or not Evil Animals only spawn at night during a new moon.
+    B:"Evil Animal New Moon Spawning"=true
+
+    # Spawn weight for the Evil Animals (Pigs, Cows, Chickens), keep under 35 to avoid complete annihilation.
+    # [range: 0 ~ 100, default: 20]
+    I:"Evil Animal spawn weight"=0
+    B:"Evil Animals Are Monsters"=false
+
+    # Toggles Hardcore mode. If set to true, all mobs (in the mod) will become tougher.
+    B:"Hardcore Mode"=false
+
+    # When Hardcore Mode is enabled, you can use this to amplify the armor-piercing damage mobs deal.
+    # [range: 1.0 ~ 10.0, default: 1.0]
+    D:"Hardcore Mode damage amplifier"=1.0
+
+    # Entities added to this list can't be captured with the Interdimensional Cage.
+    S:"Interdimensional Cage Blacklist" <
+     >
+
+    # Delay in ticks until Knowledge is synced to the client upon changing dimensions. Higher numbers mean you might see item names re-locked for a few seconds when changing dimension, but might reduce load time for the dimension by a little (useful in larger modpacks).
+    # [range: 20 ~ 400, default: 60]
+    I:"Knowledge Sync Delay"=60
+    B:"Lesser Shoggoth Overworld Spawning"=true
+
+    # Toggles whether or not Liquid Antimatter will disintegrate any items dropped into a pool of it.
+    B:"Liquid Antimatter item disintegration"=true
+    B:"Liquid Coralium Physics"=false
+
+    # Set true for the Liquid Coralium to convert other liquids into itself and transmute blocks into their Abyssal Wasteland counterparts outside of the Abyssal Wasteland.
+    B:"Liquid Coralium transmutation"=false
+
+    # Toggles whether or not AbyssalCraft Items should be inserted into vanilla loot tables (dungeons, strongholds etc).
+    B:"Loot Table Content"=true
+
+    # Toggles whether or not Books can be enchanted through the Mass Enchantment ritual.
+    B:"Mass Enchantment Books"=false
+
+    # The combined max level a single enchantment applied through the Mass Enchantment ritual can have. For example, if the max level is 10 and you apply 8 Sharpness 5 books, you'd end up with Sharpness 10 on the Item, rather than 40.
+    # [range: 1 ~ 100, default: 10]
+    I:"Mass Enchantment Max Level"=10
+
+    # Toggles whether or not Demon Animals will spread Mimic Fire instead of regular Fire (regular Fire can affect performance)
+    B:"Mimic Fire"=true
+
+    # Toggles whether or not the Necronomicon knowledge will sync from the server to the client each time a player opens their Necronomicon.
+    B:"Necronomicon Data Syncing"=true
+
+    # Set true to allow the Liquid Coralium to spread across oceans. WARNING: The game can crash from this.
+    B:"Oceanic Coralium Pollution"=false
+
+    # Toggles whether or not the Night Vision buff from the Plated Coralium Helmet should be applied in all dimensions, rather than only Surface Worlds.
+    B:"Plated Coralium Helmet Night Vision Everywhere"=true
+
+    # Toggles whether or not portals require a player to be nearby in order for it to rarely spawn mobs. If this option is disabled they follow the same principle as Nether portals.
+    B:"Portal Mob Spawning Near Players"=true
+
+    # Cooldown after using a portal, increasing the value increases the delay until you can teleport again. Measured in ticks (20 ticks = 1 second).
+    # [range: 10 ~ 300, default: 100]
+    I:"Portal cooldown"=10
+
+    # Toggles whether or not to clear and repopulate the monster spawn list of all dimension biomes to ensure no mob from another mod got in there.
+    B:"Purge Mob Spawns"=false
+
+    # The range (in chunks) that will be affected by the Ritual of Purging (on the x and z axis)
+    # [range: 3 ~ 100, default: 32]
+    I:"Purging Ritual Range"=32
+
+    # Dimension IDs added to this list won't be used as potential destinations for black holes created by J'zahar.
+    I:"Reality Maelstrom Blacklist" <
+     >
+
+    # Toggles whether or not boss dialogs are displayed at any point during their fights (when they spawn, when they die,  etc)
+    B:"Show Boss Dialogs"=true
+
+    # Toggles whether or not to add smelting recipes for armor pieces.
+    B:"Smelting Recipes"=false
+
+    # Sets the opacity for the overlay shown when wearing the Visage of The Depths, reducing the value increases the transparency on the texture. Client Side only!
+    # [range: 0.5 ~ 1.0, default: 1.0]
+    D:"Visage of The Depths Overlay Opacity"=1.0
+}
+
+
+##########################################################################################################
+# item_blacklist
+#--------------------------------------------------------------------------------------------------------#
+# Entity Item Blacklist (allows you to blacklist items/blocks for entities that can pick up things). Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+item_blacklist {
+    # Items/Blocks added to this list won't be picked up by Abyssal Anti-Zombies. Format: modid:name:meta, where meta is optional.
+    S:"Abyssal Anti-Zombie Item Blacklist" <
+        minecraft:rotten_flesh
+        minecraft:bone
+        abyssalcraft:antiflesh
+        abyssalcraft:corflesh
+        abyssalcraft:anticorflesh
+     >
+
+    # Items/Blocks added to this list won't be picked up by Abyssal Zombies. Format: modid:name:meta, where meta is optional.
+    S:"Abyssal Zombie Item Blacklist" <
+        minecraft:rotten_flesh
+        minecraft:bone
+        abyssalcraft:antiflesh
+        abyssalcraft:corflesh
+        abyssalcraft:anticorflesh
+     >
+
+    # Items/Blocks added to this list won't be picked up by Anti-Ghouls. Format: modid:name:meta, where meta is optional.
+    S:"Anti-Ghoul Item Blacklist" <
+        minecraft:rotten_flesh
+        minecraft:bone
+        abyssalcraft:antiflesh
+        abyssalcraft:corflesh
+        abyssalcraft:anticorflesh
+     >
+
+    # Toggles whether or not Anti-Players can pick up loot. You really should just blacklist them in whatever mob spawner/duplicator instead.
+    B:"Anti-Players Can Pick Up Loot"=true
+
+    # Items/Blocks added to this list won't be picked up by Depths Ghouls. Format: modid:name:meta, where meta is optional.
+    S:"Depths Ghoul Item Blacklist" <
+        minecraft:rotten_flesh
+        minecraft:bone
+        abyssalcraft:antiflesh
+        abyssalcraft:corflesh
+        abyssalcraft:anticorflesh
+     >
+
+    # Items/Blocks added to this list won't be picked up by Omothol Ghouls. Format: modid:name:meta, where meta is optional.
+    S:"Omothol Ghoul Item Blacklist" <
+     >
+}
+
+
+##########################################################################################################
+# mod_compat
+#--------------------------------------------------------------------------------------------------------#
+# Mod compatibility configuration (settings in regards to certain compatiblity with other mods that can be disabled at will).
+##########################################################################################################
+
+mod_compat {
+    # Toggles whether or not the Abyssal Wasteland should be darker if Hardcore Darkness is installed.
+    B:"Hardcore Darkness: Abyssal Wasteland"=true
+
+    # Toggles whether or not the Dark Realm should be darker if Hardcore Darkness is installed.
+    B:"Hardcore Darkness: Dark Realm"=true
+
+    # Toggles whether or not the Dreadlands should be darker if Hardcore Darkness is installed.
+    B:"Hardcore Darkness: Dreadlands"=true
+
+    # Toggles whether or not Omothol should be darker if Hardcore Darkness is installed.
+    B:"Hardcore Darkness: Omothol"=true
+}
+
+
+##########################################################################################################
+# modules
+#--------------------------------------------------------------------------------------------------------#
+# These settings allow you to disable content from the mod that may be out of place to some extent, or other reasons. Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+modules {
+    # Set to false to revert to the old crystal recipes (and them being fuels).
+    B:"Crystal Rework"=true
+
+    # Set to false to disable Abyssalcraft Food.
+    B:"Enable Foodstuffs"=true
+
+    # Set to false to disable the Coralium and Dread Enchantments.
+    B:"Enable Plague Enchantments"=true
+
+    # Set to false to disable Upgrade Kits.
+    B:"Enable Upgrade Kits"=true
+}
+
+
+##########################################################################################################
+# shoggoth
+#--------------------------------------------------------------------------------------------------------#
+# Shoggoth Ooze configuration (blacklist materials from turning into ooze). Any changes take effect immediately.
+##########################################################################################################
+
+shoggoth {
+    # The minimum Block Hardness required for a Block to not be destroyed by Shoggoth Acid (some blocks are unaffected regardless of their hardness)
+    # [range: 2.1 ~ 51.0, default: 3.0]
+    D:"Acid Resistance Hardness"=2.1
+
+    # The frequency (in ticks) at which a Lesser Shoggoth can spit acid. Higher values increase the time between each spit attack, while lower values descrease the time (and 0 disables it).
+    # [range: 0 ~ 300, default: 100]
+    I:"Acid Spit Frequency"=0
+
+    # Toggles whether or not the eyes of Lesser Shoggoths should glow. The glowing can be heavy on performance, so if you're dropping FPS noticeably while looking at Lesser Shoggoths, consider turning this off. Client Side only!
+    B:"Glowing Eyes"=true
+
+    # Toggles whether or not Lesser Shoggoths will consume any dropped item they run into.
+    B:"Item Consumption"=false
+
+    # The cooldown (in ticks) between each attempt by a Lesser Shoggoth to construct a monolith. Higher values increase the time, while lower values decrease it (and 0 disables it).
+    # [range: 0 ~ 2400, default: 1800]
+    I:"Monolith Building Cooldown"=1800
+
+    # Toggles whether or not Shoggoth Ooze slowly reverts to dirt after constant light exposure. Ooze blocks that aren't full blocks will shrink instead.
+    B:"Ooze expiration"=true
+
+    # Toggles whether or not Shields can block the acid projectiles spat by Lesser Shoggoths.
+    B:"Shields Block Acid"=true
+
+    # Toggles whether or not Lesser Shoggoths should spread their ooze when walking around.
+    B:"Shoggoth Ooze Spread"=true
+}
+
+
+##########################################################################################################
+# silly_settings
+#--------------------------------------------------------------------------------------------------------#
+# These settings are generally out of place, and don't contribute to the mod experience. They exist because 'what if X did this?'
+##########################################################################################################
+
+silly_settings {
+    # The explosion size of antimatter mobs colliding with their normal counterpart if Nucler Antimatter Explosions is enabled.
+    I:"Antimatter Explosion Size"=80
+
+    # Toggles whether or not J'zahar can break the fourth wall.
+    B:"J'zahar Can Break The Fourth Wall"=true
+
+    # Set true to allow the Liquid Coralium to break the laws of physics in terms of movement
+    B:"Liquid Coralium Physics"=false
+
+    # Take a wild guess what this does... Done guessing? Yeah, makes the antimatter explosions more genuine by making them go all nuclear. Recommended to not enable unless you want chaos and destruction.
+    B:"Nuclear Antimatter Explosions"=false
+
+    # The explosion size of an ODB. 400 is the rough limit if running on 2GB of RAM, anything above that will require more allocated memory, and could crash the game or freeze it for longer periods of time.
+    I:"ODB Explosion Size"=160
+}
+
+
+##########################################################################################################
+# spells
+#--------------------------------------------------------------------------------------------------------#
+# Spell configuration (allows you to enable or disable specific spells added by the mod). Any changes take effect after a Minecraft restart.
+##########################################################################################################
+
+spells {
+    # Set to false to disable the Detachment spell.
+    B:Detachment=true
+
+    # Set to false to disable the Entropy spell.
+    B:Entropy=true
+
+    # Set to false to disable the Grasp of Cthulhu spell.
+    B:"Grasp of Cthulhu"=true
+
+    # Set to false to disable the Hide from the Eye spell.
+    B:"Hide from the Eye"=true
+
+    # Set to false to disable the Life Drain spell.
+    B:"Life Drain"=true
+
+    # Set to false to disable the Mining spell.
+    B:Mining=true
+
+    # Set to false to disable the Ooze Removal spell.
+    B:"Ooze Removal"=true
+
+    # Set to false to disable the Sacrificial Interdiction spell.
+    B:"Sacrificial Interdiction"=true
+
+    # Set to false to disable the Siren's Song spell.
+    B:"Siren's Song§"=true
+
+    # Set to false to disable the Steal Vigor spell.
+    B:"Steal Vigor"=true
+
+    # Set to false to disable the Undeath to Dust spell.
+    B:"Undeath to Dust"=true
+}
+
+
+##########################################################################################################
+# wet_noodle
+#--------------------------------------------------------------------------------------------------------#
+# These settings allow you to disable features of a destructive type, or things that to some extent will impact how the mod is played (while generally making it easier).
+##########################################################################################################
+
+wet_noodle {
+    # Toggles whether or not the acid projectiles Lesser Shoggoths spit can break blocks.
+    B:"Disable Acid Projectiles Breaking Blocks"=true
+
+    # Toggles whether or not J'zahar can use his attack that creates a black hole.
+    B:"Disable Black Holes"=false
+
+    # Toggles whether or not statues or failing rituals will trigger disruptions.
+    B:"Disable Disruptions"=false
+
+    # Toggles whether or not the spreading of Dreadlands through the Dread Plague is disabled. Cha'garoth remains unaffected by this (because he doesn't naturally spawn outside of the dimension).
+    B:"Disable Dreadlands Spread"=false
+
+    # Toggles whether or not Oblivion Deathbombs (or ODB Cores) can explode.
+    B:"Disable ODB Explosions"=false
+
+    # Toggles whether or not Lesser Shoggoths are immune to projectile damage.
+    B:"Disable Projectile Damage Immunity"=false
+
+    # Toggles whether or not Spectral Dragons should spawn in the Abyssal Wasteland.
+    B:"Disable Spectral Dragons"=false
+}
+
+
+##########################################################################################################
+# worldgen
+#--------------------------------------------------------------------------------------------------------#
+# World generation configuration (things that generate in the world). Any changes take effect immediately.
+##########################################################################################################
+
+worldgen {
+    # Toggles whether or not to generate Copper Ore in the Abyssal Wasteland.
+    B:"Abyssal Copper Ore"=true
+
+    # Toggles whether or not to generate Coralium Ore in the Abyssal Wasteland.
+    B:"Abyssal Coralium Ore"=true
+
+    # Toggles whether or not to generate Diamond Ore in the Abyssal Wasteland
+    B:"Abyssal Diamond Ore"=true
+
+    # Toggles whether or not to generate Gold Ore in the Abyssal Wasteland.
+    B:"Abyssal Gold Ore"=true
+
+    # Toggles whether or not to generate Iron Ore in the Abyssal Wasteland.
+    B:"Abyssal Iron Ore"=true
+
+    # Toggles whether or not to generate Nitre Ore in the Abyssal Wasteland.
+    B:"Abyssal Nitre Ore"=true
+
+    # Toggles whether or not to generate Tin Ore in the Abyssal Wasteland
+    B:"Abyssal Tin Ore"=true
+
+    # Toggles whether or not to generate Tall Obsidian Pillars in the Abyssal Wasteland.
+    B:"Abyssal Wasteland Pillars"=true
+
+    # Toggles whether or not to generate small ruins in the Abyssal Wasteland.
+    B:"Abyssal Wasteland Ruins"=true
+
+    # Toggles wheter or not to generate Abyssalnite Ore in Darklands Biomes.
+    B:"Abyssalnite Ore"=true
+
+    # Toggles whether or not to generate Coralium Ore in the Overworld.
+    B:"Coralium Ore"=true
+
+    # Coralium Ore generation. First parameter is the vein count, secound is amount of ores per vein, third is max height for it to generate at. Coralium Ore generation in swamps are half as common as oceans.
+    I:"Coralium Ore Generation" <
+        24
+        12
+        56
+     >
+
+    # Toggles whether or not to generate random Darklands structures.
+    B:"Darklands Structures"=false
+
+    # Toggles whether or not to generate Dreaded Abyssalnite Ore in the Dreadlands.
+    B:"Dreaded Abyssalnite Ore"=true
+
+    # Toggles whether or not to generate Abyssalnite Ore in the Dreadlands.
+    B:"Dreadlands Abyssalnite Ore"=true
+
+    # Toggles whether or not to generate Stalagmites in Dreadlands and Purified Dreadlands biomes.
+    B:"Dreadlands Stalagmites"=true
+
+    # Toggles whether or not statues have a chance of generating inside a Shoggoth Lair.
+    B:"Generate Statues In Lairs"=true
+
+    # Toggles whether or not to generate Liquid Antimatter Lakes in Coralium Infested Swamps.
+    B:"Liquid Antimatter Lakes"=true
+
+    # Toggles whether or not to generate Liquid Coralium Lakes in the Abyssal Wasteland.
+    B:"Liquid Coralium Lakes"=true
+
+    # Toggles whether or not to generate Liquified Coralium Ore in the Abyssal Wasteland.
+    B:"Liquified Coralium Ore"=true
+
+    # Toggles whether or not to generate Nitre Ore in the Overworld.
+    B:"Nitre Ore"=false
+
+    # Dimension IDs added to this list won't have any of AbyssalCraft's Overworld ores (Coralium, Nitre) generating in them. This only affects surface worlds (dimensions that handle world generation like the Overworld does).
+    I:"Ore Generation Dimension Blacklist" <
+     >
+
+    # Toggles whether or not to generate Pearlescent Coralium Ore in the Abyssal Wasteland.
+    B:"Pearlescent Coralium Ore"=true
+
+    # Generation chance of a Shoggoth Lair in river biomes. Higher numbers decrease the chance of a Lair generating, while lower numbers increase the chance.
+    # [range: 0 ~ 1000, default: 30]
+    I:"Shoggoth Lair Generation Chance: Rivers"=13
+
+    # Generation chance of a Shoggoth Lair in swamp biomes. Higher numbers decrease the chance of a Lair generating, while lower numbers increase the chance.
+    # [range: 0 ~ 1000, default: 30]
+    I:"Shoggoth Lair Generation Chance: Swamps"=13
+
+    # Toggles whether or not to generate Shoggoth Lairs (however, they will still generate in Omothol).
+    B:"Shoggoth Lairs"=true
+
+    # Dimension IDs added to this list won't have any of AbyssalCraft's Overworld structures (Darklands structures, Shoggoth lairs) generating in them. This only affects surface worlds (dimensions that handle world generation like the Overworld does).
+    I:"Structure Generation Dimension Blacklist" <
+        7
+     >
+
+    # Toggles whether or not the dimensions will have their terrain affected by the Amplified world type.
+    B:"Use Amplified World Type"=true
+}
+
+

config/acintegration.cfg

@@ -0,0 +1,33 @@
+# Configuration file
+
+general {
+    # Whether or not to load the Bewitchment integration.
+    B:Bewitchment=true
+
+    # Whether or not to load the Game Stages integration.
+    B:"Game Stages"=true
+
+    # Whether or not to load the MineTweaker integration.
+    B:"MineTweaker Integration"=true
+
+    # Whether or not to load the ProjectE integration
+    B:"ProjectE Integration"=false
+
+    # Whether or not to load the Thaumcraft integration. Disabling this will override any other part of said integration.
+    B:"Thaumcraft Integration"=false
+    B:"Thaumcraft Warp"=false
+
+    # Toggles wheter or not to gain additional warp from being inside AbyssalCraft dimensions
+    B:"Thaumcraft Warp: Dimensions"=true
+
+    # Toggles wheter or not to gain additional warp from attacking/being attacked by AbyssalCraft mobs
+    B:"Thaumcraft Warp: Mobs"=true
+
+    # Toggles whether or not you gain additional warp through failing rituals and Disruptions
+    B:"Thaumcraft Warp: PE"=true
+
+    # Whether or not to load the Tinkers' Construct integration.
+    B:"Tinkers' Construct"=true
+}
+
+

config/acronym/base/General.cfg

@@ -0,0 +1,38 @@
+# Configuration file
+
+general {
+    # Config entry for adding other items to count as tools. Format is "modid:item_name:meta" * is for any meta
+    S:"Other Tools" <
+        [immersiveengineering:tool:0
+        thermalfoundation:wrench:*
+        techreborn:wrench:*
+        actuallyadditions:item_laser_wrench:*
+        hammercore:wrench:*
+        hammercore:iwrench:*
+        mekanism:configurator:*
+        calculator:wrench:*
+        ic2:wrench:*
+        appliedenergistics2:certus_quartz_wrench:*
+        appliedenergistics2:nether_quartz_wrench:*
+        enderio:item_yeta_wrench:*
+        botania:twigwand:*
+        essentials:wrench:*
+        factorytech:wrench:*]
+     >
+}
+
+
+materials {
+    # List for Prioritizing OreDict returns by modid
+    S:preferredOreDictIds <
+        base
+     >
+}
+
+
+module {
+    B:"JourneyMap enabled"=true
+    B:"Tool enabled"=true
+}
+
+

config/acronym/contenttweaker/General.cfg

@@ -0,0 +1,10 @@
+# Configuration file
+
+module {
+    B:"Chickens enabled"=false
+    B:"Materials enabled"=true
+    B:"Tinkers enabled"=true
+    B:"Vanilla CraftTweaker enabled"=true
+}
+
+

config/acronym/material_system.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+item {
+    # 0 - All Item Parts on a Single MC Item, 1 - All Item Parts have their own MC Item, > 1 - That many Parts per item
+    I:size=0
+}
+
+

config/acronym/saved/material_parts_contenttweaker-original.json

@@ -0,0 +1,101 @@
+{
+  "materialMappings": {
+    "invar_rod": 66,
+    "fiery_rod": 47,
+    "aquamarine_ore_minecraft_stone": 50,
+    "invar_block": 68,
+    "osmium_ore": 110,
+    "ardite_dust": 129,
+    "modularium_molten": 75,
+    "bronze_plate": 26,
+    "compressed_iron_gear": 80,
+    "osmium_ore_minecraft_stone": 111,
+    "cobalt_gear": 20,
+    "platinum_rod": 36,
+    "inferium_ore_extraplanets_kepler22b_stone": 122,
+    "silver_plate": 11,
+    "lead_gear": 15,
+    "enhanced_galgadorian_plate": 95,
+    "tin_rod": 9,
+    "iron_ore_galacticraftcore_bottom": 121,
+    "enhanced_galgadorian_rod": 98,
+    "steeleaf_plate": 39,
+    "cobalt_rod": 24,
+    "redstone_alloy_block": 60,
+    "naphtha_molten": 76,
+    "steeleaf_rod": 42,
+    "reinforced_metal_rod": 103,
+    "galgadorian_plate": 90,
+    "bronze_rod": 29,
+    "aquamarine_ore": 30,
+    "compressed_iron_rod": 84,
+    "platinum_molten": 52,
+    "galgadorian_molten": 104,
+    "cobalt_dust": 130,
+    "tin_plate": 6,
+    "copper_plate": 1,
+    "meteoric_iron_dust": 128,
+    "galgadorian_gear": 107,
+    "inferium_ore": 119,
+    "stone_nugget": 108,
+    "platinum_ingot": 37,
+    "prosperity_ore": 120,
+    "bronze_armor": 125,
+    "redstone_alloy_rod": 58,
+    "copper_rod": 4,
+    "bronze_gear": 25,
+    "redstone_alloy_gear": 54,
+    "invar_molten": 69,
+    "invar_plate": 63,
+    "redstone_alloy_ingot": 59,
+    "titanium_molten": 127,
+    "steeleaf_molten": 48,
+    "modularium_plate": 71,
+    "lead_plate": 16,
+    "space_platinum_dust": 114,
+    "enhanced_galgadorian_molten": 105,
+    "platinum_dust": 117,
+    "invar_gear": 62,
+    "silver_gear": 10,
+    "platinum_block": 51,
+    "diamond_gear": 88,
+    "fiery_gear": 43,
+    "propene_molten": 79,
+    "plastic_molten": 77,
+    "gold_gear": 87,
+    "steeleaf_gear": 38,
+    "redstone_molten": 53,
+    "osmium_molten": 109,
+    "steel_gear": 89,
+    "tin_gear": 5,
+    "gold_ore": 115,
+    "modularium_rod": 74,
+    "reinforced_metal_plate": 100,
+    "platinum_gear": 32,
+    "modularium_gear": 70,
+    "galgadorian_rod": 93,
+    "titanium_cluster": 126,
+    "reinforced_metal_molten": 106,
+    "lead_rod": 19,
+    "copper_armor": 124,
+    "glowstone_molten": 85,
+    "iron_ore": 118,
+    "iron_gear": 86,
+    "silver_rod": 14,
+    "fiery_plate": 44,
+    "reinforced_metal_gear": 99,
+    "platinum_plate": 33,
+    "silicon_ore_sample": 112,
+    "copper_gear": 0,
+    "gold_ore_galacticraftplanets_bottom": 116,
+    "prosperity_ore_extraplanets_kepler22b_stone": 123,
+    "compressed_iron_plate": 81,
+    "enhanced_galgadorian_gear": 94,
+    "cobalt_plate": 21,
+    "ender_pearl_molten": 31,
+    "osmium_ore_sample": 113,
+    "redstone_alloy_plate": 55,
+    "invar_ingot": 67,
+    "redstone_alloy_molten": 61
+  }
+}

config/acronym/saved/material_parts_contenttweaker.json

@@ -0,0 +1,101 @@
+{
+  "materialMappings": {
+    "invar_rod": 66,
+    "fiery_rod": 47,
+    "aquamarine_ore_minecraft_stone": 50,
+    "invar_block": 68,
+    "osmium_ore": 110,
+    "ardite_dust": 129,
+    "modularium_molten": 75,
+    "bronze_plate": 26,
+    "compressed_iron_gear": 80,
+    "osmium_ore_minecraft_stone": 111,
+    "cobalt_gear": 20,
+    "platinum_rod": 36,
+    "inferium_ore_extraplanets_kepler22b_stone": 122,
+    "silver_plate": 11,
+    "lead_gear": 15,
+    "enhanced_galgadorian_plate": 95,
+    "tin_rod": 9,
+    "iron_ore_galacticraftcore_bottom": 121,
+    "enhanced_galgadorian_rod": 98,
+    "steeleaf_plate": 39,
+    "cobalt_rod": 24,
+    "redstone_alloy_block": 60,
+    "naphtha_molten": 76,
+    "steeleaf_rod": 42,
+    "reinforced_metal_rod": 103,
+    "galgadorian_plate": 90,
+    "bronze_rod": 29,
+    "aquamarine_ore": 30,
+    "compressed_iron_rod": 84,
+    "platinum_molten": 52,
+    "galgadorian_molten": 104,
+    "cobalt_dust": 130,
+    "tin_plate": 6,
+    "copper_plate": 1,
+    "meteoric_iron_dust": 128,
+    "galgadorian_gear": 107,
+    "inferium_ore": 119,
+    "stone_nugget": 108,
+    "platinum_ingot": 37,
+    "prosperity_ore": 120,
+    "bronze_armor": 125,
+    "redstone_alloy_rod": 58,
+    "copper_rod": 4,
+    "bronze_gear": 25,
+    "redstone_alloy_gear": 54,
+    "invar_molten": 69,
+    "invar_plate": 63,
+    "redstone_alloy_ingot": 59,
+    "titanium_molten": 127,
+    "steeleaf_molten": 48,
+    "modularium_plate": 71,
+    "lead_plate": 16,
+    "space_platinum_dust": 114,
+    "enhanced_galgadorian_molten": 105,
+    "platinum_dust": 117,
+    "invar_gear": 62,
+    "silver_gear": 10,
+    "platinum_block": 51,
+    "diamond_gear": 88,
+    "fiery_gear": 43,
+    "propene_molten": 79,
+    "plastic_molten": 77,
+    "gold_gear": 87,
+    "steeleaf_gear": 38,
+    "redstone_molten": 53,
+    "osmium_molten": 109,
+    "steel_gear": 89,
+    "tin_gear": 5,
+    "gold_ore": 115,
+    "modularium_rod": 74,
+    "reinforced_metal_plate": 100,
+    "platinum_gear": 32,
+    "modularium_gear": 70,
+    "galgadorian_rod": 93,
+    "titanium_cluster": 126,
+    "reinforced_metal_molten": 106,
+    "lead_rod": 19,
+    "copper_armor": 124,
+    "glowstone_molten": 85,
+    "iron_ore": 118,
+    "iron_gear": 86,
+    "silver_rod": 14,
+    "fiery_plate": 44,
+    "reinforced_metal_gear": 99,
+    "platinum_plate": 33,
+    "silicon_ore_sample": 112,
+    "copper_gear": 0,
+    "gold_ore_galacticraftplanets_bottom": 116,
+    "prosperity_ore_extraplanets_kepler22b_stone": 123,
+    "compressed_iron_plate": 81,
+    "enhanced_galgadorian_gear": 94,
+    "cobalt_plate": 21,
+    "ender_pearl_molten": 31,
+    "osmium_ore_sample": 113,
+    "redstone_alloy_plate": 55,
+    "invar_ingot": 67,
+    "redstone_alloy_molten": 61
+  }
+}

config/acronym/saved/saved_sub_blocks_contenttweaker-original.json

@@ -0,0 +1,20 @@
+{
+  "savedSubBlockNames": {
+    "0": {
+      "0": "aquamarine_ore_minecraft_stone",
+      "1": "platinum_block",
+      "2": "redstone_alloy_block",
+      "3": "invar_block",
+      "4": "osmium_ore_minecraft_stone",
+      "5": "silicon_ore_sample",
+      "6": "osmium_ore_sample",
+      "7": "gold_ore_galacticraftplanets_bottom",
+      "8": "inferium_ore_extraplanets_kepler22b_stone",
+      "9": "prosperity_ore_extraplanets_kepler22b_stone",
+      "10": "iron_ore_galacticraftcore_bottom"
+    },
+    "1": {},
+    "2": {},
+    "3": {}
+  }
+}

config/acronym/saved/saved_sub_blocks_contenttweaker.json

@@ -0,0 +1,20 @@
+{
+  "savedSubBlockNames": {
+    "0": {
+      "0": "aquamarine_ore_minecraft_stone",
+      "1": "platinum_block",
+      "2": "redstone_alloy_block",
+      "3": "invar_block",
+      "4": "osmium_ore_minecraft_stone",
+      "5": "silicon_ore_sample",
+      "6": "osmium_ore_sample",
+      "7": "gold_ore_galacticraftplanets_bottom",
+      "8": "inferium_ore_extraplanets_kepler22b_stone",
+      "9": "prosperity_ore_extraplanets_kepler22b_stone",
+      "10": "iron_ore_galacticraftcore_bottom"
+    },
+    "1": {},
+    "2": {},
+    "3": {}
+  }
+}

config/actuallyadditions.cfg

@@ -0,0 +1,610 @@
+# Configuration file
+
+"machine values" {
+    # The amount of power the atomic reconstructor can store.
+    I:"Atomic Reconstructor Power"=750000
+
+    # The size of the farmer's farming area.  Default is 9x9, must be an odd number.
+    I:"Farmer Area"=9
+
+    # By default, the Item Repairer only repairs items which are repairable in an anvil. Add an item's REGISTRY NAME here if you want it to be repairable.
+    S:"Item Repairer Extra Whitelist" <
+        tconstruct:pickaxe
+        tconstruct:shovel
+        tconstruct:hatchet
+        tconstruct:mattock
+        tconstruct:broadsword
+        tconstruct:longsword
+        tconstruct:frypan
+        tconstruct:battlesign
+        tconstruct:hammer
+        tconstruct:excavator
+        tconstruct:lumberaxe
+        tconstruct:cleaver
+        tconstruct:rapier
+     >
+
+    # If Energy Laser Relays should have energy loss
+    B:"Laser Relay Energy Loss"=true
+
+    # The energy use of the Atomic Reconstructor's Mining Lens.
+    I:"Mining Lens Energy"=60000
+
+    # The amount of power that the 4 tiers of oils generate in CF/t.  Ordered.
+    I:"Oil Gen: Power Values" <
+        40
+        80
+        100
+        120
+     >
+
+    # The amount of time that the 4 tiers of oils work for in seconds.  Ordered.
+    I:"Oil Gen: Time Values" <
+        100
+        120
+        280
+        400
+     >
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can mine, but shouldn't be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option will apply in both modes.
+    S:"Vertical Digger Blacklist" <
+     >
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option only applies if the miner is in Ores Only Mode.
+    S:"Vertical Digger Extra Whitelist" <
+     >
+}
+
+
+"mob drops" {
+    # Should Bat wings drop from Bats?
+    B:"Bat Wing Drop"=true
+
+    # If true, Mobs will randomly drop solidified XP occasionally.
+    B:"Solidified XP Drop"=false
+
+    # Should Cobwebs drop from spiders?
+    B:"Spider Cobweb Drop"=false
+}
+
+
+other {
+    # Show Advanced Item Info when holding Control on every Item.
+    B:"Advanced Info"=true
+
+    # The maximum amount of characters that is displayed by the NBT view of the CTRL Advanced Info. Set to a zero to have no limit
+    I:"Advanced Info NBT Character Limit"=1000
+
+    # Show the 'Press Control for more Info'-Text on Item Tooltips
+    B:"Advanced Info Tooltips"=true
+
+    # The size of the booklet's large font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Large Font Size"=0
+
+    # The size of the booklet's medium font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Medium Font Size"=0
+
+    # The size of the booklet's small font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Small Font Size"=0
+
+    # If true, the Lens of Color will attempt to pull from the oredict instead of only using vanilla dyes.
+    B:"Color Lens Oredict"=false
+
+    # The non-Actually Additions items that are used to configure blocks from the mod. The first one is the Redstone Torch used to configure the Redstone Mode, and the second one is the Compass used to configure Laser Relays. If another mod overrides usage of either one of these items, you can change the registry name of the used items (using blocks is not possible) here.
+    S:"Configuration Items" <
+        minecraft:redstone_torch
+        minecraft:compass
+     >
+
+    # The items that aren't allowed as outputs from OreDict Crusher recipes. Use this in case a mod, for example, adds a dust variant that can't be smelted into an ingot. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_item@3
+    S:"Crusher Output Blacklist" <
+     >
+
+    # Ingots, Dusts and Ores that will be blacklisted from being auto-registered to be crushed by the Crusher. This list uses OreDictionary Names of the Inputs only.
+    S:"Crusher Recipe Exceptions" <
+        ingotBrick
+        ingotBrickNether
+     >
+
+    # If true, Cats drop Hairy Balls Occasionally.
+    B:"Do Cat Drops"=false
+
+    # If true, Actually Additions Checks for updates on World Load.
+    B:"Do Update Check"=false
+    B:"Drill Digging Packet"=false
+
+    # The 1/n drop chance, per tick, for a fur ball to be dropped.
+    I:"Fur Drop Chance"=5000
+
+    # If true, the booklet should be given to the player when he first crafts something from the Mod
+    B:"Give Booklet on First Craft"=false
+
+    # The ItemFood, IGrowable and IPlantable Items that can not be used to craft Mashed Food. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Mashed Food Crafting Exceptions" <
+        actuallyadditions:item_coffee
+     >
+
+    # The items that aren't allowed as being generated by the Lens of the Miner. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Mining Lens Blacklist" <
+     >
+
+    # By default, the mining lens has a set number of ores it can generate. If there is an ore that it should be able to generate, add its OreDictionary name followed by an @ and the weight that it should have (the higher, the more often it will generate), followed by another @ and then an s for it to generate in stone and an n for it to generate in netherrack. For instance: oreCheese@100@s would add cheese ore with a weight of 100 that generates in stone.
+    S:"Mining lens Extra Whitelist" <
+     >
+
+    # If you want to be really boring and lame, you can turn on this setting to disable colored names on Actually Additions items. Because why would you want things to look pretty anyways, right?
+    B:"No Colored Item Names"=false
+
+    # The items that aren't allowed to be put in the Repairer. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Repair Blacklist" <
+        nex:golden_wither_bone_sword
+        nex:golden_wither_bone_pickaxe
+        nex:golden_wither_bone_shovel
+        nex:golden_wither_bone_axe
+        nex:golden_wither_bone_hoe
+        nex:golden_wither_bone_hammer
+     >
+
+    # The items that aren't allowed to be put in the Traveller's Sack. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Sack Blacklist" <
+     >
+
+    # If true, Solidified Experience will always spawn orbs, even for regular players.
+    B:"Solid XP Orbs"=false
+
+    # By default, the Spawner Changer allows every living entity to be put into a spawner. If there is one that shouldn't be able to, put its MAPPING NAME here.
+    S:"Spawner Changer Blacklist" <
+        VillagerGolem
+     >
+
+    # Turn this on to make recipes for items from the mod really hard. (This is a joke feature poking fun at the whole FTB Infinity Expert Mode style of playing. You shouldn't really turn this on as it makes the mod completely unplayable.)
+    B:"Super Duper Hard Recipes"=false
+
+    # The amount of ticks waited before a TileEntity sends an additional Update to the Client
+    I:"Tile Entities: Update Interval"=5
+
+    # Should Tiny Coal and Tiny Charcoal be craftable
+    B:"Tiny Coal"=false
+
+    # If true, Actually Additions' Update Checker searches for updates for the Minecraft Version you currently play on.
+    B:"Version Specific Update Checker"=false
+
+    # Should Actually Additions Loot generate in dungeons?
+    B:"Village and Dungeon Loot"=false
+
+    # Should right-clicking a bowl on water blocks create a water bowl?
+    B:"Water Bowl"=false
+
+    # Should the water bowl spill if you don't sneak while using it?
+    B:"Water Bowl Spilling"=false
+
+    # 11?
+    I:"What is 11"=0
+
+    # The amount of ticks it takes for a worm to die. When at 0 ticks, it will not die.
+    I:"Worm Death Time"=36000
+
+    # If true, worms will drop from tilling the soil.
+    B:Worms=true
+}
+
+
+"tool control" {
+    # This will disable the Black Quartz AIOT. It will not be registered. [default: false]
+    B:"Disable: Black Quartz AIOT"=false
+
+    # This will disable the Black Quartz Axe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Axe"=false
+
+    # This will disable the Black Quartz Boots. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Boots"=false
+
+    # This will disable the Black Quartz Chestplate. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Chestplate"=false
+
+    # This will disable the Black Quartz Helmet. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Helmet"=false
+
+    # This will disable the Black Quartz Hoe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Hoe"=false
+
+    # This will disable the Black Quartz Pants. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Pants"=false
+
+    # This will disable the Black Quartz Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Pickaxe"=false
+
+    # This will disable the Black Quartz Shovel. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Shovel"=false
+
+    # This will disable the Black Quartz Sword. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Sword"=false
+
+    # This will disable the Diamatine Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal AIOT"=false
+
+    # This will disable the Diamatine Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Axe"=false
+
+    # This will disable the Diamatine Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Boots"=false
+
+    # This will disable the Diamatine Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Chestplate"=false
+
+    # This will disable the Diamatine Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Helmet"=false
+
+    # This will disable the Diamatine Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Hoe"=false
+
+    # This will disable the Diamatine Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Pants"=false
+
+    # This will disable the Diamatine Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Pickaxe"=false
+
+    # This will disable the Diamatine Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Shovel"=false
+
+    # This will disable the Diamatine Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Sword"=false
+
+    # This will disable the Diamond AIOT. It will not be registered. [default: false]
+    B:"Disable: Diamond AIOT"=false
+
+    # This will disable the Emeradic Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal AIOT"=false
+
+    # This will disable the Emeradic Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Axe"=false
+
+    # This will disable the Emeradic Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Boots"=false
+
+    # This will disable the Emeradic Crystal Chest. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Chest"=false
+
+    # This will disable the Emeradic Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Helmet"=false
+
+    # This will disable the Emeradic Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Hoe"=false
+
+    # This will disable the Emeradic Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Pants"=false
+
+    # This will disable the Emeradic Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Pickaxe"=false
+
+    # This will disable the Emeradic Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Shovel"=false
+
+    # This will disable the Emeradic Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Sword"=false
+
+    # This will disable the Emerald AIOT. It will not be registered. [default: false]
+    B:"Disable: Emerald AIOT"=false
+
+    # This will disable the Emerald Axe. It will not be registered. [default: false]
+    B:"Disable: Emerald Axe"=false
+
+    # This will disable the Emerald Boots. It will not be registered. [default: false]
+    B:"Disable: Emerald Boots"=false
+
+    # This will disable the Emerald Chestplate. It will not be registered. [default: false]
+    B:"Disable: Emerald Chestplate"=false
+
+    # This will disable the Emerald Helmet. It will not be registered. [default: false]
+    B:"Disable: Emerald Helmet"=false
+
+    # This will disable the Emerald Hoe. It will not be registered. [default: false]
+    B:"Disable: Emerald Hoe"=false
+
+    # This will disable the Emerald Pants. It will not be registered. [default: false]
+    B:"Disable: Emerald Pants"=false
+
+    # This will disable the Emerald Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Emerald Pickaxe"=false
+
+    # This will disable the Emerald Shovel. It will not be registered. [default: false]
+    B:"Disable: Emerald Shovel"=false
+
+    # This will disable the Emerald Sword. It will not be registered. [default: false]
+    B:"Disable: Emerald Sword"=false
+
+    # This will disable the Engineer's Goggles. It will not be registered. [default: false]
+    B:"Disable: Engineer's Goggles"=false
+
+    # This will disable the Engineer's Infrared Goggles. It will not be registered. [default: false]
+    B:"Disable: Engineer's Infrared Goggles"=false
+
+    # This will disable the Enori Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal AIOT"=false
+
+    # This will disable the Enori Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Axe"=false
+
+    # This will disable the Enori Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Boots"=false
+
+    # This will disable the Enori Crystal Chest. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Chest"=false
+
+    # This will disable the Enori Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Helmet"=false
+
+    # This will disable the Enori Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Hoe"=false
+
+    # This will disable the Enori Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Pants"=false
+
+    # This will disable the Enori Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Pickaxe"=false
+
+    # This will disable the Enori Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Shovel"=false
+
+    # This will disable the Enori Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Sword"=false
+
+    # This will disable the Golden AIOT. It will not be registered. [default: false]
+    B:"Disable: Golden AIOT"=false
+
+    # This will disable the Iron AIOT. It will not be registered. [default: false]
+    B:"Disable: Iron AIOT"=false
+
+    # This will disable the Obsidian AIOT. It will not be registered. [default: false]
+    B:"Disable: Obsidian AIOT"=false
+
+    # This will disable the Obsidian Axe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Axe"=false
+
+    # This will disable the Obsidian Boots. It will not be registered. [default: false]
+    B:"Disable: Obsidian Boots"=false
+
+    # This will disable the Obsidian Chestplate. It will not be registered. [default: false]
+    B:"Disable: Obsidian Chestplate"=false
+
+    # This will disable the Obsidian Helmet. It will not be registered. [default: false]
+    B:"Disable: Obsidian Helmet"=false
+
+    # This will disable the Obsidian Hoe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Hoe"=false
+
+    # This will disable the Obsidian Pants. It will not be registered. [default: false]
+    B:"Disable: Obsidian Pants"=false
+
+    # This will disable the Obsidian Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Pickaxe"=false
+
+    # This will disable the Obsidian Shovel. It will not be registered. [default: false]
+    B:"Disable: Obsidian Shovel"=false
+
+    # This will disable the Obsidian Sword. It will not be registered. [default: false]
+    B:"Disable: Obsidian Sword"=false
+
+    # This will disable the Palis Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal AIOT"=false
+
+    # This will disable the Palis Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Axe"=false
+
+    # This will disable the Palis Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Boots"=false
+
+    # This will disable the Palis Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Chestplate"=false
+
+    # This will disable the Palis Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Helmet"=false
+
+    # This will disable the Palis Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Hoe"=false
+
+    # This will disable the Palis Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Pants"=false
+
+    # This will disable the Palis Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Pickaxe"=false
+
+    # This will disable the Palis Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Shovel"=false
+
+    # This will disable the Palis Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Sword"=false
+
+    # This will disable the Restonia Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal AIOT"=false
+
+    # This will disable the Restonia Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Axe"=false
+
+    # This will disable the Restonia Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Boots"=false
+
+    # This will disable the Restonia Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Chestplate"=false
+
+    # This will disable the Restonia Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Helmet"=false
+
+    # This will disable the Restonia Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Hoe"=false
+
+    # This will disable the Restonia Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Pants"=false
+
+    # This will disable the Restonia Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Pickaxe"=false
+
+    # This will disable the Restonia Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Shovel"=false
+
+    # This will disable the Restonia Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Sword"=false
+
+    # This will disable the Stone AIOT. It will not be registered. [default: false]
+    B:"Disable: Stone AIOT"=false
+
+    # This will disable the Void Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Void Crystal AIOT"=false
+
+    # This will disable the Void Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Axe"=false
+
+    # This will disable the Void Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Boots"=false
+
+    # This will disable the Void Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Chestplate"=false
+
+    # This will disable the Void Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Helmet"=false
+
+    # This will disable the Void Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Hoe"=false
+
+    # This will disable the Void Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Pants"=false
+
+    # This will disable the Void Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Pickaxe"=false
+
+    # This will disable the Void Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Shovel"=false
+
+    # This will disable the Void Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Sword"=false
+
+    # This will disable the Wooden AIOT. It will not be registered. [default: false]
+    B:"Disable: Wooden AIOT"=false
+}
+
+
+"tool values" {
+    # By default, the AIOT can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"AIOT Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+
+    # If true,'Press key for more information' text should show when the item has a page in the booklet
+    B:"Booklet Quick Opening Info"=true
+
+    # By default, the Drill can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Drill Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+}
+
+
+"world gen" {
+    # Should Black Lotus generate in the World?
+    B:"Black Lotus Gen"=true
+
+    # The Amount of Black Lotus generating
+    I:"Black Lotus: Amount"=14
+
+    # Shold Black Quartz generate in the world?
+    B:"Black Quartz"=false
+
+    # Should Canola generate in the World?
+    B:"Canola Gen"=true
+
+    # The Amount of Canola generating
+    I:"Canola: Amount"=10
+
+    # Should Coffee Plants generate in the World?
+    B:"Coffee Gen"=true
+
+    # The Amount of Coffee generating
+    I:"Coffee: Amount"=6
+
+    # Should Custom Crop Fields exist?
+    B:"Crop Field: Existence"=false
+
+    # If Crystal Clusters should generate in Lush Caves
+    B:"Crystal Clusters in Lush Caves"=false
+
+    # Should the Engineer Villager and his House generate in the worl?
+    B:"Engineer Villager: Existence"=false
+
+    # Should Flax generate in the World?
+    B:"Flax Gen"=false
+
+    # The Amount of Flax generating
+    I:"Flax: Amount"=8
+
+    # Should caves with trees and grass randomly generate underground?
+    B:"Generate Lush Caves"=true
+
+    # Should the Jam Villager and his House generate in the world?
+    B:"Jam Villager: Existence"=false
+    I:"Jam Villager: ID"=493827
+
+    # The chances for lush caves to generate. The lower the number, the higher the chances.
+    I:"Lush Caves: Chance"=20
+
+    # If true, the ore gen dimension blacklist will be treated as a whitelist.
+    B:"Ore Gen Whitelist"=false
+
+    # The list of IDs that Actually Additions OreGen (Ex: Black Quartz) is banned in. This also applies for other world gen like lush caves.
+    I:"OreGen Dimension Blacklist" <
+        10
+        7
+        20
+        28885
+        50
+        51
+        52
+        144
+        -13
+        -14
+        -15
+        -16
+        -17
+        -18
+        -19
+        -20
+        -21
+        -22
+        -23
+        -24
+        -25
+        -26
+        -27
+        -28
+        -29
+        -30
+        -31
+        -32
+        -33
+        -34
+        -35
+        -36
+        -37
+        -38
+        -39
+        -40
+        -41
+        -42
+        -43
+     >
+
+    # The list of IDs of the dimensions that Actually Additions Plants (Rice for example) are banned in.
+    I:"Plant Blacklist" <
+        10
+     >
+
+    # Should Rice generate in the World?
+    B:"Rice Gen"=true
+
+    # The Amount of Rice generating
+    I:"Rice: Amount"=15
+
+    # Should Treasure Chests generate in the World?
+    B:"Treasure Chest Gen"=false
+}
+
+

config/advancedmortars.module.Mortar.cfg

@@ -0,0 +1,59 @@
+# Configuration file
+
+general {
+    # Set to false to make the mortar drop its contents when moved.
+    B:KEEP_CONTENTS=true
+
+    client {
+        # Set to false to hide the mortar interaction hints in the UI overlay.
+        B:DISPLAY_INTERACTION_HINTS=true
+
+        # Set to false to hide the mortar durability in the UI overlay.
+        B:DISPLAY_MORTAR_DURABILITY=true
+    }
+
+    recipes {
+        # Set to false to disable all default recipes.
+        B:ENABLE_DEFAULT_RECIPES=false
+
+        # Amount of exhaustion to charge the player per click required to complete a recipe.
+        # Set to 0 to disable.
+        # Min: 0.0
+        # Max: 40.0
+        D:EXHAUSTION_COST_PER_CLICK=0.0
+
+        # Minimum amount of hunger the player needs to operate a mortar.
+        # Set to 0 to disable.
+        # Min: 0
+        # Max: 20
+        I:MINIMUM_HUNGER_TO_USE=0
+
+        # If set to true, the mortar will require an empty hand to use.
+        B:REQUIRE_EMPTY_HAND_TO_USE=false
+    }
+
+    durability {
+        # Set to 0 for infinite uses.
+        # Min: 0
+        # Max: 2147483647
+        I:DIAMOND=1024
+
+        # Set to 0 for infinite uses.
+        # Min: 0
+        # Max: 2147483647
+        I:IRON=256
+
+        # Set to 0 for infinite uses.
+        # Min: 0
+        # Max: 2147483647
+        I:STONE=64
+
+        # Set to 0 for infinite uses.
+        # Min: 0
+        # Max: 2147483647
+        I:WOOD=16
+    }
+
+}
+
+

config/animalium.cfg

@@ -0,0 +1,67 @@
+# Configuration file
+
+"animal attack settings" {
+    B:"Bears Attack Everything (Except Bears)"=false
+    B:"Bears Attack Monsters"=false
+    B:"Piranhas Attack Everything (Except Piranhas)"=false
+    B:"Piranhas Attack Monsters"=false
+    I:"Piranhas Damage Boats Probablility"=30
+    B:"Piranhas Damage Boats on Colliding"=true
+    I:"Rat Item Stealing Probability Bigger Numbers = Less Chance"=1
+    B:"Rats Attack Everything (Except Rats)"=false
+    B:"Rats Attack Monsters"=false
+    B:"Rats Steal Items)"=false
+    B:"Wild Dogs Attack Everything (Except Wild Dogs)"=false
+    B:"Wild Dogs Attack Monsters"=false
+}
+
+
+"animal spawn settings" {
+    I:"Bear Max Y Spawn Height"=256
+    I:"Bear Spawn Chance Probability"=1
+
+    #  [default: [Ljava.lang.String;@45d5585e]
+    S:"Bear Spawn Dimension Blacklist" <
+        1
+        -1
+     >
+    I:"Bear Spawn Group Maximum Size"=1
+    I:"Bear Spawn Group Minimum Size"=1
+    B:"Bears Spawn Only During Day"=true
+    I:"Piranha Spawn Chance Probability"=2
+
+    #  [default: [Ljava.lang.String;@3ffc96e7]
+    S:"Piranha Spawn Dimension Blacklist" <
+        1
+        -1
+     >
+    I:"Piranha Spawn Group Maximum Size"=2
+    I:"Piranha Spawn Group Minimum Size"=1
+    I:"Rat Max Y Spawn Height"=256
+    I:"Rat Spawn Chance Probability"=2
+
+    #  [default: [Ljava.lang.String;@1ddc2cb8]
+    S:"Rat Spawn Dimension Blacklist" <
+        1
+        -1
+     >
+    I:"Rat Spawn Group Maximum Size"=3
+    I:"Rat Spawn Group Minimum Size"=1
+    I:"Wild Dog Max Y Spawn Height"=256
+    I:"Wild Dog Spawn Chance Probability"=2
+
+    #  [default: [Ljava.lang.String;@76f9e8c1]
+    S:"Wild Dog Spawn Dimension Blacklist" <
+        1
+        -1
+     >
+    I:"Wild Dog Spawn Group Maximum Size"=2
+    I:"Wild Dog Spawn Group Minimum Size"=1
+}
+
+
+"wild dog hit box complaints!" {
+    B:"Render Dog Hitbox for Scrub Combat Practice"=false
+}
+
+

config/antiqueatlas/antiqueatlas.cfg

@@ -0,0 +1,104 @@
+# Configuration file
+
+##########################################################################################################
+# gameplay
+#--------------------------------------------------------------------------------------------------------#
+# These settings will affect how the mod behaves in certain situations and the players' overall gameplay, but generally won't affect performance.
+##########################################################################################################
+
+gameplay {
+    # Whether to add local marker for the spot where the player died.
+    B:autoDeathMarker=true
+
+    # Whether to add global markers for Nether Portals.
+    B:autoNetherPortalMarkers=true
+
+    # Whether to add global markers for NPC villages.
+    B:autoVillageMarkers=true
+
+    # Whether to remember last open browsing position and zoom level for each dimension in every atlas.
+    # If disabled, all dimensions and all atlases will be "synchronized" at the same coordinates and zoom level, and map will "follow" player by default.
+    B:doSaveBrowsingPos=true
+
+    # Player will need to craft atlas item to use atlas.
+    B:itemNeeded=true
+}
+
+
+##########################################################################################################
+# performance
+#--------------------------------------------------------------------------------------------------------#
+# These settings affect the algorithms for scanning the world, drawing the map etc. Changing them may improve the game's overall stability and performance at the cost of Atlas' functionality.
+##########################################################################################################
+
+performance {
+    # If true, map render time will be output.
+    B:debugRender=false
+
+    # Whether to rescan chunks in the area that have been previously mapped. This is useful in case of changes in coastline (including small ponds of water and lava), or if land disappears completely (for sky worlds).
+    # Disable for better performance.
+    B:doRescan=true
+
+    # Whether to perform additional scanning to locate small ponds of water or lava.
+    # Disable for better performance.
+    B:doScanPonds=true
+
+    # Whether to perform additional scanning to locate ravines.
+    # Disable for better performance.
+    B:doScanRavines=true
+
+    # Force loading of chunks within scan radius even if it exceeds regular chunk loading distance.
+    # Enabling this may SEVERELY decrease performance!
+    B:forceChunkLoading=false
+
+    # The maximum number of markers a particular atlas can hold.
+    # Min: 0
+    # Max: 2147483647
+    I:markerLimit=1024
+
+    # Time in seconds between two scans of the area.
+    # Higher value gives better performance.
+    D:newScanInterval=2.0
+
+    # The number of area scans between full rescans.
+    # Higher value gives better performance.
+    # Min: 1
+    # Max: 1000
+    I:rescanRate=12
+
+    # The radius of the area around the player which is scanned by the Atlas at regular intervals.
+    # Note that this will not force faraway chunks to load, unless force_chunk_loading is enabled.
+    # Lower value gives better performance.
+    I:scanRadius=8
+}
+
+
+##########################################################################################################
+# userinterface
+#--------------------------------------------------------------------------------------------------------#
+# These setting will affect the look and feel of the Atlas' interface.
+##########################################################################################################
+
+userinterface {
+    # Default zoom level. The number corresponds to the size of a block on the map relative to the size of a GUI pixel. Preferrably a power of 2.
+    # Min: 0.001953125
+    # Max: 16.0
+    D:defaultScale=0.5
+
+    # If false (by default), then mousewheel up is zoom in, mousewheel down is zoom out.
+    # If true, then the direction is reversed.
+    B:doReverseWheelZoom=false
+    B:doScaleMarkers=false
+
+    # Maximum zoom level. The number corresponds to the size of a block on the map relative to the size of a GUI pixel. Preferrably a power of 2.
+    # Min: 0.001953125
+    # Max: 16.0
+    D:maxScale=4.0
+
+    # Minimum zoom level. The number corresponds to the size of a block on the map relative to the size of a GUI pixel. Preferrably a power of 2. Smaller values may decrease performance!
+    # Min: 0.001953125
+    # Max: 16.0
+    D:minScale=0.03125
+}
+
+

config/antiqueatlas/atlas_overlay.cfg

@@ -0,0 +1,97 @@
+# Configuration file
+
+##########################################################################################################
+# appearance
+#--------------------------------------------------------------------------------------------------------#
+# These settings change what the map shows, or how it is shown.
+##########################################################################################################
+
+appearance {
+    # The width of the map border on the left and right sides of the minimap tiles.
+    # Represented as a fraction of the image width.
+    # Below a certain threshold, this border will be overtaken by the map border graphic.
+    # Min: 0.0
+    # Max: 0.5
+    D:borderX=0.0
+
+    # The width of the map border on the top and bottom sides of the minimap tiles.
+    # Represented as a fraction of the image width.
+    # Below a certain threshold, this border will be overtaken by the map border graphic.
+    # 
+    # Min: 0.0
+    # Max: 0.5
+    D:borderY=0.0
+
+    # Set false to disable minimap
+    B:enabled=true
+
+    # The size (in GUI pixels) of a marker on the map.
+    # Note that this will change with Minecraft's GUI scale configuration.
+    # Min: 0
+    # Max: 2147483647
+    I:markerSize=16
+
+    # The height (in GUI pixels) of the player's icon.
+    # Min: 0
+    # Max: 2147483647
+    I:playerIconHeight=8
+
+    # The width (in GUI pixels) of the player's icon.
+    # Min: 0
+    # Max: 2147483647
+    I:playerIconWidth=7
+
+    # If true, the minimap will show the map of an atlas only while it is held.
+    # If false, the minimap will show the map of the first atlas in the hotbar.
+    B:requiresHold=false
+
+    # The size (in GUI pixels) of a map's tile.
+    # Note that this will change with Minecraft's GUI scale configuration.
+    # When using a small gui scale, the map may look better with a TILE_SIZE of 16 or more.
+    # Min: 1
+    # Max: 2147483647
+    I:tileSize=8
+}
+
+
+##########################################################################################################
+# position
+#--------------------------------------------------------------------------------------------------------#
+# These settings change the location and size.
+##########################################################################################################
+
+position {
+    # If true, the map position's y axis will align 0 to the bottom
+    # of the screen, increasing towards the top.
+    B:alignBottom=false
+
+    # If true, the map position's x axis will align 0 to the right
+    # of the screen, increasing towards the left.
+    B:alignRight=true
+
+    # Map's height in GUI pixels.
+    # Note that this will change with Minecraft's GUI scale configuration.
+    # Min: 0
+    # Max: 2147483647
+    I:height=109
+
+    # Map's width in GUI pixels.
+    # Note that this will change with Minecraft's GUI scale configuration.
+    # Min: 0
+    # Max: 2147483647
+    I:width=155
+
+    # Map's minimum position along the x axis in GUI pixels.
+    # Note that this will change with Minecraft's GUI scale configuration.
+    # Min: -2147483648
+    # Max: 2147483647
+    I:xPosition=2
+
+    # Map's minimum position along the y axis in GUI pixels.
+    # Note that this will change with Minecraft's GUI scale configuration.
+    # Min: -2147483648
+    # Max: 2147483647
+    I:yPosition=2
+}
+
+

config/antiqueatlas/biome_textures.json

@@ -0,0 +1,150 @@
+{
+  "version": 2,
+  "data": {
+    "abyssalcraft:abyssal_wastelands": "SAVANNA",
+    "abyssalcraft:coralium_infested_swamp": "SWAMP",
+    "abyssalcraft:dark_realm": "SWAMP_HILLS",
+    "abyssalcraft:darklands": "JUNGLE_EDGE",
+    "abyssalcraft:darklands_forest": "FOREST",
+    "abyssalcraft:darklands_hills": "HILLS",
+    "abyssalcraft:darklands_mountains": "MOUNTAINS_NAKED",
+    "abyssalcraft:darklands_plains": "PLAINS",
+    "abyssalcraft:dreadlands": "SWAMP",
+    "abyssalcraft:dreadlands_forest": "FOREST",
+    "abyssalcraft:dreadlands_mountains": "MOUNTAINS_NAKED",
+    "abyssalcraft:omothol": "SHORE",
+    "abyssalcraft:purged": "PLAINS",
+    "abyssalcraft:purified_dreadlands": "SAVANNA",
+    "appliedenergistics2:storage_biome": "END_VOID",
+    "beneath:the_beneath": "CAVE_WALLS",
+    "extraplanets:outer space 10": "END_VOID",
+    "extraplanets:outer space 11": "END_VOID",
+    "extraplanets:outer space 12": "END_VOID",
+    "extraplanets:outer space 3": "END_VOID",
+    "extraplanets:outer space 4": "END_VOID",
+    "extraplanets:outer space 5": "END_VOID",
+    "extraplanets:outer space 6": "END_VOID",
+    "extraplanets:outer space 7": "END_VOID",
+    "extraplanets:outer space 8": "END_VOID",
+    "extraplanets:outer space 9": "END_VOID",
+    "galacticraftcore:outer space": "END_VOID",
+    "galacticraftplanets:outer space 1": "END_VOID",
+    "galacticraftplanets:outer space 2": "END_VOID",
+    "integrateddynamics:biome_meneglin": "BIRCH",
+    "jeid:error_biome": "PLAINS",
+    "minecraft:beaches": "SHORE",
+    "minecraft:birch_forest": "BIRCH",
+    "minecraft:birch_forest_hills": "BIRCH_HILLS",
+    "minecraft:cold_beach": "SHORE",
+    "minecraft:deep_ocean": "WATER",
+    "minecraft:desert": "DESERT",
+    "minecraft:desert_hills": "DESERT_HILLS",
+    "minecraft:extreme_hills": "MOUNTAINS",
+    "minecraft:extreme_hills_with_trees": "MOUNTAINS_ALL",
+    "minecraft:forest": "FOREST",
+    "minecraft:forest_hills": "FOREST_HILLS",
+    "minecraft:frozen_ocean": "ICE",
+    "minecraft:frozen_river": "ICE",
+    "minecraft:hell": "CAVE_WALLS",
+    "minecraft:ice_flats": "SNOW",
+    "minecraft:ice_mountains": "SNOW_HILLS",
+    "minecraft:jungle": "JUNGLE",
+    "minecraft:jungle_edge": "JUNGLE_EDGE",
+    "minecraft:jungle_hills": "JUNGLE_HILLS",
+    "minecraft:mesa": "MESA",
+    "minecraft:mesa_clear_rock": "PLATEAU_MESA",
+    "minecraft:mesa_rock": "PLATEAU_MESA_TREES",
+    "minecraft:mushroom_island": "MUSHROOM",
+    "minecraft:mushroom_island_shore": "SHORE",
+    "minecraft:mutated_birch_forest": "TALL_BIRCH",
+    "minecraft:mutated_birch_forest_hills": "TALL_BIRCH_HILLS",
+    "minecraft:mutated_desert": "DESERT",
+    "minecraft:mutated_extreme_hills": "MOUNTAINS_SNOW_CAPS",
+    "minecraft:mutated_extreme_hills_with_trees": "MOUNTAINS_SNOW_CAPS",
+    "minecraft:mutated_forest": "FOREST_FLOWERS",
+    "minecraft:mutated_ice_flats": "ICE_SPIKES",
+    "minecraft:mutated_jungle": "JUNGLE_CLIFFS",
+    "minecraft:mutated_jungle_edge": "JUNGLE_EDGE_HILLS",
+    "minecraft:mutated_mesa": "BRYCE",
+    "minecraft:mutated_mesa_clear_rock": "PLATEAU_MESA_LOW",
+    "minecraft:mutated_mesa_rock": "PLATEAU_MESA_TREES_LOW",
+    "minecraft:mutated_plains": "SUNFLOWERS",
+    "minecraft:mutated_redwood_taiga": "MEGA_SPRUCE",
+    "minecraft:mutated_redwood_taiga_hills": "MEGA_SPRUCE_HILLS",
+    "minecraft:mutated_roofed_forest": "DENSE_FOREST_HILLS",
+    "minecraft:mutated_savanna": "SAVANNA_CLIFFS",
+    "minecraft:mutated_savanna_rock": "PLATEAU_SAVANNA_M",
+    "minecraft:mutated_swampland": "SWAMP_HILLS",
+    "minecraft:mutated_taiga": "PINES_HILLS",
+    "minecraft:mutated_taiga_cold": "SNOW_PINES_HILLS",
+    "minecraft:ocean": "WATER",
+    "minecraft:plains": "PLAINS",
+    "minecraft:redwood_taiga": "MEGA_TAIGA",
+    "minecraft:redwood_taiga_hills": "MEGA_TAIGA_HILLS",
+    "minecraft:river": "WATER",
+    "minecraft:roofed_forest": "DENSE_FOREST",
+    "minecraft:savanna": "SAVANNA",
+    "minecraft:savanna_rock": "PLATEAU_SAVANNA",
+    "minecraft:sky": "SHORE",
+    "minecraft:smaller_extreme_hills": "MOUNTAINS",
+    "minecraft:stone_beach": "ROCK_SHORE",
+    "minecraft:swampland": "SWAMP",
+    "minecraft:taiga": "PINES",
+    "minecraft:taiga_cold": "SNOW_PINES",
+    "minecraft:taiga_cold_hills": "SNOW_PINES_HILLS",
+    "minecraft:taiga_hills": "PINES_HILLS",
+    "minecraft:void": "SHORE",
+    "nex:arctic_abyss": "DESERT",
+    "nex:fungi_forest": "MUSHROOM",
+    "nex:ruthless_sands": "DESERT",
+    "nex:torrid_wasteland": "PLAINS",
+    "thebetweenlands:coarse_islands": "SWAMP",
+    "thebetweenlands:deep_waters": "SWAMP",
+    "thebetweenlands:marsh_0": "SWAMP",
+    "thebetweenlands:marsh_1": "SWAMP",
+    "thebetweenlands:patchy_islands": "SWAMP",
+    "thebetweenlands:sludge_plains": "SWAMP",
+    "thebetweenlands:sludge_plains_clearing": "SWAMP",
+    "thebetweenlands:swamplands": "SWAMP",
+    "thebetweenlands:swamplands_clearing": "SWAMP",
+    "traverse:autumnal_wooded_hills": "DENSE_FOREST_HILLS",
+    "traverse:autumnal_woods": "FOREST",
+    "traverse:badlands": "FOREST",
+    "traverse:birch_forested_hills": "BIRCH_HILLS",
+    "traverse:canyon": "PLATEAU_MESA_LOW",
+    "traverse:cliffs": "MOUNTAINS",
+    "traverse:crag_cliffs": "PLATEAU_MESA",
+    "traverse:forested_hills": "FOREST_HILLS",
+    "traverse:glacier": "ICE",
+    "traverse:glacier_spikes": "ICE_SPIKES",
+    "traverse:green_swamp": "SWAMP",
+    "traverse:lush_hills": "MEGA_SPRUCE_HILLS",
+    "traverse:meadow": "PLAINS",
+    "traverse:mini_jungle": "JUNGLE",
+    "traverse:mountainous_desert": "DESERT_HILLS",
+    "traverse:red_desert": "DESERT",
+    "traverse:rocky_plateau": "PLATEAU_MESA_LOW",
+    "traverse:snowy_coniferous_forest": "SNOW_PINES",
+    "traverse:temperate_rainforest": "FOREST",
+    "traverse:woodlands": "BIRCH",
+    "twilightforest:dark_forest": "JUNGLE",
+    "twilightforest:dark_forest_center": "JUNGLE_CLIFFS",
+    "twilightforest:deep_mushroom_forest": "MEGA_SPRUCE_HILLS",
+    "twilightforest:dense_twilight_forest": "DENSE_FOREST",
+    "twilightforest:enchanted_forest": "FOREST_FLOWERS",
+    "twilightforest:fire_swamp": "SWAMP_HILLS",
+    "twilightforest:firefly_forest": "BIRCH",
+    "twilightforest:highlands_center": "PLATEAU_MESA",
+    "twilightforest:mushroom_forest": "MEGA_SPRUCE",
+    "twilightforest:oak_savannah": "SAVANNA",
+    "twilightforest:snowy_forest": "SNOW_PINES",
+    "twilightforest:thornlands": "DESERT_HILLS",
+    "twilightforest:twilight_clearing": "PLAINS",
+    "twilightforest:twilight_forest": "FOREST",
+    "twilightforest:twilight_glacier": "SNOW",
+    "twilightforest:twilight_highlands": "PLATEAU_MESA_TREES",
+    "twilightforest:twilight_lake": "WATER",
+    "twilightforest:twilight_stream": "WATER",
+    "twilightforest:twilight_swamp": "SWAMP"
+  }
+}

config/antiqueatlas/markers.json

@@ -0,0 +1,38 @@
+{
+  "version": 1,
+  "data": {
+    "antiqueatlas:Example": {
+      "__comment": [
+        "Any of these values can be ommited. The mod will either use the default value or if it is already been registered it will keep the existing values",
+        "This example entry is never parsed, and if modified, will not persist"
+      ],
+      "textures": [
+        "List of icons at different resolutions",
+        "[Default: `antiqueatlas:textures/gui/markers/red_x_small.png`]"
+      ],
+      "size": "[Default: 2] The width and height of the marker, in tiles (a chunk at 1x zoom)",
+      "clipMin": "[Default: -1000] The minimum zoom, -1 is 1/2x, -2 is 1/4x, ...",
+      "clipMax": "[Default:  1000] The maximum zoom, 0 is 1x, 1 is 2x, ...",
+      "alwaysShow": "[Default: false] True if the marker should appear regardless of whether hide markers is on",
+      "isTile": "[Default: false] True if the marker should scale with the map",
+      "isTechnical": "[Default: false] True if user should not be able to place the marker on the map",
+      "centerX": "[Default: 0.5] The point in the image that should be at the location of the marker (0-1)",
+      "centerY": "[Default: 0.5] The point in the image that should be at the location of the marker (0-1)"
+    },
+    "antiqueatlas:bed": {},
+    "antiqueatlas:diamond": {},
+    "antiqueatlas:end_city": {},
+    "antiqueatlas:end_city_far": {},
+    "antiqueatlas:google": {},
+    "antiqueatlas:nether_portal": {},
+    "antiqueatlas:pickaxe": {},
+    "antiqueatlas:red_x_large": {},
+    "antiqueatlas:red_x_small": {},
+    "antiqueatlas:scroll": {},
+    "antiqueatlas:skull": {},
+    "antiqueatlas:sword": {},
+    "antiqueatlas:tomb": {},
+    "antiqueatlas:tower": {},
+    "antiqueatlas:village": {}
+  }
+}

config/antiqueatlas/texture_sets.json

@@ -0,0 +1,9 @@
+{
+  "version": 1,
+  "data": {
+    "TEST": [
+      "antiqueatlas:textures/gui/tiles/test.png",
+      "antiqueatlas:textures/gui/tiles/test.png"
+    ]
+  }
+}

config/antiqueatlas/tile_textures.json

@@ -0,0 +1,33 @@
+{
+  "version": 1,
+  "data": {
+    "endIsland": "END_ISLAND",
+    "endIslandPlants": "END_ISLAND_PLANTS",
+    "endVoid": "END_VOID",
+    "lava": "LAVA",
+    "lavaShore": "LAVA_SHORE",
+    "netherBridge": "NETHER_BRIDGE",
+    "netherBridgeEndX": "NETHER_BRIDGE_END_X",
+    "netherBridgeEndZ": "NETHER_BRIDGE_END_Z",
+    "netherBridgeGate": "NETHER_BRIDGE_GATE",
+    "netherBridgeX": "NETHER_BRIDGE_X",
+    "netherBridgeZ": "NETHER_BRIDGE_Z",
+    "netherFortStairs": "NETHER_FORT_STAIRS",
+    "netherHall": "NETHER_HALL",
+    "netherThrone": "NETHER_THRONE",
+    "netherTower": "NETHER_TOWER",
+    "netherWall": "NETHER_WALL",
+    "npcVillageButchersShop": "BUTCHERS_SHOP",
+    "npcVillageChurch": "CHURCH",
+    "npcVillageFarmlandLarge": "FARMLAND_LARGE",
+    "npcVillageFarmlandSmall": "FARMLAND_SMALL",
+    "npcVillageHut": "HUT",
+    "npcVillageLHouse": "L-HOUSE",
+    "npcVillageLibrary": "LIBRARY",
+    "npcVillageSmallHouse": "HOUSE_SMALL",
+    "npcVillageSmithy": "SMITHY",
+    "npcVillageTorch": "VILLAGE_TORCH",
+    "npcVillageWell": "WELL",
+    "ravine": "RAVINE"
+  }
+}

config/antiqueatlas/tileids.json

@@ -0,0 +1,33 @@
+{
+  "version": 1,
+  "data": {
+    "endIsland": -26,
+    "endIslandPlants": -27,
+    "endVoid": -28,
+    "lava": -13,
+    "lavaShore": -14,
+    "netherBridge": -15,
+    "netherBridgeEndX": -18,
+    "netherBridgeEndZ": -19,
+    "netherBridgeGate": -20,
+    "netherBridgeX": -16,
+    "netherBridgeZ": -17,
+    "netherFortStairs": -24,
+    "netherHall": -23,
+    "netherThrone": -25,
+    "netherTower": -21,
+    "netherWall": -22,
+    "npcVillageButchersShop": -11,
+    "npcVillageChurch": -12,
+    "npcVillageFarmlandLarge": -5,
+    "npcVillageFarmlandSmall": -6,
+    "npcVillageHut": -9,
+    "npcVillageLHouse": -4,
+    "npcVillageLibrary": -2,
+    "npcVillageSmallHouse": -10,
+    "npcVillageSmithy": -3,
+    "npcVillageTorch": -8,
+    "npcVillageWell": -7,
+    "ravine": -29
+  }
+}

config/appleskin.cfg

@@ -0,0 +1,29 @@
+# Configuration file
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# These config settings are client-side only
+##########################################################################################################
+
+client {
+    # If true, shows your food exhaustion as a progress bar behind the hunger bars
+    B:show.food.exhaustion.hud.underlay=true
+
+    # If true, adds a line that shows your hunger, saturation, and exhaustion level in the F3 debug overlay
+    B:show.food.stats.in.debug.overlay=true
+
+    # If true, shows the hunger (and saturation if show.saturation.hud.overlay is true) that would be restored by food you are currently holding
+    B:show.food.values.hud.overlay=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip while holding SHIFT
+    B:show.food.values.in.tooltip=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip automatically (without needing to hold SHIFT)
+    B:show.food.values.in.tooltip.always=true
+
+    # If true, shows your current saturation level overlayed on the hunger bar
+    B:show.saturation.hud.overlay=true
+}
+
+

config/aroma1997/aromabackup.cfg

@@ -0,0 +1,63 @@
+# Configuration file
+
+backup {
+    # The compression type used for backups. The following ones are available: "zip"
+    S:compressionType=zip
+}
+
+
+backup_location {
+    # The filename of the backup files. Supported variables:
+    #  world, year, month, date, hour, minute, second, identifier.
+    #  Please note: using the identifier is recommended, but not enforced. Please make sure, that your filenames are unique and that two backups will not have the same filename. [default: %world%/Backup--%world%--%year%-%month%-%date%--%hour%-%minute%]
+    S:filename=%world%/Backup--%world%--%year%-%month%-%date%--%hour%-%minute%
+
+    # Where to store the Backups. Either an absolute path or relative to the minecraft folder.
+    S:location=./backups
+}
+
+
+backup_schedule {
+    # How frequently a automatic backup is done in minutes. 0 means Auto-Backup disabled.
+    I:delay=30
+
+    # How many full backups to keep. When there are this many full backups, the oldest full backup will be deleted together with all incremental backups, that depend on it. [range: 1 ~ 2147483647, default: 30]
+    I:fullBackupsToKeep=5
+
+    # How many incremental backups to create. Set to something bigger that 0 to enable. If this is set to for example 5, then there will be one full backup, 5 incremental backups and then the next full backup and so on. [range: 0 ~ 500, default: 0]
+    I:incrementalBackupsToCreate=0
+
+    # How many incremental backups to keep. When there are this many incremental backups, the oldest incremental backup will be deleted together with all backups, that depend on it. [range: 1 ~ 2147483647, default: 100]
+    I:incrementalBackupsToKeep=100
+
+    # If a backup should be done when the world gets loaded.
+    B:onStartup=false
+
+    # If the scheduled backup should be skipped if no players were on the server since the last one.
+    B:skipbackup=true
+}
+
+
+general {
+    # If all players or only admins can use the /backup command.
+    B:allPlayers=true
+
+    # If the blacklist is enabled, the dimensions (ids) specified here will not be backed up.
+    I:blacklist <
+     >
+
+    # Compression rate. Has to be between 9 (high compression) and 1 (low compression).
+    I:compressionRate=5
+
+    # If this is set to true, it will use the Dimension Whitelist, if it is false, it will use the Dimension Blacklist
+    B:useWhitelist=false
+
+    # If the whitelist is enabled, only the dimensions (ids) specified here will be backed up.
+    I:whitelist <
+        0
+        1
+        -1
+     >
+}
+
+

config/aroma1997/aromabackuprecovery.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+general {
+    # If this is set to true, the RecoveryHelper with GUI will be enabled. [default: true]
+    B:recoveryHelperEnabled=true
+}
+
+

config/astikorcarts.cfg

@@ -0,0 +1,40 @@
+# Configuration file
+
+general {
+    # Min: -1.0
+    # Max: 0.0
+    D:speedModifier=-0.65
+
+    cargocart {
+        S:canPull <
+            minecraft:horse
+            minecraft:donkey
+            minecraft:mule
+            minecraft:pig
+            minecraft:llama
+         >
+    }
+
+    plowcart {
+        S:canPull <
+            minecraft:horse
+            minecraft:donkey
+            minecraft:mule
+            minecraft:pig
+            minecraft:llama
+         >
+    }
+
+    mobcart {
+        S:canPull <
+            minecraft:horse
+            minecraft:donkey
+            minecraft:mule
+            minecraft:pig
+            minecraft:llama
+         >
+    }
+
+}
+
+

config/astralsorcery/aevitas_ore_perk.cfg

@@ -0,0 +1,27 @@
+# Configuration file
+
+##########################################################################################################
+# data
+#--------------------------------------------------------------------------------------------------------#
+# Defines random ore-selection data. Items with higher weight are more likely to be selected overall. Format: <oreDictionaryName>;<integerWeight>
+##########################################################################################################
+
+data {
+    #  [default: [oreCoal;5200], [oreIron;2500], [oreGold;550], [oreLapis;140], [oreRedstone;700], [oreDiamond;180], [oreEmerald;100], [oreAluminum;600], [oreCopper;1100], [oreTin;1500], [oreLead;1000], [oreCertusQuartz;500], [oreNickel;270], [orePlatinum;90], [oreSilver;180], [oreMithril;1], [oreRuby;400], [oreSapphire;400], [oreUranium;550], [oreYellorite;560], [oreZinc;300], [oreSulfur;600], [oreOsmium;950]]
+    S:data <
+        oreGeolosysCoal;5200
+        oreGeolosysHematite;2500
+        oreGeolosysGold;550
+        oreGeolosysLapis;140
+        oreBlockCinnabar;700
+        oreGeolosysBauxite;600
+        oreGeolosysAzurite;1100
+        oreGeolosysCassiterite;1500
+        oreGeolosysGalena;600
+        oreGeolosysLimonite;270
+        oreGeolosysAutunite;550
+        oreGeolosysQuartz;250
+     >
+}
+
+

config/astralsorcery/amulet_enchantments.cfg

@@ -0,0 +1,67 @@
+# Configuration file
+
+##########################################################################################################
+# data
+#--------------------------------------------------------------------------------------------------------#
+# Defines a whitelist of which enchantments can be rolled and buffed by the enchantment-amulet. The higher the weight, the more likely that roll is selected.Format: <enchantment-registry-name>:<weight>
+##########################################################################################################
+
+data {
+    #  [default: [minecraft:protection:10], [minecraft:fire_protection:5], [minecraft:feather_falling:5], [minecraft:blast_protection:2], [minecraft:projectile_protection:5], [minecraft:respiration:2], [minecraft:aqua_affinity:2], [minecraft:thorns:1], [minecraft:depth_strider:2], [minecraft:frost_walker:2], [minecraft:sharpness:10], [minecraft:smite:5], [minecraft:bane_of_arthropods:5], [minecraft:knockback:5], [minecraft:fire_aspect:2], [minecraft:looting:2], [minecraft:sweeping:2], [minecraft:efficiency:10], [minecraft:silk_touch:1], [minecraft:unbreaking:5], [minecraft:fortune:2], [minecraft:power:10], [minecraft:punch:2], [minecraft:flame:2], [minecraft:infinity:1], [minecraft:luck_of_the_sea:2], [minecraft:lure:2], [minecraft:mending:2], [jaff:roasting:5], [bibliocraft:bibliocraft.deathcompassench:1], [bibliocraft:bibliocraft.readingench:5], [oeintegration:oreexcavation:1], [spartanshields:ssenchspikes:5], [walljump:walljump:5], [walljump:doublejump:2], [walljump:speedboost:2], [yoyos:collecting:5], [abyssalcraft:coralium:2], [abyssalcraft:dread:2], [abyssalcraft:light_pierce:10], [abyssalcraft:iron_wall:5], [abyssalcraft:sapping:5], [abyssalcraft:multi_rend:2], [cyclicmagic:enchantment.autosmelt:2], [cyclicmagic:enchantment.beheading:1], [cyclicmagic:enchantment.lifeleech:10], [cyclicmagic:enchantment.quickdraw:1], [cyclicmagic:enchantment.reach:1], [cyclicmagic:enchantment.waterwalking:1], [cyclicmagic:enchantment.expboost:1], [astralsorcery:enchantment.as.nightvision:1], [astralsorcery:enchantment.as.smelting:1]]
+    S:data <
+        minecraft:protection:10
+        minecraft:fire_protection:5
+        minecraft:feather_falling:5
+        minecraft:blast_protection:2
+        minecraft:projectile_protection:5
+        minecraft:respiration:2
+        minecraft:aqua_affinity:2
+        minecraft:thorns:1
+        minecraft:depth_strider:2
+        minecraft:frost_walker:2
+        minecraft:sharpness:10
+        minecraft:smite:5
+        minecraft:bane_of_arthropods:5
+        minecraft:knockback:5
+        minecraft:fire_aspect:2
+        minecraft:looting:2
+        minecraft:sweeping:2
+        minecraft:efficiency:10
+        minecraft:silk_touch:1
+        minecraft:unbreaking:5
+        minecraft:fortune:2
+        minecraft:power:10
+        minecraft:punch:2
+        minecraft:flame:2
+        minecraft:infinity:1
+        minecraft:luck_of_the_sea:2
+        minecraft:lure:2
+        minecraft:mending:2
+        jaff:roasting:5
+        bibliocraft:bibliocraft.deathcompassench:1
+        bibliocraft:bibliocraft.readingench:5
+        oeintegration:oreexcavation:1
+        spartanshields:ssenchspikes:5
+        yoyos:collecting:5
+        abyssalcraft:coralium:2
+        abyssalcraft:dread:2
+        abyssalcraft:light_pierce:10
+        abyssalcraft:iron_wall:5
+        astralsorcery:enchantment.as.nightvision:1
+        astralsorcery:enchantment.as.smelting:1
+        cyclicmagic:enchantment.waterwalking:1
+        cyclicmagic:enchantment.reach:1
+        cyclicmagic:enchantment.expboost:1
+        cyclicmagic:enchantment.autosmelt:2
+        cyclicmagic:enchantment.launch:10
+        cyclicmagic:enchantment.magnet:1
+        cyclicmagic:enchantment.venom:10
+        cyclicmagic:enchantment.lifeleech:10
+        cyclicmagic:enchantment.beheading:1
+        cyclicmagic:enchantment.quickdraw:1
+        cyclicmagic:enchantment.excavation:1
+        cyclicmagic:enchantment.multishot:1
+     >
+}
+
+

config/astralsorcery/fluid_rarities.cfg

@@ -0,0 +1,38 @@
+# Configuration file
+
+##########################################################################################################
+# data
+#--------------------------------------------------------------------------------------------------------#
+# Defines fluid-rarities and amounts for the evershifting fountain's neromantic prime. The lower the relative rarity, the more rare the fluid. Format: <FluidName>;<guaranteedMbAmount>;<additionalRandomMbAmount>;<rarity>
+##########################################################################################################
+
+data {
+    #  [default: [water;2147483647;2147483647;14000], [lava;4000000;1000000;7500], [crystaloil;600000;400000;800], [empoweredoil;350000;150000;200], [redstone;120000;70000;500], [glowstone;120000;70000;500], [ender;140000;60000;250], [pyrotheum;200000;120000;200], [cryotheum;200000;120000;200], [refined_oil;480000;400000;600], [refined_fuel;450000;300000;550], [iron;600000;350000;900], [gold;400000;350000;600], [cobalt;150000;150000;80], [ardite;150000;150000;80], [emerald;60000;90000;30], [fluidoil;500000;350000;900], [fluidnitrodiesel;400000;250000;450], [ic2uu_matter;600;800;1], [ic2biomass;300000;200000;600], [ic2biogas;250000;150000;500], [mana;550000;120000;1500], [nacre;150000;250000;250]]
+    S:data <
+        water;2147483647;2147483647;14000
+        lava;4000000;1000000;7500
+        crystaloil;600000;400000;800
+        empoweredoil;350000;150000;200
+        redstone;120000;70000;500
+        glowstone;120000;70000;500
+        ender;140000;60000;250
+        pyrotheum;200000;120000;200
+        cryotheum;200000;120000;200
+        refined_oil;480000;400000;600
+        refined_fuel;450000;300000;550
+        iron;600000;350000;900
+        gold;400000;350000;600
+        cobalt;150000;150000;80
+        ardite;150000;150000;80
+        emerald;60000;90000;30
+        fluidoil;500000;350000;900
+        fluidnitrodiesel;400000;250000;450
+        ic2uu_matter;600;800;1
+        ic2biomass;300000;200000;600
+        ic2biogas;250000;150000;500
+        mana;550000;120000;1500
+        nacre;150000;250000;250
+     >
+}
+
+

config/astralsorcery/herdable_animals_blacklist.cfg

@@ -0,0 +1,15 @@
+# Configuration file
+
+##########################################################################################################
+# data
+#--------------------------------------------------------------------------------------------------------#
+# Defines a list of animals that can not be used in an bootes ritual to gain drops from. List animals with their registry name (e.g. parrots would be 'minecraft:parrot')
+##########################################################################################################
+
+data {
+    #  [default: ]
+    S:data <
+     >
+}
+
+

config/astralsorcery/mineralis_ritual.cfg

@@ -0,0 +1,27 @@
+# Configuration file
+
+##########################################################################################################
+# data
+#--------------------------------------------------------------------------------------------------------#
+# Defines random ore-selection data. Items with higher weight are more likely to be selected overall. Format: <oreDictionaryName>;<integerWeight>
+##########################################################################################################
+
+data {
+    #  [default: [oreCoal;5200], [oreIron;2500], [oreGold;550], [oreLapis;140], [oreRedstone;700], [oreDiamond;180], [oreEmerald;100], [oreAluminum;600], [oreCopper;1100], [oreTin;1500], [oreLead;1000], [oreCertusQuartz;500], [oreNickel;270], [orePlatinum;90], [oreSilver;180], [oreMithril;1], [oreRuby;400], [oreSapphire;400], [oreUranium;550], [oreYellorite;560], [oreZinc;300], [oreSulfur;600], [oreOsmium;950]]
+    S:data <
+        oreGeolosysCoal;5200
+        oreGeolosysHematite;2500
+        oreGeolosysGold;550
+        oreGeolosysLapis;140
+        oreBlockCinnabar;700
+        oreGeolosysBauxite;600
+        oreGeolosysAzurite;1100
+        oreGeolosysCassiterite;1500
+        oreGeolosysGalena;600
+        oreGeolosysLimonite;270
+        oreGeolosysAutunite;550
+        oreGeolosysQuartz;250
+     >
+}
+
+

config/astralsorcery/perk_void_trash_replacement.cfg

@@ -0,0 +1,38 @@
+# Configuration file
+
+##########################################################################################################
+# data
+#--------------------------------------------------------------------------------------------------------#
+# Defines random ore-selection data. Items with higher weight are more likely to be selected overall. Format: <oreDictionaryName>;<integerWeight>
+##########################################################################################################
+
+data {
+    #  [default: [oreCoal;5200], [oreIron;2500], [oreGold;550], [oreLapis;140], [oreRedstone;700], [oreDiamond;180], [oreEmerald;100], [oreAluminum;600], [oreCopper;1100], [oreTin;1500], [oreLead;1000], [oreCertusQuartz;500], [oreNickel;270], [orePlatinum;90], [oreSilver;180], [oreMithril;1], [oreRuby;400], [oreSapphire;400], [oreUranium;550], [oreYellorite;560], [oreZinc;300], [oreSulfur;600], [oreOsmium;950]]
+    S:data <
+        oreCoal;5200
+        oreIron;2500
+        oreGold;550
+        oreLapis;140
+        oreRedstone;700
+        oreDiamond;180
+        oreEmerald;100
+        oreAluminum;600
+        oreCopper;1100
+        oreTin;1500
+        oreLead;1000
+        oreCertusQuartz;500
+        oreNickel;270
+        orePlatinum;90
+        oreSilver;180
+        oreMithril;1
+        oreRuby;400
+        oreSapphire;400
+        oreUranium;550
+        oreYellorite;560
+        oreZinc;300
+        oreSulfur;600
+        oreOsmium;950
+     >
+}
+
+

config/astralsorcery/treasure_shrine.cfg

@@ -0,0 +1,28 @@
+# Configuration file
+
+##########################################################################################################
+# data
+#--------------------------------------------------------------------------------------------------------#
+# Defines random ore-selection data. Items with higher weight are more likely to be selected overall. Format: <oreDictionaryName>;<integerWeight>
+##########################################################################################################
+
+data {
+    #  [default: [oreCoal;5200], [oreIron;2500], [oreGold;550], [oreLapis;140], [oreRedstone;700], [oreDiamond;180], [oreEmerald;100], [oreAluminum;600], [oreCopper;1100], [oreTin;1500], [oreLead;1000], [oreCertusQuartz;500], [oreNickel;270], [orePlatinum;90], [oreSilver;180], [oreMithril;1], [oreRuby;400], [oreSapphire;400], [oreUranium;550], [oreYellorite;560], [oreZinc;300], [oreSulfur;600], [oreOsmium;950]]
+    S:data <
+        oreCoal;5200
+        oreIron;2500
+        oreGold;550
+        oreLapis;140
+        oreRedstone;700
+        oreAluminum;600
+        oreCopper;1100
+        oreTin;1500
+        oreLead;1000
+        oreNickel;270
+        oreSilver;180
+        oreUranium;550
+        oreSulfur;600
+     >
+}
+
+

config/baubles.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+client {
+    # Set this to false to disable rendering of baubles in the player. [default: true]
+    B:baubleRender.enabled=true
+}
+
+