minecraft server init

.mixin.out/audit/mixin_implementation_report.csv

@@ -0,0 +1 @@
+Class,Method,Signature,Interface

.mixin.out/audit/mixin_implementation_report.txt

@@ -0,0 +1 @@
+Mixin Implementation Report generated on 2025-05-16 16:57:10

Install.bat

@@ -0,0 +1,11 @@
+@echo off
+
+call settings.bat
+
+:install_files
+echo Installing Forge and required jars.
+java -jar %INSTALL_JAR% --installServer > NUL 2>&1
+echo Done!
+exit /B
+
+goto install_files

Install.sh

@@ -0,0 +1,12 @@
+#!/bin/sh
+
+# Read the settings.
+. ./settings.sh
+
+install_files() {
+    java -jar ${INSTALL_JAR} --installServer > /dev/null 2>&1
+}
+
+echo "Installing Forge and required jars."
+install_files
+echo "Done!"

README.txt

@@ -0,0 +1,46 @@
+Welcome to SevTech Ages Server Guide
+
+If you are looking for the guide for updating your server from an older version see UPDATE-GUIDE.txt
+
+In this download you'll find two scripts one for Windows, Linux and Mac which will run the Forge Installer
+to get the needed files for you! Like magic!
+
+Hardware Notes:
+	- Recommended Min Memory is 4GB (You can run it on 2GB but it's not ideal)
+	- A modern processor/system which would be running the server.
+
+To get your server up and running just run the following:
+
+- Windows:
+	- Run Install.bat
+- Linux & Mac:
+	- Run Install.sh
+
+Once the script finishes you'll be able to start your server. Please note the server does use a fair
+amount of RAM is is taxing on the CPU; so please ensure you have a system capable to run a server.
+Especially if you are planning to have a lot users on the server.
+
+Don't forget you'll need to accept/create the EULA file for the server to start!
+Also you'll find a `settings` file which you can edit the Java Options used for starting the server
+make sure you edit the one for your system and that they are valid.
+
+To start the server you can perform the following:
+
+- Windows: (Only pick one of the options .bat file is prefered)
+	- Run the Start.bat Script.
+	- Double Click the Forge Jar.
+- Linux & Mac:
+	- Run the Start.sh Script.
+
+NOTE: The server will crash first time with the EULA not being accepted. You can run the server let it crash then
+edit the file to change "false" to "true". Alternatively copy the following into a file called "eula.txt" in the root directory (same place as this file). You'll need to change the false to true yourself:
+
+#By changing the setting below to TRUE you are indicating your agreement to our EULA (https://account.mojang.com/documents/minecraft_eula).
+eula=false
+
+
+You don't have to use the Start Scripts at all; if you know what you are doing by all means create your
+own scripts to run the server. It's your server!
+
+But thank you from the team for download and playing the SevTech Ages Pack. If you find any issues or
+bugs please file them at our tracker: https://github.com/Darkosto/SevTech-Ages/issues

ServerStart.bat

@@ -0,0 +1,11 @@
+@echo off
+
+call settings.bat
+
+:start_server
+echo Starting SevTech Ages Server...
+java -server -Xms%MIN_RAM% -Xmx%MAX_RAM% %JAVA_PARAMETERS% -jar %SERVER_JAR% nogui
+pause
+exit /B
+
+goto start_server

ServerStart.sh

@@ -0,0 +1,12 @@
+#!/bin/sh
+
+# Read the settings.
+. ./settings.sh
+
+# Start the server.
+start_server() {
+    java -server -Xms${MIN_RAM} -Xmx${MAX_RAM} ${JAVA_PARAMETERS} -jar ${SERVER_JAR} nogui
+}
+
+echo "Starting SevTech Ages Server..."
+start_server

UPDATE-GUIDE.txt

@@ -0,0 +1,28 @@
+How to Upgrade Your SevTech Server:
+
+1. MAKE A BACKUP OF YOUR WORLD AND PRESTIGE FODLER THEN STORE IT ELSEWHERE. (Make sure it's safe from the Creepers)
+
+2. Download the latest version from CurseForge.  
+   **Note: the server files come out after the client is, and is published as quickly as possible, but there are delays in the approval process. If it's not listed, be patient.
+   **Note: The server files on the ATLauncher ARE NOT the same as the provided ones on CurseForge.  They are just curated from the client itself.
+
+3. Shut down your server.
+
+4. In your server's directory, locate the following directories and delete them:
+        - config
+        - journeymap
+        - mods
+        - resources
+        - scripts
+        - structures
+
+	DON'T DELETE THE WORLD OR PRESTIGE FOLDER
+        
+5. Copy the contents from the Zip file you downloaded to your server folder. Overwrite any files requested.
+
+6. Run the Install script for your system to update Forge to the version needed.
+
+7. Upload the entire libraries folder to the server also. As changes could of been made and you'll need them otherwise you'll have bad times.
+
+8. Run your server. Profit!
+

backups/world/Backup--world--2025-05-15--17-48.backupinfo

@@ -0,0 +1,8 @@
+#=============================================
+#This is an important file for your backups.
+#Do not move, edit or delete this file.
+#If you do, backups may not be automatically restorable.
+#=============================================
+date:1747320514803
+parent:null
+world:world

backups/world/Backup--world--2025-05-15--18-18.backupinfo

@@ -0,0 +1,8 @@
+#=============================================
+#This is an important file for your backups.
+#Do not move, edit or delete this file.
+#If you do, backups may not be automatically restorable.
+#=============================================
+date:1747322314803
+parent:null
+world:world

backups/world/Backup--world--2025-05-15--18-48.backupinfo

@@ -0,0 +1,8 @@
+#=============================================
+#This is an important file for your backups.
+#Do not move, edit or delete this file.
+#If you do, backups may not be automatically restorable.
+#=============================================
+date:1747324114803
+parent:null
+world:world

backups/world/Backup--world--2025-05-15--23-37.backupinfo

@@ -0,0 +1,8 @@
+#=============================================
+#This is an important file for your backups.
+#Do not move, edit or delete this file.
+#If you do, backups may not be automatically restorable.
+#=============================================
+date:1747341474149
+parent:null
+world:world

backups/world/Backup--world--2025-05-16--00-37.backupinfo

@@ -0,0 +1,8 @@
+#=============================================
+#This is an important file for your backups.
+#Do not move, edit or delete this file.
+#If you do, backups may not be automatically restorable.
+#=============================================
+date:1747345074126
+parent:null
+world:world

banned-ips.json

@@ -0,0 +1 @@
+[]

banned-players.json

@@ -0,0 +1 @@
+[]

config/AdvGenerators/client.config

@@ -0,0 +1,17 @@
+# Configuration file
+
+display {
+    # Units to use when displaying power. Valid values: MJ, EU, RF, T
+    S:PowerShowUnits=RF
+}
+
+
+tooltips {
+    # If false will only show tooltip in Syngas Producer GUI
+    B:AlwaysShowCarbonTooltip=true
+
+    # If false will only show tooltip in Turbine GUI
+    B:AlwaysShowFuelTooltip=true
+}
+
+

config/AdvGenerators/readme.txt

@@ -0,0 +1,2 @@
+Any .cfg files in this directory will be loaded after the internal configuration, in alphabetic order
+Files in 'overrides' directory with matching names cab be used to override internal configuration

config/AdvGenerators/turbine.cfg

@@ -0,0 +1,7 @@
+recipes {
+
+    // Default is 51.2 MJ/mB, bump to match Simple Generators
+    // https://github.com/bdew/generators/blob/2a14f2d63/resources/assets/advgenerators/config/turbine.cfg#L171
+    turbine-fuel: gasoline 120 MJ/mB
+
+}

config/AppliedEnergistics2/AppliedEnergistics2.cfg

@@ -0,0 +1,492 @@
+# Configuration file
+
+automation {
+    I:formationPlaneEntityLimit=0
+}
+
+
+battery {
+    I:chargedStaff=8000
+    I:colorApplicator=20000
+    I:entropyManipulator=200000
+    I:matterCannon=200000
+    I:portableCell=20000
+    I:wirelessTerminal=1600000
+}
+
+
+client {
+    # Possible Values: AE, EU, RF
+    S:PowerUnit=RF
+
+    # Possible Values: AUTOSEARCH, AUTOSEARCH_KEEP, MANUAL_SEARCH, MANUAL_SEARCH_KEEP, JEI_AUTOSEARCH, JEI_AUTOSEARCH_KEEP, JEI_MANUAL_SEARCH, JEI_MANUAL_SEARCH_KEEP
+    S:SEARCH_MODE=MANUAL_SEARCH_KEEP
+
+    # Possible Values: YES, NO, UNDECIDED
+    S:SEARCH_TOOLTIPS=YES
+
+    # Possible Values: TALL, FULL, SMALL
+    S:TERMINAL_STYLE=TALL
+
+    # Controls buttons on Crafting Screen : Capped at 9
+    I:craftAmtButton1=1
+
+    # Controls buttons on Crafting Screen : Capped at 99
+    I:craftAmtButton2=10
+
+    # Controls buttons on Crafting Screen : Capped at 999
+    I:craftAmtButton3=100
+
+    # Controls buttons on Crafting Screen : Capped at 9999
+    I:craftAmtButton4=1000
+    B:disableColoredCableRecipesInJEI=true
+    B:enableEffects=true
+
+    # Controls buttons on Level Emitter Screen : Capped at 9
+    I:levelAmtButton1=1
+
+    # Controls buttons on Level Emitter Screen : Capped at 99
+    I:levelAmtButton2=10
+
+    # Controls buttons on Level Emitter Screen : Capped at 999
+    I:levelAmtButton3=100
+
+    # Controls buttons on Level Emitter Screen : Capped at 9999
+    I:levelAmtButton4=1000
+
+    # Controls buttons on Priority Screen : Capped at 9
+    I:priorityAmtButton1=1
+
+    # Controls buttons on Priority Screen : Capped at 99
+    I:priorityAmtButton2=10
+
+    # Controls buttons on Priority Screen : Capped at 999
+    I:priorityAmtButton3=100
+
+    # Controls buttons on Priority Screen : Capped at 9999
+    I:priorityAmtButton4=1000
+    B:rememberTerminalSearchOnClose=false
+    B:useColoredCraftingStatus=true
+    B:useTerminalUseLargeFont=false
+}
+
+
+condenser {
+    I:MatterBalls=256
+    I:Singularity=256000
+}
+
+
+craftingcpu {
+    I:craftingCalculationTimePerTick=5
+}
+
+
+##########################################################################################################
+# features
+#--------------------------------------------------------------------------------------------------------#
+# Warning: Disabling a feature may disable other features depending on it.
+##########################################################################################################
+
+features {
+
+    world {
+        B:CertusOre=true
+        B:CertusQuartzWorldGen=false
+        B:ChargedCertusOre=true
+        B:Charger=true
+        B:ChestLoot=false
+        B:CrystalGrowthAccelerator=true
+
+        # Blocks that are not used in any essential recipes, also slabs and stairs.
+        B:DecorativeBlocks=true
+        B:DecorativeLights=true
+        B:DecorativeQuartzBlocks=true
+        B:Flour=false
+        B:GrindStone=true
+        B:Inscriber=true
+        B:MeteoriteWorldGen=false
+        B:SkyStoneChests=false
+        B:SpawnPressesInMeteorites=false
+        B:TinyTNT=true
+        B:VillagerTrading=false
+        B:VillagerTradingPresses=false
+    }
+
+    toolsclassifications {
+        B:CertusQuartzTools=true
+        B:NetherQuartzTools=true
+        B:PoweredTools=true
+    }
+
+    tools {
+        B:ChargedStaff=true
+        B:ColorApplicator=true
+        B:EntropyManipulator=true
+        B:MatterCannon=true
+        B:MeteoriteCompass=false
+        B:PaintBalls=true
+        B:QuartzAxe=true
+        B:QuartzHoe=true
+        B:QuartzKnife=true
+        B:QuartzPickaxe=true
+        B:QuartzSpade=true
+        B:QuartzSword=true
+        B:QuartzWrench=true
+        B:WirelessAccessTerminal=true
+    }
+
+    networkfeatures {
+        B:Channels=true
+        B:PowerGen=true
+        B:QuantumNetworkBridge=true
+        B:Security=true
+        B:SpatialIO=true
+    }
+
+    networkbuses {
+        B:AnnihilationPlane=true
+        B:CableAnchor=true
+        B:CraftingTerminal=true
+        B:ExportBus=true
+        B:FluidAnnihilationPlane=true
+        B:FluidExportBus=true
+        B:FluidFormationPlane=true
+        B:FluidImportBus=true
+        B:FluidInterface=true
+        B:FluidLevelEmitter=true
+        B:FluidStorageBus=true
+        B:FluidTerminal=true
+        B:FormationPlane=true
+        B:IdentityAnnihilationPlane=true
+        B:ImportBus=true
+        B:Interface=true
+        B:LevelEmitter=true
+        B:P2PTunnel=true
+        B:Panels=true
+        B:PartConversionMonitor=true
+        B:QuartzFiber=true
+        B:StorageBus=true
+        B:StorageMonitor=true
+        B:Terminal=true
+        B:ToggleBus=true
+    }
+
+    portablecell {
+        B:PortableCell=true
+    }
+
+    storage {
+        B:Condenser=true
+        B:IOPort=true
+        B:MEChest=true
+        B:MEDrive=true
+        B:StorageCells=true
+    }
+
+    networktool {
+        B:MemoryCard=true
+        B:NetworkTool=true
+    }
+
+    cables {
+        B:CoveredCables=true
+        B:DenseCables=true
+        B:GlassCables=true
+        B:SmartCables=true
+    }
+
+    energy {
+        B:DenseEnergyCells=true
+        B:EnergyAcceptor=true
+        B:EnergyCells=true
+    }
+
+    highercapacity {
+        B:DenseCables=true
+        B:DenseEnergyCells=true
+    }
+
+    p2ptunnels {
+        B:P2PTunnelEU=true
+        B:P2PTunnelFE=true
+        B:P2PTunnelFluids=true
+        B:P2PTunnelItems=true
+        B:P2PTunnelLight=true
+        B:P2PTunnelME=true
+        B:P2PTunnelOpenComputers=true
+        B:P2PTunnelPressure=true
+        B:P2PTunnelRF=true
+        B:P2PTunnelRedstone=true
+    }
+
+    blockfeatures {
+        B:MassCannonBlockDamage=true
+        B:TinyTNTBlockDamage=true
+    }
+
+    facades {
+        B:Facades=true
+    }
+
+    misc {
+        B:Achievements=true
+        B:CraftingLog=false
+        B:Creative=true
+        B:DebugLogging=false
+        B:GrinderLogging=false
+        B:IntegrationLogging=false
+        B:LightDetector=true
+        B:LogSecurityAudits=false
+        B:Logging=true
+        B:PacketLogging=false
+        B:UnsupportedDeveloperTools=false
+        B:UpdateLogging=false
+        B:WebsiteRecipes=false
+    }
+
+    crafting {
+        B:EnableDisassemblyCrafting=true
+        B:EnableFacadeCrafting=true
+        B:InWorldFluix=true
+        B:InWorldPurification=true
+        B:InWorldSingularity=true
+        B:InterfaceTerminal=true
+    }
+
+    rendering {
+        B:AlphaPass=true
+    }
+
+    craftingfeatures {
+        B:CraftingCPU=true
+
+        # Use CraftingManager to find an alternative recipe, after a pattern rejected an ingredient. Should be enabled to avoid issues, but can have a minor performance impact.
+        B:CraftingManagerFallback=true
+        B:MolecularAssembler=true
+        B:Patterns=true
+    }
+
+    upgrades {
+        B:AdvancedCards=true
+        B:BasicCards=true
+        B:ViewCell=true
+    }
+
+    materials {
+        B:Certus=true
+        B:Cores=true
+        B:CrystalSeeds=true
+        B:Dusts=true
+        B:Fluix=true
+        B:MatterBall=true
+        B:Nuggets=true
+        B:Presses=true
+        B:PrintedCircuits=true
+        B:Processors=true
+        B:PureCrystals=true
+        B:QuartzGlass=true
+        B:Silicon=true
+        B:SkyStone=true
+    }
+
+    commands {
+        B:ChunkLoggerTrace=false
+    }
+
+    machines {
+        B:Charger=true
+        B:CrystalGrowthAccelerator=true
+        B:GrindStone=true
+        B:Inscriber=true
+        B:VibrationChamber=true
+    }
+
+    craftingcomponents {
+        B:Cores=true
+        B:MatterBall=true
+        B:Presses=true
+        B:PrintedCircuits=true
+        B:Processors=true
+    }
+
+}
+
+
+general {
+    B:patternTermRequiresItems=true
+
+    # Will auto-remove items that crash when being loaded from storage. This will destroy those items instead of crashing the game!
+    B:removeCrashingItemsOnLoad=false
+}
+
+
+##########################################################################################################
+# grindstone
+#--------------------------------------------------------------------------------------------------------#
+# Creates recipe of the following pattern automatically: '1 oreTYPE => 2 dustTYPE' and '(1 ingotTYPE or 1 crystalTYPE or 1 gemTYPE) => 1 dustTYPE'
+##########################################################################################################
+
+grindstone {
+    # Blacklists the exact oredict name from being handled by any recipe.
+    S:blacklist <
+     >
+
+    # The list of types to handle. Specify without a prefix like ore or dust.
+    S:grinderOres <
+        Obsidian
+        Ender
+        EnderPearl
+        Coal
+        Gold
+        Charcoal
+        NetherQuartz
+        CertusQuartz
+        Wheat
+        Fluix
+        Copper
+        Tin
+        Silver
+        Lead
+        Bronze
+        Brass
+        Platinum
+        Nickel
+        Invar
+        Aluminium
+        Electrum
+        Osmium
+        Zinc
+     >
+
+    # Chance to actually get an output with stacksize > 1.
+    D:oreDoublePercentage=90.0
+}
+
+
+##########################################################################################################
+# modintegration
+#--------------------------------------------------------------------------------------------------------#
+# Valid Values are 'AUTO', 'ON', or 'OFF' - defaults to 'AUTO' ; Suggested that you leave this alone unless your experiencing an issue, or wish to disable the integration for a reason.
+##########################################################################################################
+
+modintegration {
+    S:Buildcraft=AUTO
+    S:Chisel=AUTO
+    S:CraftTweaker=AUTO
+    S:IndustrialCraft2=OFF
+    S:InventoryTweaks=AUTO
+    S:JustEnoughItems=AUTO
+    S:Mekanism=OFF
+    S:MineFactoryReloaded=OFF
+    S:OpenComputers=OFF
+    S:Railcraft=OFF
+    S:RedstoneFluxPower-Items=AUTO
+    S:RedstoneFluxPower-Tiles=AUTO
+    S:TFHammer=OFF
+    S:Tesla=AUTO
+    S:TheOneProbe=OFF
+    S:Waila=AUTO
+}
+
+
+orecamouflage {
+    B:ENDER_DUST=true
+    B:GOLD_DUST=true
+    B:IRON_DUST=true
+    B:NETHER_QUARTZ_DUST=true
+    B:SILICON=true
+    B:WOODEN_GEAR=true
+}
+
+
+powerratios {
+    D:"Forge Energy"=0.5
+    D:ForgeEnergy=0.5
+    D:IC2=2.0
+    D:UsageMultiplier=1.0
+}
+
+
+spatialio {
+    D:spatialPowerExponent=1.35
+    D:spatialPowerMultiplier=1250.0
+    I:storageBiomeID=59
+    I:storageDimensionID=2
+    I:storageProviderID=-11
+}
+
+
+##########################################################################################################
+# tickrates
+#--------------------------------------------------------------------------------------------------------#
+#  Min / Max Tickrates for dynamic ticking, most of these components also use sleeping, to prevent constant ticking, adjust with care, non standard rates are not supported or tested.
+##########################################################################################################
+
+tickrates {
+    I:AnnihilationPlane.max=120
+    I:AnnihilationPlane.min=2
+    I:Charger.max=120
+    I:Charger.min=10
+    I:ExportBus.max=60
+    I:ExportBus.min=5
+    I:FluidExportBus.max=60
+    I:FluidExportBus.min=5
+    I:FluidImportBus.max=40
+    I:FluidImportBus.min=5
+    I:FluidStorageBus.max=60
+    I:FluidStorageBus.min=5
+    I:IOPort.max=5
+    I:IOPort.min=1
+    I:ImportBus.max=40
+    I:ImportBus.min=5
+    I:Inscriber.max=1
+    I:Inscriber.min=1
+    I:Interface.max=120
+    I:Interface.min=5
+    I:ItemTunnel.max=60
+    I:ItemTunnel.min=5
+    I:LightTunnel.max=120
+    I:LightTunnel.min=5
+    I:METunnel.max=20
+    I:METunnel.min=5
+    I:OpenComputersTunnel.max=5
+    I:OpenComputersTunnel.min=1
+    I:PressureTunnel.max=120
+    I:PressureTunnel.min=1
+    I:StorageBus.max=60
+    I:StorageBus.min=5
+    I:VibrationChamber.max=40
+    I:VibrationChamber.min=10
+}
+
+
+##########################################################################################################
+# wireless
+#--------------------------------------------------------------------------------------------------------#
+# Range= wirelessBaseRange + wirelessBoosterRangeMultiplier * Math.pow( boosters, wirelessBoosterExp )
+# PowerDrain= wirelessBaseCost + wirelessCostMultiplier * Math.pow( boosters, 1 + boosters / wirelessHighWirelessCount )
+##########################################################################################################
+
+wireless {
+    D:wirelessBaseCost=8.0
+    D:wirelessBaseRange=16.0
+    D:wirelessBoosterExp=1.5
+    D:wirelessBoosterRangeMultiplier=1.0
+    D:wirelessCostMultiplier=1.0
+    D:wirelessTerminalDrainMultiplier=1.0
+}
+
+
+worldgen {
+    D:meteoriteClusterChance=0.1
+    I:meteoriteDimensionWhitelist <
+     >
+    I:meteoriteMaximumSpawnHeight=256
+    I:minMeteoriteDistance=707
+    I:quartzOresClusterAmount=15
+    I:quartzOresPerCluster=4
+    D:spawnChargedChance=0.07999998331069946
+}
+
+

config/AppliedEnergistics2/CustomRecipes.cfg

@@ -0,0 +1,25 @@
+# Configuration file
+
+cache {
+    S:digest=35be480fcae22376bc84ea31d11e4627
+
+    # Caching can save processing time, if there are a lot of items. [default: true]
+    B:enableCache=false
+}
+
+
+general {
+    # Will output more detailed information into the CSV like corresponding items [default: false]
+    B:enableAdditionalInfo=false
+
+    # If true, the CSV exporting will always happen. This will not use the cache to reduce the computation. [default: false]
+    B:enableForceRefresh=false
+
+    # If true, the custom recipes are enabled. Acts as a master switch. [default: true]
+    B:enabled=true
+
+    # If true, all registered items will be exported containing the internal minecraft name and the localized name to actually find the item you are using. This also contains the item representation of the blocks, but are missing items, which are too much to display e.g. FMP. [default: true]
+    B:exportItemNames=true
+}
+
+

config/AppliedEnergistics2/Facades.cfg

@@ -0,0 +1,45 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+##########################################################################################################
+# common
+#--------------------------------------------------------------------------------------------------------#
+# Settings applied to all facades.
+# 
+# By default full blocks with no tile entity and a model do not need whitelisting.
+# This will only be read once during client startup.
+##########################################################################################################
+
+common {
+    # Unsupported: Allows whitelisting TileEntity as facades. Could work, have render issues, or corrupt your world. USE AT YOUR OWN RISK.
+    B:allowTileEntityFacades=false
+}
+
+
+##########################################################################################################
+# facades
+#--------------------------------------------------------------------------------------------------------#
+# A way to explicitly handle certain blocks as facades.
+# 
+# Blocks can be added by their resource location under the following rules.
+#  - One category per domain like minecraft or appliedenergistics2
+#  - One key per id. E.g. glass in case of minecraft:glass
+#  - An integer value ranging from 0 to 16 representing the metadata 0-15 and 16 as wildcard for all - Multiple entries for the same id but different metadata are possible when needed
+##########################################################################################################
+
+facades {
+
+    minecraft {
+        I:glass=16
+        I:stained_glass=16
+    }
+
+    appliedenergistics2 {
+        I:quartz_glass=16
+        I:quartz_vibrant_glass=16
+    }
+
+}
+
+

config/AppliedEnergistics2/VersionChecker.cfg

@@ -0,0 +1,30 @@
+# Configuration file
+
+cache {
+    # Waits as many hours, until it checks again. [range: 0 ~ 168, default: 24]
+    I:interval=24
+    S:lastCheck=1501773110066
+}
+
+
+channel {
+    # Determines the channel level which should be checked for updates. Can be either Stable, Beta or Alpha. [default: Beta]
+    S:level=Beta
+}
+
+
+client {
+    # If true, the player is getting a notification including changelog. Only happens if notification are enabled. [default: true]
+    B:changelog=true
+
+    # If true, the player is getting a notification, that a new version is available. [default: true]
+    B:notify=false
+}
+
+
+general {
+    # If true, the version checker is enabled. Acts as a master switch. [default: true]
+    B:enabled=false
+}
+
+

config/BNBGamingCore.cfg

@@ -0,0 +1,9 @@
+# Configuration file
+
+modules {
+    # Specify ASM modules here that you do not want to run. [default: ]
+    S:"disabled modules" <
+     >
+}
+
+

config/BetterBedrock.cfg

@@ -0,0 +1,38 @@
+# Configuration file
+
+##########################################################################################################
+# dimensions
+#--------------------------------------------------------------------------------------------------------#
+# Dimension Configuration
+##########################################################################################################
+
+dimensions {
+    # Dimentions to generate flat bedrock in
+    I:whitelist <
+        -1
+        0
+        7
+        10
+        28885
+     >
+}
+
+
+##########################################################################################################
+# retrogen
+#--------------------------------------------------------------------------------------------------------#
+# Retro-Generation Config
+##########################################################################################################
+
+retrogen {
+    # Enabled chunks to be regenerated. This will probability cause lag until chunks are done. [default: false]
+    B:enabled=false
+
+    # Marker for marking chunks that have been generated. Must be a number. [range: 1 ~ 2147483647, default: 1]
+    I:marker=1
+
+    # Enable this only to rebuild the Bedrock at y level 0. Retrogen must be enabled to work. [default: false]
+    B:rebuild=false
+}
+
+

config/Building Gadgets.cfg

@@ -0,0 +1,204 @@
+# Configuration file
+
+general {
+    # Disable absolute coords-mode for the Copy-Paste gadget
+    B:"Allow absolute Coord-Mode"=true
+
+    # Whether the Building / CopyPaste Gadget can overwrite blocks like water, lava, grass, etc (like a player can).
+    # False will only allow it to overwrite air blocks.
+    B:"Allow non-Air-Block-Overwrite"=true
+
+    # The maximum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Max"=3
+
+    # The minimum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Min"=1
+
+    # Determines if the Copy/Paste GUI's coordinate mode starts in 'Absolute' mode by default.
+    # Set to true for Absolute, set to False for Relative.
+    B:"Default to absolute Coord-Mode"=false
+
+    # Set to false to disable the recipe for construction paste.
+    B:"Enable Construction Paste"=true
+
+    # Set to false to disable the Destruction Gadget.
+    B:"Enable Destruction Gadget"=true
+
+    # Defines how far away you can build
+    # Min: 1.0
+    # Max: 48.0
+    D:"Max Build Distance"=32.0
+
+    # Set to true for Forge Energy Support, set to False for vanilla Item Damage
+    B:"Powered by Forge Energy"=true
+
+    ##########################################################################################################
+    # blacklist settings
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure your Blacklist-Settings here
+    ##########################################################################################################
+
+    "blacklist settings" {
+        # All Blocks added to this will be treated similar to TileEntities. Not at all.
+        # Notice that you can use Regular Expressions as defined by Java Patterns to express more complex name combinations.
+        # Use for example "awfulmod:.*" to blacklist all awfulmod Blocks.
+        S:"Blacklisted Blocks" <
+            minecraft:.*_door.*
+            minecraft:piston_head
+         >
+    }
+
+    ##########################################################################################################
+    # gadgets
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Gadgets here
+    ##########################################################################################################
+
+    gadgets {
+        # The max energy of Building, Exchanging & Copy-Paste Gadget
+        # Min: 0
+        # Max: 2147483647
+        I:"Maximum Energy"=500000
+
+        # The max range of the Gadgets
+        # Min: 1
+        # Max: 25
+        I:"Maximum allowed Range"=15
+
+        ##########################################################################################################
+        # building gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Building Gadget
+        ##########################################################################################################
+
+        "building gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+        ##########################################################################################################
+        # exchanging gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Exchanging Gadget
+        ##########################################################################################################
+
+        "exchanging gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=2
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=100
+        }
+
+        ##########################################################################################################
+        # destruction gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost, Durability & Maximum Energy of the Destruction Gadget
+        ##########################################################################################################
+
+        "destruction gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=4
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=200
+
+            # The max energy of the Destruction Gadget
+            # Min: 0
+            # Max: 2147483647
+            I:"Maximum Energy"=1000000
+
+            # If enabled, the Destruction Gadget can be taken out of fuzzy mode, allowing only instances of the block clicked to be removed (at a higher cost)
+            B:"Non-Fuzzy Mode Enabled"=false
+
+            # The cost in energy/durability will increase by this amount when not in fuzzy mode
+            # Min: 0.0
+            # Max: 1.7976931348623157E308
+            D:"Non-Fuzzy Mode Multiplier"=2.0
+        }
+
+        ##########################################################################################################
+        # copy-paste gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Copy-Paste Gadget
+        ##########################################################################################################
+
+        "copy-paste gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=500
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+    }
+
+    ##########################################################################################################
+    # paste containers
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Paste Containers here
+    ##########################################################################################################
+
+    "paste containers" {
+        # The maximum capacity of a tier 1 (iron) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T1 Container Capacity"=512
+
+        # The maximum capacity of a tier 2 (gold) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T2 Container Capacity"=2048
+
+        # The maximum capacity of a tier 3 (diamond) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T3 Container Capacity"=8192
+    }
+
+}
+
+

config/CookingForBlockheadsCompat/actuallyadditions.json

@@ -0,0 +1,28 @@
+{
+    "modid": "actuallyadditions",
+    "foods": {
+        "INGREDIENTS": [
+            "food_meatballs",
+            "item_food",
+            {
+                "item": "item_food",
+                "data": 8
+            },
+            {
+                "item": "item_food",
+                "data": 12
+            },
+            {
+                "item": "item_food",
+                "data": 14
+            },
+            {
+                "item": "item_food",
+                "data": 20
+            }
+        ]
+    },
+    "oven_recipes": {
+        "item_food:14": "cooked_omelet"
+    }
+}

config/CookingForBlockheadsCompat/betterwithaddons.json

@@ -0,0 +1,27 @@
+{
+    "modid": "betterwithaddons",
+    "foods": {
+        "INGREDIENTS": [
+            "food_ground_meat",
+            "unbaked",
+            {
+                "item": "unbaked",
+                "data": 1
+            },
+            {
+                "item": "unbaked",
+                "data": 2
+            },
+            {
+                "item": "unbaked",
+                "data": 3
+            }
+        ]
+    },
+    "oven_recipes": {
+        "unbaked": "food_pie_melon",
+        "unbaked:1": "food_pie_meat",
+        "unbaked:2": "food_pie_mushroom",
+        "unbaked:3": "food_pie_amanita"
+    }
+}

config/CookingForBlockheadsCompat/betterwithmods.json

@@ -0,0 +1,24 @@
+{
+    "modid": "betterwithmods",
+    "foods": {
+        "INGREDIENTS": [
+            "raw_egg",
+            "raw_kebab",
+            "raw_omelet",
+            "raw_pastry",
+            "raw_scrambled_egg",
+            {
+                "item": "raw_pastry",
+                "data": 1
+            },
+            {
+                "item": "raw_pastry",
+                "data": 2
+            }
+        ]
+    },
+    "oven_recipes": {
+        "raw_omelet": "cooked_omelet",
+        "raw_pastry:4": "apple_pie"
+    }
+}

config/CookingForBlockheadsCompat/horsepower.json

@@ -0,0 +1,15 @@
+{
+  "modid": "horsepower",
+  "foods": {
+    "INGREDIENTS": [
+      "flour",
+      "dough"
+    ]
+  },
+  "oven_fuel": [
+    {
+      "item": "hand_grindstone",
+      "value": 100
+    }
+  ]
+}

config/CookingForBlockheadsCompat/rustic.json

@@ -0,0 +1,9 @@
+{
+    "modid": "rustic",
+    "foods": {
+        "INGREDIENTS": [
+            "chili_pepper",
+            "tomato"
+        ]
+    }
+}

config/CustomMainMenu/mainmenu.json

@@ -0,0 +1,145 @@
+{
+    "images":
+    {
+        "title":
+        {
+            "image" : "test:textures/gui/title/background/alpha.png",
+            "posX" : -137,
+            "posY" : 30,
+            "width" : 512,
+            "height" : 512,
+            "alignment" : "top_center"
+        }
+    },
+    
+    "buttons":
+    {
+        "singleplayer":
+        {
+            "text" : "menu.singleplayer",
+            "texture" : "test:textures/gui/title/background/longbutton.png",
+            "posX" : -100,
+            "posY" : 25,
+            "width" : 200,
+            "height" : 20,
+            "alignment" : "center",
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "singleplayer"
+            }
+        },
+        
+        "multiplayer":
+        {
+            "text" : "menu.multiplayer",
+            "texture" : "test:textures/gui/title/background/longbutton.png",            
+            "posX" : -100,
+            "posY" : 48,
+            "width" : 200,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "multiplayer"
+            }
+        },
+        
+        "mods":
+        {
+            "text" : "fml.menu.mods",
+            "texture" : "test:textures/gui/title/background/longbutton.png",            
+            "posX" : -100,
+            "posY" : 71,
+            "width" : 200,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "mods"
+            }
+        },
+            
+        "options":
+        {
+            "text" : "menu.options",
+            "texture" : "test:textures/gui/title/background/shortbutton.png",            
+            "posX" : -100,
+            "posY" : 94,
+            "width" : 98,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "options"
+            }
+        },
+        
+        "quit":
+        {
+            "text" : "menu.quit",
+            "texture" : "test:textures/gui/title/background/shortbutton.png",            
+            "posX" : 2,
+            "posY" : 94,
+            "width" : 98,
+            "height" : 20,
+            "alignment" : "center",            
+            "action" : 
+            {
+                "type" : "quit"
+            }
+        },
+        
+        "language":
+        {
+            "text" : " ",
+            "texture" : "test:textures/gui/title/background/lang.png",            
+            "posX" : -124,
+            "posY" : 94,
+            "width" : 20,
+            "height" : 20,
+            "alignment" : "center",            
+            "imageWidth": "40",
+            "imageHeight": "40",
+            "action" : 
+            {
+                "type" : "openGui",
+                "gui" : "languages"
+            }
+        }
+    },
+    
+    "labels":
+    {
+        "mojang":
+        {
+            "text" : "Copyright Mojang AB. Do not distribute!",
+            "posX" : -197,
+            "posY" : -10,
+            "color" : -1,
+            "alignment" : "bottom_right"
+        },
+        
+        "fml":
+        {
+            "text" : "",
+            "posX" : 2,
+            "posY" : -40,
+            "color" : -1,
+            "alignment" : "bottom_left"
+        }
+    },
+        
+    "other":
+    {
+        "background":
+        {
+            "image" : "test:textures/gui/title/background/background.png",
+            "mode" : "stretch"
+            }
+        }
+    }
+}

config/ElevatorMod/ElevatorMod.cfg

@@ -0,0 +1,14 @@
+# Configuration file
+
+general {
+    # Can mobs spawn in elevators ? [default: true]
+    B:mobSpawn=true
+
+    # Realign players after teleporting to the center of elevator ? [default: true]
+    B:precisionTarget=true
+
+    # Should elevators have the same color to teleport ? [default: true]
+    B:sameColor=true
+}
+
+

config/FBP/AnimBlockExceptions.txt

@@ -0,0 +1,21 @@
+minecraft:vine
+minecraft:barrier
+minecraft:standing_banner
+minecraft:cobblestone_wall
+minecraft:chest
+minecraft:ender_chest
+minecraft:trapped_chest
+minecraft:wooden_door
+minecraft:birch_door
+minecraft:spruce_door
+minecraft:dark_oak_door
+minecraft:jungle_door
+minecraft:stone
+minecraft:skull
+minecraft:wall_banner
+minecraft:air
+minecraft:standing_sign
+minecraft:wall_sign
+minecraft:iron_door
+minecraft:acacia_door
+minecraft:bed

config/FBP/FloatingMaterials.txt

@@ -0,0 +1,35 @@
+grass=false
+ground=false
+wood=true
+rock=false
+iron=false
+anvil=false
+water=false
+lava=false
+leaves=true
+plants=true
+vine=false
+sponge=false
+cloth=false
+fire=false
+sand=false
+circuits=false
+carpet=true
+glass=false
+redstone_light=false
+tnt=false
+coral=false
+ice=true
+packed_ice=false
+snow=false
+crafted_snow=false
+cactus=false
+clay=false
+gourd=false
+dragon_egg=false
+portal=false
+cake=false
+web=true
+piston=false
+barrier=false
+structure_void=false

config/FBP/Particle.properties

@@ -0,0 +1,29 @@
+enabled=true
+weatherParticleDensity=1.0
+particlesPerAxis=4
+restOnFloor=true
+waterPhysics=true
+fancyFlame=true
+fancySmoke=true
+fancyRain=false
+fancySnow=true
+spawnPlaceParticles=true
+fancyPlaceAnim=false
+animSmoothLighting=false
+smartBreaking=true
+lowTraction=false
+bounceOffWalls=true
+showInMillis=false
+randomRotation=true
+cartoonMode=false
+entityCollision=false
+randomizedScale=true
+randomFadingSpeed=true
+spawnRedstoneBlockParticles=false
+spawnWhileFrozen=true
+infiniteDuration=false
+minAge=10
+maxAge=55
+scaleMult=0.75
+gravityMult=1.0
+rotationMult=1.0

config/FarmingForBlockheads/Market.json

@@ -0,0 +1,49 @@
+{
+  "defaults": {
+    "__comment": "You can disable defaults by setting these to false. Do *NOT* try to add additional entries here. You can add additional entries in the custom section.",
+    "Vanilla Seeds": true,
+    "Natura Saplings": true,
+    "Vanilla Saplings": true,
+    "Bonemeal": true,
+    "Animal Eggs": false,
+    "Natura Seeds": true,
+    "Vanilla Flowers": false,
+    "Natura Bushes": false,
+    "Vanilla Mushrooms": false,
+    "Natura Nether Bushes": false
+  },
+  "defaults payment": {
+    "__comment": "You can define custom payment items for the default entries here.",
+    "Vanilla Seeds": "1*minecraft:gold_ingot:0",
+    "Natura Saplings": "1*minecraft:gold_ingot:0",
+    "Vanilla Saplings": "1*minecraft:gold_ingot:0",
+    "Bonemeal": "1*minecraft:gold_ingot:0",
+    "Animal Eggs": "1*minecraft:gold_ingot:0",
+    "Natura Seeds": "1*minecraft:emerald:0",
+    "Vanilla Flowers": "1*minecraft:emerald:0",
+    "Natura Bushes": "2*minecraft:emerald:0",
+    "Vanilla Mushrooms": "1*minecraft:emerald:0",
+    "Natura Nether Bushes": "3*minecraft:emerald:0"
+  },
+  "defaults blacklist": [
+    "examplemod:example_item"
+  ],
+  "custom entries": {
+    "__comment": "You can define additional items to be sold by the Market here. Defaults can be overridden. Prefix with ! to blacklist instead.",
+    "immersiveengineering:seed": "2*minecraft:gold_ingot",
+    "abyssalcraft:shoggothflesh": "24*abyssalcraft:stone:7",
+    "primal:corn_seeds": "8*actuallyadditions:item_fertilizer"
+  },
+  "defaults amount": {
+    "Vanilla Seeds": 1,
+    "Natura Saplings": 1,
+    "Vanilla Saplings": 1,
+    "Bonemeal": 1,
+    "Animal Eggs": 1,
+    "Natura Seeds": 1,
+    "Vanilla Flowers": 1,
+    "Natura Bushes": 1,
+    "Vanilla Mushrooms": 1,
+    "Natura Nether Bushes": 1
+  }
+}

config/Galacticraft/chunkloading.conf

@@ -0,0 +1,8 @@
+# Configuration file
+
+chunkloading {
+    # If you don't want each player's chunks to load when they log in, set to false.
+    B:LoadOnLogin=true
+}
+
+

config/Galacticraft/core.conf

@@ -0,0 +1,458 @@
+# Configuration file
+
+achievements {
+    # Base Achievement ID. All achievement IDs will start at this number.
+    I:idAchievBase=1784
+}
+
+
+client {
+    # Setting this to false will revert night skies back to default minecraft star count
+    B:"More Stars"=true
+
+    # If you have FPS problems, setting this to true will help if rocket particles are in your sights
+    B:"Disable Spaceship Particles"=false
+
+    # If you're using this mod in virtual reality, or if you don't want the camera changes when entering a Galacticraft vehicle, set this to true.
+    B:"Disable Vehicle Third-Person and Zoom"=false
+
+    # If true, this will move the Oxygen Indicator to the left side. You can combine this with "Minimap Bottom"
+    B:"Minimap Left"=false
+
+    # If true, this will move the Oxygen Indicator to the bottom. You can combine this with "Minimap Left"
+    B:"Minimap Bottom"=true
+
+    # By default, Galacticraft will override capes with the mod's donor cape. Set to false to disable.
+    B:"Override Capes"=true
+}
+
+
+compatibility {
+    # Set to true to make Galacticraft oil register as oilgc, for backwards compatibility with previously generated worlds.
+    B:"Use legacy oilgc fluid registration"=false
+
+    # Set to true to make Galacticraft fuel register as fuelgc, for backwards compatibility with previously generated worlds.
+    B:"Use legacy fuelgc fluid registration"=false
+
+    # List non-opaque blocks from other mods (for example, special types of glass) that the Oxygen Sealer should recognize as solid seals. Format is BlockName or BlockName:metadata
+    S:"External Sealable IDs" <
+        actuallyadditions:block_greenhouse_glass:0
+        chisel:glass:0
+        chisel:glass:1
+        chisel:glass:2
+        chisel:glass:3
+        chisel:glass:4
+        chisel:glass:5
+        chisel:glass:6
+        chisel:glass:7
+        chisel:glass:8
+        chisel:glass:9
+        chisel:glass:10
+        chisel:glass:11
+        chisel:glass:12
+        chisel:glass:13
+        chisel:glass:14
+        chisel:glass:15
+        chisel:glassdyedblack:0
+        chisel:glassdyedblack:1
+        chisel:glassdyedblack:2
+        chisel:glassdyedblack:3
+        chisel:glassdyedblack:4
+        chisel:glassdyedblack:5
+        chisel:glassdyedblue:0
+        chisel:glassdyedblue:1
+        chisel:glassdyedblue:2
+        chisel:glassdyedblue:3
+        chisel:glassdyedblue:4
+        chisel:glassdyedblue:5
+        chisel:glassdyedbrown:0
+        chisel:glassdyedbrown:1
+        chisel:glassdyedbrown:2
+        chisel:glassdyedbrown:3
+        chisel:glassdyedbrown:4
+        chisel:glassdyedbrown:5
+        chisel:glassdyedcyan:0
+        chisel:glassdyedcyan:1
+        chisel:glassdyedcyan:2
+        chisel:glassdyedcyan:3
+        chisel:glassdyedcyan:4
+        chisel:glassdyedcyan:5
+        chisel:glassdyedgray:0
+        chisel:glassdyedgray:1
+        chisel:glassdyedgray:2
+        chisel:glassdyedgray:3
+        chisel:glassdyedgray:4
+        chisel:glassdyedgray:5
+        chisel:glassdyedgreen:0
+        chisel:glassdyedgreen:1
+        chisel:glassdyedgreen:2
+        chisel:glassdyedgreen:3
+        chisel:glassdyedgreen:4
+        chisel:glassdyedgreen:5
+        chisel:glassdyedlightblue:0
+        chisel:glassdyedlightblue:1
+        chisel:glassdyedlightblue:2
+        chisel:glassdyedlightblue:3
+        chisel:glassdyedlightblue:4
+        chisel:glassdyedlightblue:5
+        chisel:glassdyedlightgray:0
+        chisel:glassdyedlightgray:1
+        chisel:glassdyedlightgray:2
+        chisel:glassdyedlightgray:3
+        chisel:glassdyedlightgray:4
+        chisel:glassdyedlightgray:5
+        chisel:glassdyedlime:0
+        chisel:glassdyedlime:1
+        chisel:glassdyedlime:2
+        chisel:glassdyedlime:3
+        chisel:glassdyedlime:4
+        chisel:glassdyedlime:5
+        chisel:glassdyedmagenta:0
+        chisel:glassdyedmagenta:1
+        chisel:glassdyedmagenta:2
+        chisel:glassdyedmagenta:3
+        chisel:glassdyedmagenta:4
+        chisel:glassdyedmagenta:5
+        chisel:glassdyedorange:0
+        chisel:glassdyedorange:1
+        chisel:glassdyedorange:2
+        chisel:glassdyedorange:3
+        chisel:glassdyedorange:4
+        chisel:glassdyedorange:5
+        chisel:glassdyedpink:0
+        chisel:glassdyedpink:1
+        chisel:glassdyedpink:2
+        chisel:glassdyedpink:3
+        chisel:glassdyedpink:4
+        chisel:glassdyedpink:5
+        chisel:glassdyedpurple:0
+        chisel:glassdyedpurple:1
+        chisel:glassdyedpurple:2
+        chisel:glassdyedpurple:3
+        chisel:glassdyedpurple:4
+        chisel:glassdyedpurple:5
+        chisel:glassdyedred:0
+        chisel:glassdyedred:1
+        chisel:glassdyedred:2
+        chisel:glassdyedred:3
+        chisel:glassdyedred:4
+        chisel:glassdyedred:5
+        chisel:glassdyedwhite:0
+        chisel:glassdyedwhite:1
+        chisel:glassdyedwhite:2
+        chisel:glassdyedwhite:3
+        chisel:glassdyedwhite:4
+        chisel:glassdyedwhite:5
+        chisel:glassdyedyellow:0
+        chisel:glassdyedyellow:1
+        chisel:glassdyedyellow:2
+        chisel:glassdyedyellow:3
+        chisel:glassdyedyellow:4
+        chisel:glassdyedyellow:5
+        chisel:ice:0
+        chisel:ice:1
+        chisel:ice:2
+        chisel:ice:3
+        chisel:ice:4
+        chisel:ice:5
+        chisel:ice:6
+        chisel:ice:7
+        chisel:ice:8
+        chisel:ice:9
+        chisel:ice:10
+        chisel:ice:11
+        chisel:ice:12
+        chisel:ice:13
+        chisel:ice:14
+        chisel:ice:15
+        chisel:ice1:0
+        chisel:ice1:1
+        chisel:ice1:2
+        chisel:ice1:3
+        chisel:ice1:4
+        chisel:ice1:5
+        chisel:ice1:6
+        chisel:ice1:7
+        chisel:ice1:8
+        chisel:ice1:9
+        chisel:ice1:10
+        chisel:ice1:11
+        chisel:ice1:12
+        chisel:ice1:13
+        chisel:ice1:14
+        chisel:ice1:15
+        chisel:ice2:0
+        chisel:icepillar:0
+        chisel:icepillar:1
+        chisel:icepillar:2
+        chisel:icepillar:3
+        chisel:icepillar:4
+        chisel:icepillar:5
+        chisel:icepillar:6
+        ferdinandsflowers:block_dye_glass:0
+        ferdinandsflowers:block_dye_glass:1
+        ferdinandsflowers:block_dye_glass:2
+        ferdinandsflowers:block_dye_glass:3
+        ferdinandsflowers:block_dye_glass:4
+        ferdinandsflowers:block_dye_glass:5
+        ferdinandsflowers:block_dye_glass:6
+        ferdinandsflowers:block_dye_glass:7
+        ferdinandsflowers:block_dye_glass:8
+        ferdinandsflowers:block_dye_glass:9
+        ferdinandsflowers:block_dye_glass:10
+        ferdinandsflowers:block_dye_glass:11
+        ferdinandsflowers:block_dye_glass:12
+        ferdinandsflowers:block_dye_glass:13
+        ferdinandsflowers:block_dye_glass:14
+        ferdinandsflowers:block_dye_glass:15
+        galacticraftplanets:dense_ice:0
+        immersiveengineering:stone_decoration:8
+        mekanism:basicblock:10
+        minecraft:ice:0
+        natura:nether_glass:0
+        natura:nether_glass:1
+        nex:soul_glass:0
+        primal:soulglass:0
+        tconstruct:clear_glass:0
+        tconstruct:clear_stained_glass:0
+        tconstruct:clear_stained_glass:1
+        tconstruct:clear_stained_glass:2
+        tconstruct:clear_stained_glass:3
+        tconstruct:clear_stained_glass:4
+        tconstruct:clear_stained_glass:5
+        tconstruct:clear_stained_glass:6
+        tconstruct:clear_stained_glass:7
+        tconstruct:clear_stained_glass:8
+        tconstruct:clear_stained_glass:9
+        tconstruct:clear_stained_glass:10
+        tconstruct:clear_stained_glass:11
+        tconstruct:clear_stained_glass:12
+        tconstruct:clear_stained_glass:13
+        tconstruct:clear_stained_glass:14
+        tconstruct:clear_stained_glass:15
+        tconstruct:seared_glass:0
+     >
+
+    # List blocks from other mods that the Sensor Glasses should recognize as solid blocks. Format is BlockName or BlockName:metadata.
+    S:"External Detectable IDs" <
+        coal_ore
+        diamond_ore
+        gold_ore
+        iron_ore
+        lapis_ore
+        lit_redstone_ore
+        redstone_ore
+     >
+
+    # Enable this if the standard canister recipe causes a conflict.
+    B:"Alternate recipe for canisters"=false
+
+    # This needs to match the OreDictionary name used in the other mod. Set a nonsense name to disable.
+    S:"OreDict name of other mod's silicon"=itemSilicon
+
+    # Should normally be true. If you set this to false, in a modpack with other mods with the same metals, players may be able to craft advanced GC items without travelling to Moon, Mars, Asteroids etc.
+    B:"Must use GC's own space metals in recipes"=true
+
+    # The normal factor is 1.  Increase this to 2 - 5 if other mods with a lot of oil (e.g. BuildCraft) are installed to increase GC rocket fuel requirement.
+    I:"Rocket fuel factor"=1
+}
+
+
+controls {
+    # Increase to make the mouse drag scroll more sensitive, decrease to lower sensitivity.
+    D:"Map Scroll Mouse Sensitivity"=1.0
+
+    # Set to true to invert the mouse scroll feature on the galaxy map.
+    B:"Map Scroll Mouse Invert"=false
+}
+
+
+difficulty {
+    # Spaceships will not explode on contact if set to true.
+    B:"Disable Spaceship Explosion"=true
+
+    # Solar panels will work (default 2x) more effective on space stations.
+    D:"Space Station Solar Energy Multiplier"=2.0
+
+    # Set this to true for less metal use in Galacticraft recipes (makes the game easier).
+    B:"Quick Game Mode"=true
+
+    # Set this to true for increased difficulty in modpacks (see forum for more info).
+    B:"Harder Difficulty"=false
+
+    # Set this to true for a challenging adventure where the player starts the game stranded in the Asteroids dimension with low resources (only effective if Galacticraft Planets installed).
+    B:"Adventure Game Mode"=false
+
+    # Add together flags 8, 4, 2, 1 to enable the four elements of adventure game mode. Default 15.  1 = extended compressor recipes.  2 = mob drops and spawning.  4 = more trees in hollow asteroids.  8 = start stranded in Asteroids.
+    I:"Adventure Game Mode Flags"=15
+
+    # Lower/Raise this value to change time between suffocation damage ticks (allowed range 50-250)
+    I:"Suffocation Cooldown"=100
+
+    # Change this value to modify the damage taken per suffocation tick
+    I:"Suffocation Damage"=2
+
+    # Change this if you wish to balance the mod (if you have more powerful weapon mods).
+    D:"Dungeon Boss Health Modifier"=1.0
+
+    # Set to a value between 0.0 and 1.0 to decrease meteor spawn chance (all dimensions).
+    D:"Meteor Spawn Modifier"=8.5
+
+    # Set to false to stop meteors from breaking blocks on contact.
+    B:"Meteor Block Damage Enabled"=true
+}
+
+
+dimensions {
+    # Dimension ID for the Overworld (as seen in the Celestial Map)
+    I:idDimensionOverworld=0
+
+    # Dimension ID for the Moon
+    I:idDimensionMoon=-28
+
+    # WorldProvider ID for Overworld Space Stations (advanced: do not change unless you have conflicts)
+    I:idDimensionOverworldOrbit=-27
+
+    # WorldProvider ID for Static Space Stations (advanced: do not change unless you have conflicts)
+    I:idDimensionOverworldOrbitStatic=-26
+
+    # Biome ID for Moon (Mars will be this + 1, Asteroids + 2 etc). Allowed range 40-250.
+    I:biomeIDBase=102
+
+    # IDs to load at startup, and keep loaded until server stops. Can be added via /gckeeploaded
+    I:"Static Loaded Dimensions" <
+     >
+
+    # Set this to true to have an automatic /gckeeploaded for any new Space Station created.
+    B:"Set new Space Stations to be static loaded"=false
+
+    # IDs of dimensions where rockets should not launch - this should always include the Nether.
+    S:"Dimensions where rockets cannot launch" <
+        1
+        -1
+        144
+        10
+     >
+
+    # If true, rockets will be unable to reach the Overworld (only use this in special modpacks!)
+    B:"Disable rockets from returning to Overworld"=false
+}
+
+
+general {
+    # If this is enabled, debug messages will appear in the console. This is useful for finding bugs in the mod.
+    B:"Enable Debug Messages"=false
+
+    # By default, you will respawn on Galacticraft dimensions if you die. If you are dying over and over on a planet, set this to true, and you will respawn back on the Overworld.
+    B:"Force Overworld Spawn"=false
+
+    # If this is true, the player will parachute onto the Moon instead - use only in debug situations.
+    B:"Disable lander on Moon and other planets"=false
+
+    # Update check will not run if this is set to true.
+    B:"Disable Update Check"=true
+
+    # Liquids will not flow into Grating block if this is set to false.
+    B:"Allow liquids into Gratings"=true
+
+    # Space Race Manager will show on-screen after login, if enabled.
+    B:"Enable Space Race Manager Popup"=false
+}
+
+
+keybindings_initial {
+    # Default Map key on first Galacticraft run only. After first run, change keys by Minecraft in-game Controls menu.  Valid settings: KEY_ followed by 0-9 or A-Z.
+    S:"Open Galaxy Map"=KEY_M
+
+    # Default Rocket/Fuel key on first Galacticraft run only. After first run, change keys by Minecraft in-game Controls menu.  Valid settings: KEY_ followed by 0-9 or A-Z.
+    S:"Open Rocket GUI"=KEY_G
+
+    # Default Goggles key on first Galacticraft run only. After first run, change keys by Minecraft in-game Controls menu.  Valid settings: KEY_ followed by 0-9 or A-Z.
+    S:"Toggle Advanced Goggles"=KEY_K
+}
+
+
+schematic {
+    # Schematic ID for Tier 1 Rocket, must be unique.
+    I:idSchematicRocketT1=0
+
+    # Schematic ID for Moon Buggy, must be unique.
+    I:idSchematicMoonBuggy=1
+
+    # Schematic ID for "Add Schematic" Page, must be unique
+    I:idSchematicAddSchematic=2147483647
+}
+
+
+server {
+    # Set this to 0 for no borders (default).  If set to e.g. 2000, players will land on the Moon inside the x,z range -2000 to 2000.)
+    I:"World border for landing location on other planets (Moon, Mars, etc)"=0
+
+    # While true, space stations require you to invite other players using /ssinvite <playername>
+    B:"Space Stations Require Permission"=true
+
+    # If set to true on a server, players will be completely unable to create space stations.
+    B:"Disable Space Station creation"=false
+
+    # If this is enabled, areas sealed by Oxygen Sealers will run a seal check when the player breaks or places a block (or on block updates).  This should be enabled for a 100% accurate sealed status, but can be disabled on servers for performance reasons.
+    B:"Enable Sealed edge checks"=true
+}
+
+
+worldgen {
+    # Increasing this will increase amount of oil that will generate in each chunk.
+    D:"Oil Generation Factor"=1.8
+
+    # List of non-galacticraft dimension IDs to generate oil in.
+    I:"Oil gen in external dimensions" <
+     >
+
+    # If this is enabled, GC oil will be added to existing Overworld maps where possible.
+    B:"Retro Gen of GC Oil in existing map chunks"=false
+
+    # If this is enabled, copper ore will generate on the overworld.
+    B:"Enable Copper Ore Gen"=false
+
+    # If this is enabled, tin ore will generate on the overworld.
+    B:"Enable Tin Ore Gen"=false
+
+    # If this is enabled, aluminum ore will generate on the overworld.
+    B:"Enable Aluminum Ore Gen"=false
+
+    # If this is enabled, silicon ore will generate on the overworld.
+    B:"Enable Silicon Ore Gen"=false
+
+    # Disable Cheese Ore Gen on Moon.
+    B:"Disable Cheese Ore Gen on Moon"=false
+
+    # Disable Tin Ore Gen on Moon.
+    B:"Disable Tin Ore Gen on Moon"=false
+
+    # Disable Copper Ore Gen on Moon.
+    B:"Disable Copper Ore Gen on Moon"=false
+
+    # Disable Sapphire Ore Gen on Moon.
+    B:"Disable Sapphire Ore Gen on Moon"=false
+
+    # If true, moon villages will not generate.
+    B:"Disable Moon Village Gen"=false
+
+    # If this is enabled, other mods' standard ores and all other features (eg. plants) can generate on the Moon and planets. Apart from looking wrong, this make cause 'Already Decorating!' type crashes.  NOT RECOMMENDED!  See Wiki.
+    B:"Generate all other mods features on planets"=false
+
+    # If generate other mods features is disabled as recommended, this setting can whitelist CoFHCore custom worldgen on planets.
+    B:"Whitelist CoFHCore worldgen to generate its ores and lakes on planets"=false
+
+    # If ThaumCraft is installed, ThaumCraft wild nodes can generate on the Moon and planets.
+    B:"Generate ThaumCraft wild nodes on planetary surfaces"=false
+
+    # Enter IDs of other mods' ores here for Galacticraft to generate them on the Moon and other planets. Format is BlockName or BlockName:metadata. Use optional parameters at end of each line: /RARE /UNCOMMON or /COMMON for rarity in a chunk; /DEEP /SHALLOW or /BOTH for height; /SINGLE /STANDARD or /LARGE for clump size; /XTRARANDOM for ores sometimes there sometimes not at all.  /ONLYMOON or /ONLYMARS if wanted on one planet only.  If nothing specified, defaults are /COMMON, /BOTH and /STANDARD.  Repeat lines to generate a huge quantity of ores.
+    S:"Other mods ores for GC to generate on the Moon and planets" <
+        contenttweaker:sub_block_holder_0:7 /ONLYMARS /DEEP /LARGE
+     >
+
+    # Biome Types will not be registered in the BiomeDictionary if this is set to true.
+    B:"Disable Biome Type Registrations"=false
+}
+
+

config/Galacticraft/miccore.conf

@@ -0,0 +1,11 @@
+# Configuration file
+
+general {
+    # Enable debug messages during Galacticraft bytecode injection at startup.
+    B:"Enable Debug messages"=false
+
+    # This will cause some dimensions to appear round, disable if render transformations cause a conflict.
+    B:"Enable Small Moons"=true
+}
+
+

config/Galacticraft/planets.conf

@@ -0,0 +1,92 @@
+# Configuration file
+
+dimensions {
+    # Dimension ID for Mars
+    I:dimensionIDMars=-29
+
+    # Dimension ID for Asteroids
+    I:dimensionIDAsteroids=-30
+
+    # Dimension ID for Venus
+    I:dimensionIDVenus=-31
+}
+
+
+general {
+    # Whether or not the launch controller acts as a chunk loader. Will cause issues if disabled!
+    B:launchControllerChunkLoad=true
+
+    # May rarely cause issues if enabled, depends on how the other mod's dimensions are.
+    B:launchControllerAllDims=false
+
+    # Option to disable Helium gas in Galacticraft (because it will be registered by another mod eg GregTech).
+    B:disableGalacticraftHelium=false
+
+    # Maximum number of Astro Miners each player is allowed to have active (default 6).
+    I:maximumAstroMiners=6
+
+    # Option to disable small asteroids from spawning in the Asteroids Dimension.
+    B:disableSmallAsteroids=false
+
+    # Disables background thunder and lightning.
+    B:disableAmbientLightning=false
+}
+
+
+schematic {
+    # Schematic ID for Tier 2 Rocket, must be unique.
+    I:idSchematicRocketT2=2
+
+    # Schematic ID for Cargo Rocket, must be unique.
+    I:idSchematicCargoRocket=3
+
+    # Schematic ID for Tier 3 Rocket, must be unique.
+    I:idSchematicRocketT3=4
+}
+
+
+worldgen {
+    # Disable Iron Ore Gen on Mars.
+    B:"Disable Iron Ore Gen on Mars"=false
+
+    # Disable Copper Ore Gen on Mars.
+    B:"Disable Copper Ore Gen on Mars"=false
+
+    # Disable Tin Ore Gen on Mars.
+    B:"Disable Tin Ore Gen on Mars"=false
+
+    # Disable Desh Ore Gen on Mars.
+    B:"Disable Desh Ore Gen on Mars"=false
+
+    # Disable Iron Ore Gen on Asteroids.
+    B:"Disable Iron Ore Gen on Asteroids"=false
+
+    # Disable Aluminum Ore Gen on Asteroids.
+    B:"Disable Aluminum Ore Gen on Asteroids"=false
+
+    # Disable Ilmenite Ore Gen on Asteroids.
+    B:"Disable Ilmenite Ore Gen on Asteroids"=false
+
+    # Disable Aluminum Ore Gen on Venus.
+    B:"Disable Aluminum Ore Gen on Venus"=false
+
+    # Disable Copper Ore Gen on Venus.
+    B:"Disable Copper Ore Gen on Venus"=false
+
+    # Disable Galena Ore Gen on Venus.
+    B:"Disable Galena Ore Gen on Venus"=false
+
+    # Disable Quartz Ore Gen on Venus.
+    B:"Disable Quartz Ore Gen on Venus"=false
+
+    # Disable Silicon Ore Gen on Venus.
+    B:"Disable Silicon Ore Gen on Venus"=false
+
+    # Disable Tin Ore Gen on Venus.
+    B:"Disable Tin Ore Gen on Venus"=false
+
+    # Disable Solar Ore Gen on Venus.
+    B:"Disable Solar Ore Gen on Venus"=false
+}
+
+

config/Galacticraft/power-GC3.conf

@@ -0,0 +1,30 @@
+# Configuration file
+
+compatibility {
+    D:"BuildCraft Conversion Ratio"=16.0
+    B:"Disable INPUT of BuildCraft energy"=false
+    B:"Disable INPUT of Forge Energy to GC machines"=false
+    B:"Disable INPUT of IC2 energy"=false
+    B:"Disable INPUT of Mekanism energy"=false
+    B:"Disable INPUT of RF energy"=false
+    B:"Disable OUTPUT of BuildCraft energy"=false
+    B:"Disable OUTPUT of Forge Energy from GC machines"=false
+    B:"Disable OUTPUT of IC2 energy"=false
+    B:"Disable OUTPUT of Mekanism energy"=false
+    B:"Disable OUTPUT of RF energy"=false
+    B:"Disable old Buildcraft API (MJ) interfacing completely?"=false
+    D:"IndustrialCraft Conversion Ratio"=6.557376861572266
+    I:"Loss factor when converting energy as a percentage (100 = no loss, 90 = 10% loss ...)"=100
+    D:"Mekanism Conversion Ratio"=0.6557376980781555
+    D:"RF Conversion Ratio"=1.600000023841858
+}
+
+
+display {
+    B:"If BuildCraft is loaded, show Galacticraft machines energy as MJ instead of gJ?"=false
+    B:"If IndustrialCraft2 is loaded, show Galacticraft machines energy as EU instead of gJ?"=false
+    B:"If Mekanism is loaded, show Galacticraft machines energy as Joules (J) instead of gJ?"=false
+    B:"Show Galacticraft machines energy in RF instead of gJ?"=true
+}
+
+

config/Guide-API/Guide-API.cfg

@@ -0,0 +1,48 @@
+# Configuration file
+
+##########################################################################################################
+# books
+#--------------------------------------------------------------------------------------------------------#
+# All settings related to Books.
+##########################################################################################################
+
+books {
+    # Allows books to spawn with new players.
+    # This is a global override for all books. [default: true]
+    B:canSpawnWithBooks=false
+
+    ##########################################################################################################
+    # spawn
+    #--------------------------------------------------------------------------------------------------------#
+    # If true, the user will spawn with the book.
+    # This defaults to the value the book owner has set and is overridden by this config.
+    ##########################################################################################################
+
+    spawn {
+        #  [default: false]
+        B:"bloodmagic:guide"=false
+        B:"crossroads:crossroadsmainguide"=false
+        B:"crossroads:info_guide"=false
+
+        #  [default: true]
+        B:"cyclicmagic:guide"=false
+
+        #  [default: false]
+        B:"modularrouters:guidebook"=false
+    }
+
+}
+
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# Miscellaneous settings.
+##########################################################################################################
+
+general {
+    # Enables extra information being printed to the console. [default: true]
+    B:enableLogging=false
+}
+
+

config/InvTweaks/InvTweaks.cfg

@@ -0,0 +1,23 @@
+#Inventory Tweaks Configuration
+#(Regarding shortcuts, all key names can be found at: http://legacy.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html)
+#Mon Dec 13 19:08:47 EST 2021
+enableMiddleClick=true
+showChestButtons=true
+enableSortingOnPickup=false
+enableAutoRefill=true
+autoRefillBeforeBreak=false
+autoRefillDamageThreshhold=5
+enableSounds=true
+enableShortcuts=true
+enableAutoEquipArmor=false
+enableServerItemSwap=true
+enableConfigLoadedMesssage=false
+invertToolDamageSorting=true
+shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT
+shortcutKeyEverything=SPACE
+shortcutKeyOneItem=LCONTROL, RCONTROL
+shortcutKeyToUpperSection=UP
+shortcutKeyToLowerSection=DOWN
+shortcutKeyDrop=LALT, RALT
+enableToolTipTreePath=false
+version=1.64+dev.151.822d839

config/InvTweaks/InvTweaksRules.txt

@@ -0,0 +1,31 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can add it there.

config/InvTweaks/trees/readme.txt

@@ -0,0 +1,5 @@
+You may add additional ".tree" files to this folder and they will be merged into either the "minecraft.tree" file if it is in this folder or the normal InvTweakTree.txt file if "minecraft.tree" does not exist.  These tree files have the same structure as the InvTweakTree.txt file, and matching categories will be merged into one with nodes from the new tree file being added to the end of the matching category.
+
+You can find tree files maintained by IMarvinTPA at https://github.com/IMarvinTPA/InventoryTweaksTrees
+
+

config/InvTweaksRules.txt

@@ -0,0 +1,31 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can add it there.

config/Mercurius.cfg

@@ -0,0 +1,448 @@
+# Configuration file
+
+general {
+    S:modPack=SevTech-Ages
+    S:modPackVersion=3.2.1
+    B:spammyLogs=false
+
+    optout {
+        B:OS=false
+        B:clientTime=false
+        B:environment=false
+        B:installID=false
+        B:javaVersion=false
+        B:minecraftVersion=false
+        B:modPack=false
+        B:modPackVersion=false
+        B:ramAllocated=false
+        B:ramMax=false
+        B:sessionID=false
+
+        mods {
+            B:FML=false
+            B:abyssalcraft=false
+            B:acintegration=false
+            B:actuallyadditions=false
+            B:actuallybaubles=false
+            B:adchimneys=false
+            B:advancedmortars=false
+            B:advancedrocketry=false
+            B:advancedrocketrycore=false
+            B:advgenerators=false
+            B:ae2stuff=false
+            B:animalium=false
+            B:animania=false
+            B:antiqueatlas=false
+            B:antiqueatlasoverlay=false
+            B:applecore=false
+            B:appleskin=false
+            B:appliedenergistics2=false
+            B:appliedenergistics2-core=false
+            B:aquamunda=false
+            B:arcanum=false
+            B:armoreablemobs=false
+            B:aroma1997core=false
+            B:aromabackup=false
+            B:aromabackuprecovery=false
+            B:astikoor=false
+            B:astikorcarts=false
+            B:astralsorcery=false
+            B:atmlib=false
+            B:autoreglib=false
+            B:autoverse=false
+            B:base=false
+            B:baubles=false
+            B:bdlib=false
+            B:bedbugs=false
+            B:bedrockbgone=false
+            B:bedrockores=false
+            B:beneath=false
+            B:betteradvancements=false
+            B:betterbedrock=false
+            B:betterbedrockgen=false
+            B:betterbuilderswands=false
+            B:betterfoliage=false
+            B:betterfonts=false
+            B:betterplacement=false
+            B:betterunderground=false
+            B:betterwithaddons=false
+            B:betterwithlib=false
+            B:betterwithmods=false
+            B:bibliocraft=false
+            B:bibliotheca=false
+            B:bloodmagic=false
+            B:blur=false
+            B:bnbgamingcore=false
+            B:bnbgaminglib=false
+            B:bonsaitrees=false
+            B:bookshelf=false
+            B:bottledmilk=false
+            B:bringbedrockback=false
+            B:buildcraftbuilders=false
+            B:buildcraftcore=false
+            B:buildcraftenergy=false
+            B:buildcraftfactory=false
+            B:buildcraftlib=false
+            B:buildcraftrobotics=false
+            B:buildcraftsilicon=false
+            B:buildcrafttransport=false
+            B:buildinggadgets=false
+            B:caliper=false
+            B:car=false
+            B:caravans=false
+            B:carryon=false
+            B:cavern=false
+            B:cd4017be_lib=false
+            B:ceramics=false
+            B:chameleon=false
+            B:charcoalblock=false
+            B:chargers=false
+            B:chesttransporter=false
+            B:chisel=false
+            B:chiselsandbits=false
+            B:chopdown=false
+            B:chunkanimator=false
+            B:clienttweaks=false
+            B:clumps=false
+            B:codechickenlib=false
+            B:coloredtooltips=false
+            B:colouredtooltips=false
+            B:com.elytradev.movingworld.common.asm.coremod=false
+            B:commoncapabilities=false
+            B:compactmachines3=false
+            B:compressions=false
+            B:conarm=false
+            B:containerfix=false
+            B:contenttweaker=false
+            B:controlling=false
+            B:cookingforblockheads=false
+            B:craftstudioapi=false
+            B:crafttweaker=false
+            B:crafttweakerjei=false
+            B:crossroads=false
+            B:csokicraftutil=false
+            B:csokicraftutil-11=false
+            B:ctgui=false
+            B:ctm=false
+            B:cucumber=false
+            B:cultivatedtech=false
+            B:custommainmenu=false
+            B:cyclicmagic=false
+            B:cyclopscore=false
+            B:darkutils=false
+            B:davincisvessels=false
+            B:death_compass=false
+            B:debugserverinfo=false
+            B:defaultoptions=false
+            B:despawningspawners=false
+            B:dimensionalcontrol=false
+            B:dimstages=false
+            B:dooglamooworlds=false
+            B:draftykites=false
+            B:dungpipe=false
+            B:ecomod=false
+            B:elevatorid=false
+            B:emberroot=false
+            B:embers=false
+            B:enchdesc=false
+            B:enderstorage=false
+            B:enderutilities=false
+            B:energyconverters=false
+            B:environmentaltech=false
+            B:examplemod=false
+            B:extendedcrafting=false
+            B:externaltweaker=false
+            B:extraplanets=false
+            B:factorytech=false
+            B:farmingforblockheads=false
+            B:farseek=false
+            B:fastbench=false
+            B:fastfurnace=false
+            B:fat_cat=false
+            B:fbp=false
+            B:fencejumper=false
+            B:ferdinandsflowers=false
+            B:ffs=false
+            B:findme=false
+            B:finite-water-control=false
+            B:flatbedrockx=false
+            B:flatcoloredblocks=false
+            B:foamfix=false
+            B:foamfixcore=false
+            B:forge=false
+            B:forgeendertech=false
+            B:forgelin=false
+            B:forgemultipartcbe=false
+            B:friendlyfire=false
+            B:fw=false
+            B:galacticraftcore=false
+            B:galacticraftplanets=false
+            B:galacticrafttweaker=false
+            B:gamestages=false
+            B:gardenstuff=false
+            B:geolosys=false
+            B:globalgamerules=false
+            B:glowing_dirtstone_reborn=false
+            B:gobblecore=false
+            B:gravestone=false
+            B:guideapi=false
+            B:hammercore=false
+            B:harvest=false
+            B:harvesttweaks=false
+            B:horsepower=false
+            B:huntingdim=false
+            B:iblis=false
+            B:ichunutil=false
+            B:igwmod=false
+            B:immcraft=false
+            B:immersiveengineering=false
+            B:immersivepetroleum=false
+            B:immersiverailroading=false
+            B:immersivetech=false
+            B:improvedbackpacks=false
+            B:incontrol=false
+            B:indlog=false
+            B:industrialforegoing=false
+            B:infinitefluids=false
+            B:infoaccessories=false
+            B:integrateddynamics=false
+            B:integrateddynamicscompat=false
+            B:integrationforegoing=false
+            B:inventorytweaks=false
+            B:ironbackpacks=false
+            B:ironchest=false
+            B:ironjetpacks=false
+            B:itemstages=false
+            B:ivtoolkit=false
+            B:jaff=false
+            B:jarm=false
+            B:jei=false
+            B:jeid=false
+            B:jeidsi=false
+            B:jeivillagers=false
+            B:jeresources=false
+            B:jmapstages=false
+            B:journeymap=false
+            B:jp.crafterkina.pipes=false
+            B:justenoughpetroleum=false
+            B:justthetips=false
+            B:keywizard=false
+            B:kleeslabs=false
+            B:laggoggles=false
+            B:legiblenei=false
+            B:lex=false
+            B:librarianlib=false
+            B:librarianliblate=false
+            B:libvulpes=false
+            B:loadingprofiler=false
+            B:loadingscreens=false
+            B:loottweaker=false
+            B:lostcities=false
+            B:lostsouls=false
+            B:lostthaumaturgy=false
+            B:lttweaker=false
+            B:magma_monsters=false
+            B:magnum=false
+            B:mantle=false
+            B:mcjtylib_ng=false
+            B:mcp=false
+            B:meecreeps=false
+            B:mekanism=false
+            B:mekatweaks=false
+            B:mercurius=false
+            B:micdoodlecore=false
+            B:microblockcbe=false
+            B:minecraft=false
+            B:minecraftmultipartcbe=false
+            B:missingtextures=false
+            B:mjrlegendslib=false
+            B:mob_grinding_utils=false
+            B:mobends=false
+            B:mobstages=false
+            B:modernconverter=false
+            B:moderncraftcore=false
+            B:modlistbuilder=false
+            B:modtweaker=false
+            B:modularmachinery=false
+            B:modularrouters=false
+            B:moreoverlays=false
+            B:morpheus=false
+            B:morphtool=false
+            B:mousetweaks=false
+            B:movillages=false
+            B:movingworld=false
+            B:mpbasic=false
+            B:mputils=false
+            B:mtlib=false
+            B:multiblockstages=false
+            B:mundaneredstone=false
+            B:mystagradcompat=false
+            B:mysticalagradditions=false
+            B:mysticalagriculture=false
+            B:natura=false
+            B:naturescompass=false
+            B:neat=false
+            B:nei=false
+            B:nex=false
+            B:nonausea=false
+            B:norecipebook=false
+            B:noworldgen5you=false
+            B:nuclearphysics=false
+            B:nutrition=false
+            B:oeintegration=false
+            B:omegacraft=false
+            B:openglider=false
+            B:oreexcavation=false
+            B:orestages=false
+            B:oretiers=false
+            B:overloaded=false
+            B:packetfilter=false
+            B:parrotpower=false
+            B:pdp=false
+            B:personalcars=false
+            B:pickletweaks=false
+            B:placebo=false
+            B:playerbosses=false
+            B:playerskins=false
+            B:pneumaticcraft=false
+            B:portalgun=false
+            B:poweradapters=false
+            B:prestige=false
+            B:primal=false
+            B:primal_tech=false
+            B:primalchests=false
+            B:progressiontweaks=false
+            B:progressivedifficulty=false
+            B:prospectors=false
+            B:quantumstorage=false
+            B:quark=false
+            B:quickleafdecay=false
+            B:randompatches=false
+            B:rangedpumps=false
+            B:realdrops=false
+            B:realtimeclock=false
+            B:reauth=false
+            B:reborncore=false
+            B:rebornstorage=false
+            B:reccomplex=false
+            B:recipestages=false
+            B:redstoneflux=false
+            B:refinedrelocation=false
+            B:refinedstorage=false
+            B:refinedstorageaddons=false
+            B:regressments=false
+            B:resourceloader=false
+            B:rftools=false
+            B:rftoolscontrol=false
+            B:roadrunner=false
+            B:roots=false
+            B:runesofwizardry=false
+            B:runesofwizardry_classics=false
+            B:rustic=false
+            B:sampler=false
+            B:samsocean=false
+            B:sasit=false
+            B:scannable=false
+            B:sev_tweaks_npc=false
+            B:sevpatches=false
+            B:sevtweaks=false
+            B:simpleautorun=false
+            B:simplegenerators=false
+            B:simpleplanes=false
+            B:simpletomb=false
+            B:simplyarrows=false
+            B:simplyconveyors=false
+            B:simplytea=false
+            B:skillable=false
+            B:smoothfont=false
+            B:smoothfontcore=false
+            B:soot=false
+            B:spartanshields=false
+            B:spatialservermod=false
+            B:stellarapi=false
+            B:stellarsky=false
+            B:stepup=false
+            B:stevescarts=false
+            B:stevesfactorymanager=false
+            B:stg=false
+            B:stickyfingers=false
+            B:storagedrawers=false
+            B:storagedrawersextra=false
+            B:storagenetwork=false
+            B:streams=false
+            B:structuredcrafting=false
+            B:sugiforest=false
+            B:supersoundmuffler=false
+            B:survivalist=false
+            B:tallgates=false
+            B:tcomplement=false
+            B:tconstruct=false
+            B:teslacorelib=false
+            B:teslacorelib_registries=false
+            B:"test mod"=false
+            B:texfix=false
+            B:thebetweenlands=false
+            B:thebomplugin=false
+            B:theoneprobe=false
+            B:thirstybottles=false
+            B:tickprofiler=false
+            B:timecontrol=false
+            B:tinker_io=false
+            B:tinkerstages=false
+            B:tinkertoolleveling=false
+            B:tips=false
+            B:tipthescales=false
+            B:toastcontrol=false
+            B:togetherforever=false
+            B:toolbelt=false
+            B:toolprogression=false
+            B:topography=false
+            B:totemic=false
+            B:tothebatpoles=false
+            B:tp=false
+            B:trackapi=false
+            B:translocator=false
+            B:translocators=false
+            B:trashslot=false
+            B:traverse=false
+            B:treechopper=false
+            B:triumph=false
+            B:trumpetskeleton=false
+            B:tumbleweed=false
+            B:twilightforest=false
+            B:unidict=false
+            B:universalmodifiers=false
+            B:uppers=false
+            B:valkyrielib=false
+            B:vc=false
+            B:vctweaker=false
+            B:vimmersion=false
+            B:vtt=false
+            B:waddles=false
+            B:waila=false
+            B:wailaharvestability=false
+            B:wailastages=false
+            B:walljump=false
+            B:wanionlib=false
+            B:watercontrolextreme=false
+            B:waterstrainer=false
+            B:wawla=false
+            B:weirdinggadget=false
+            B:wildcrops=false
+            B:witherskelefix=false
+            B:wizardry=false
+            B:wopper=false
+            B:worldstripper=false
+            B:worldutils=false
+            B:xnet=false
+            B:ynot=false
+            B:yoyos=false
+            B:zenloot=false
+            B:zenstages=false
+        }
+
+    }
+
+}
+
+

config/MoVillages/VillageDistance.cfg

@@ -0,0 +1,24 @@
+# Configuration file
+
+customization {
+    I:"Village Distance - 32 is vanilla, 16 is more common, 8 is extremely common, 4 is just insane."=23
+}
+
+
+"villages to generate" {
+    B:"Birch Forest"=true
+    B:"Cold Taiga"=true
+    B:"Extreme Hills"=true
+    B:Forest=true
+    B:"Ice Plains/Mountains"=true
+    B:Jungle=true
+    B:"Mega Taiga"=true
+    B:Mesa=true
+    B:Mushroom=true
+    B:Ocean=false
+    B:"Roofed Forest"=true
+    B:Swamp=true
+    B:Taiga=true
+}
+
+

config/MoreOverlays.cfg

@@ -0,0 +1,89 @@
+# Configuration file
+
+##########################################################################################################
+# chunkbounds
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the chunk bounds overlay
+##########################################################################################################
+
+chunkbounds {
+    # Show the middle of the current Chunk (yellow line)
+    B:middle=true
+
+    # Radius (in Chunks) to show the edges (red line)
+    I:radius=1
+}
+
+
+##########################################################################################################
+# itemsearch
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the item search feature
+##########################################################################################################
+
+itemsearch {
+    # Items where the NBT of an Item matters and should not be ignored
+    S:matchNBT <
+        minecraft:enchanted_book
+     >
+}
+
+
+##########################################################################################################
+# lightoverlay
+#--------------------------------------------------------------------------------------------------------#
+# Settings for the light / mobspawn overlay
+##########################################################################################################
+
+lightoverlay {
+    # Range of the lightoverlay (negative Y)
+    I:downrange=16
+
+    # Range of the lightoverlay (Horizontal N,E,S,W)
+    I:hrange=16
+
+    # Ignore if there in no 2 Block space to spawn. (Less lag if true)
+    B:ignoreLayer=false
+
+    # Ignore if mobs can actually spawn and just go by light value
+    B:ignoreSpawns=false
+
+    # Minimum save light level where no mobs can spawn
+    I:saveLevel=8
+
+    # Range of the lightoverlay (positive Y)
+    I:uprange=4
+}
+
+
+##########################################################################################################
+# rendersettings
+#--------------------------------------------------------------------------------------------------------#
+# Settings for lines & colors
+# Values: 0xRRGGBB (Hex)
+##########################################################################################################
+
+rendersettings {
+    # Color for the chunk edge
+    I:chunk_edge_color=16711680
+
+    # Color for the chunk grid
+    I:chunk_grid_color=65280
+
+    # Line width for chunk boundaries
+    D:chunk_line_width=1.5
+
+    # Color for the middle chunk line
+    I:chunk_mid_color=16776960
+
+    # Color the X that marks "Spawns always possible"
+    I:spawn_always_color=16711680
+
+    # Line width for spawn indication
+    I:spawn_line_width=2
+
+    # Color the X that marks "Spawns at night possible"
+    I:spawn_night_color=16776960
+}
+
+

config/MouseTweaks.cfg

@@ -0,0 +1,9 @@
+#Wed May 09 10:47:19 EDT 2018
+WheelScrollDirection=0
+WheelTweak=0
+LMBTweakWithoutItem=1
+WheelSearchOrder=1
+LMBTweakWithItem=1
+RMBTweak=1
+OnTickMethodOrder=Forge, LiteLoader
+Debug=0

config/MovingWorld/AssemblePriority.cfg

@@ -0,0 +1,231 @@
+# Configuration file
+
+"dont touch" {
+    S:"CONFIG VERSION"=MovingWorldCFG.1.0.0
+}
+
+
+general {
+    B:"Rediscover powered blocks on next restart?"=false
+}
+
+
+mobile_chunk {
+    S:highpriorityassembly_blocks <
+        minecraft:air
+        minecraft:piston_extension
+        minecraft:piston_head
+        minecraft:sticky_piston
+        minecraft:piston
+        minecraft:air
+        minecraft:golden_rail
+        minecraft:detector_rail
+        minecraft:wooden_door
+        minecraft:lever
+        minecraft:stone_pressure_plate
+        minecraft:iron_door
+        minecraft:wooden_pressure_plate
+        minecraft:stone_button
+        minecraft:fence_gate
+        minecraft:tripwire_hook
+        minecraft:tripwire
+        minecraft:wooden_button
+        minecraft:unpowered_comparator
+        minecraft:powered_comparator
+        minecraft:activator_rail
+        minecraft:spruce_fence_gate
+        minecraft:birch_fence_gate
+        minecraft:jungle_fence_gate
+        minecraft:dark_oak_fence_gate
+        minecraft:acacia_fence_gate
+        minecraft:spruce_door
+        minecraft:birch_door
+        minecraft:jungle_door
+        minecraft:acacia_door
+        minecraft:dark_oak_door
+        minecraft:observer
+        advgenerators:control
+        rustic:fence_gate_olive
+        rustic:fence_gate_ironwood
+        rustic:olive_door
+        rustic:ironwood_door
+        tconstruct:slime_channel
+        natura:overworld_door_eucalyptus
+        natura:overworld_door_hopseed
+        natura:overworld_door_sakura
+        natura:overworld_door_redwood
+        natura:overworld_door_redwood_bark
+        natura:overworld_door_tiger
+        natura:overworld_door_maple
+        natura:overworld_door_silverbell
+        natura:nether_door_ghostwood
+        natura:nether_door_bloodwood
+        natura:nether_door_darkwood
+        natura:nether_door_fusewood
+        natura:nether_lever
+        natura:nether_button
+        natura:nether_pressure_plate
+        natura:blaze_rail_golden
+        natura:blaze_rail_activator
+        natura:blaze_rail_detector
+        natura:maple_button
+        natura:maple_pressure_plate
+        natura:maple_fence_gate
+        natura:silverbell_button
+        natura:silverbell_pressure_plate
+        natura:silverbell_fence_gate
+        natura:amaranth_button
+        natura:amaranth_pressure_plate
+        natura:amaranth_fence_gate
+        natura:tiger_button
+        natura:tiger_pressure_plate
+        natura:tiger_fence_gate
+        natura:willow_button
+        natura:willow_pressure_plate
+        natura:willow_fence_gate
+        natura:eucalyptus_button
+        natura:eucalyptus_pressure_plate
+        natura:eucalyptus_fence_gate
+        natura:hopseed_button
+        natura:hopseed_pressure_plate
+        natura:hopseed_fence_gate
+        natura:sakura_button
+        natura:sakura_pressure_plate
+        natura:sakura_fence_gate
+        natura:redwood_button
+        natura:redwood_pressure_plate
+        natura:redwood_fence_gate
+        natura:ghostwood_button
+        natura:ghostwood_pressure_plate
+        natura:ghostwood_fence_gate
+        natura:bloodwood_button
+        natura:bloodwood_pressure_plate
+        natura:bloodwood_fence_gate
+        natura:fusewood_button
+        natura:fusewood_pressure_plate
+        natura:fusewood_fence_gate
+        natura:darkwood_button
+        natura:darkwood_pressure_plate
+        natura:darkwood_fence_gate
+        traverse:fir_fence_gate
+        traverse:fir_door
+        betterwithmods:booster
+        betterwithmods:steel_pressure_plate
+        appliedenergistics2:security_station
+        appliedenergistics2:quartz_growth_accelerator
+        appliedenergistics2:crafting_unit
+        appliedenergistics2:crafting_accelerator
+        appliedenergistics2:crafting_storage_1k
+        appliedenergistics2:crafting_storage_4k
+        appliedenergistics2:crafting_storage_16k
+        appliedenergistics2:crafting_storage_64k
+        appliedenergistics2:crafting_monitor
+        appliedenergistics2:molecular_assembler
+        quark:nether_brick_fence_gate
+        quark:redstone_randomizer
+        quark:iron_button
+        quark:gold_button
+        quark:obsidian_pressure_plate
+        car:oilmill
+        car:blastfurnace
+        car:backmix_reactor
+        car:generator
+        chargers:wireless_charger
+        cookingforblockheads:oven
+        darkutils:update_detector
+        darkutils:sneaky_lever
+        darkutils:sneaky_plate
+        darkutils:sneaky_button
+        darkutils:timer
+        enderutilities:molecular_exciter
+        enderutilities:phasing
+        integrateddynamics:menril_door
+        mob_grinding_utils:fan
+        mob_grinding_utils:saw
+        mob_grinding_utils:xp_tap
+        nex:quartz_fence_gate
+        nex:nether_brick_fence_gate
+        nex:red_nether_brick_fence_gate
+        nex:basalt_fence_gate
+        nex:basalt_smooth_fence_gate
+        nex:basalt_brick_fence_gate
+        nex:basalt_pillar_fence_gate
+        nex:fiery_nether_brick_fence_gate
+        nex:icy_nether_brick_fence_gate
+        nex:lively_nether_brick_fence_gate
+        nex:gloomy_nether_brick_fence_gate
+        primal:lever_nether
+        primal:door_corypha
+        primal:door_ironwood
+        primal:door_yew
+        primal:door_lacquer
+        primal:gate_ironwood
+        primal:gate_corypha
+        primal:gate_yew
+        primal:gate_lacquer
+        stevescarts:blockdetector
+        storagedrawers:keybutton
+        tallgates:oak_tall_gate
+        tallgates:spruce_tall_gate
+        tallgates:birch_tall_gate
+        tallgates:jungle_tall_gate
+        tallgates:dark_oak_tall_gate
+        tallgates:acacia_tall_gate
+        tcomplement:alloy_tank
+        tcomplement:porcelain_alloy_tank
+        totemic:cedar_fence_gate
+        abyssalcraft:dsbutton
+        abyssalcraft:dspplate
+        abyssalcraft:dltbutton
+        abyssalcraft:dltpplate
+        abyssalcraft:abybutton
+        abyssalcraft:abypplate
+        abyssalcraft:cstonebutton
+        abyssalcraft:cstonepplate
+        abyssalcraft:door_dlt
+        abyssalcraft:door_drt
+        cyclicmagic:wireless_transmitter
+        cyclicmagic:wireless_receiver
+        cyclicmagic:clock
+        cyclicmagic:password_block
+        refinedstorage:detector
+        davincisvessels:crate_wood
+        thebetweenlands:weedwood_plank_fence_gate
+        thebetweenlands:weedwood_log_fence_gate
+        thebetweenlands:rubber_tree_plank_fence_gate
+        thebetweenlands:giant_root_plank_fence_gate
+        thebetweenlands:hearthgrove_plank_fence_gate
+        thebetweenlands:nibbletwig_plank_fence_gate
+        thebetweenlands:weedwood_plank_pressure_plate
+        thebetweenlands:betweenstone_pressure_plate
+        thebetweenlands:syrmorite_pressure_plate
+        thebetweenlands:weedwood_plank_button
+        thebetweenlands:betweenstone_button
+        thebetweenlands:weedwood_lever
+        thebetweenlands:mud_tower_beam_origin
+        thebetweenlands:mud_tower_beam_relay
+        thebetweenlands:rotten_plank_fence_gate
+        thebetweenlands:weedwood_door
+        thebetweenlands:rubber_tree_plank_door
+        thebetweenlands:giant_root_plank_door
+        thebetweenlands:hearthgrove_plank_door
+        thebetweenlands:nibbletwig_plank_door
+        thebetweenlands:syrmorite_door
+        thebetweenlands:scabyst_door
+     >
+    S:highprioritydisassembly_blocks <
+        minecraft:piston_head
+        minecraft:piston_extension
+     >
+    S:lowpriorityassembly_blocks <
+        minecraft:redstone_wire
+        minecraft:obsidian
+     >
+    S:lowprioritydisassembly_blocks <
+        minecraft:end_portal
+        minecraft:portal
+        minecraft:redstone_wire
+     >
+}
+
+

config/MovingWorld/Main.cfg

@@ -0,0 +1,200 @@
+# Configuration file
+
+general {
+    B:"Allow other mods to add to the whitelist/blacklist? NOTE: Turn off if you want to remove the default blacklist/whitelist"=true
+    B:"Assemble Diagonal Blocks NOTE: Can be overridden by mods!"=false
+    B:"Use Iterative Algorithm"=true
+}
+
+
+mobile_chunk {
+    # A list of blocks that are allowed on a Moving World.
+    S:allowed_blocks <
+        minecraft:acacia_stairs
+        minecraft:activator_rail
+        minecraft:anvil
+        minecraft:bed
+        minecraft:birch_stairs
+        minecraft:bookshelf
+        minecraft:brewing_stand
+        minecraft:brick_block
+        minecraft:brick_stairs
+        minecraft:cactus
+        minecraft:cake
+        minecraft:carpet
+        minecraft:coal_block
+        minecraft:cobblestone
+        minecraft:cobblestone_wall
+        minecraft:command_block
+        minecraft:crafting_table
+        minecraft:dark_oak_stairs
+        minecraft:detector_rail
+        minecraft:diamond_block
+        minecraft:dispenser
+        minecraft:dropper
+        minecraft:daylight_detector
+        minecraft:double_stone_slab
+        minecraft:double_wooden_slab
+        minecraft:emerald_block
+        minecraft:enchanting_table
+        minecraft:end_stone
+        minecraft:ender_chest
+        minecraft:acacia_fence
+        minecraft:birch_fence
+        minecraft:dark_oak_fence
+        minecraft:jungle_fence
+        minecraft:nether_brick_fence
+        minecraft:fence
+        minecraft:spruce_fence
+        minecraft:acacia_fence_gate
+        minecraft:birch_fence_gate
+        minecraft:dark_oak_fence_gate
+        minecraft:jungle_fence_gate
+        minecraft:fence_gate
+        minecraft:spruce_fence_gate
+        minecraft:air
+        minecraft:furnace
+        minecraft:fire
+        minecraft:glass
+        minecraft:glass_pane
+        minecraft:glowstone
+        minecraft:gold_block
+        minecraft:golden_rail
+        minecraft:hardened_clay
+        minecraft:hay_block
+        minecraft:heavy_weighted_pressure_plate
+        minecraft:hopper
+        minecraft:iron_bars
+        minecraft:iron_block
+        minecraft:iron_door
+        minecraft:jukebox
+        minecraft:jungle_stairs
+        minecraft:ladder
+        minecraft:lapis_block
+        minecraft:lever
+        minecraft:light_weighted_pressure_plate
+        minecraft:lit_furnace
+        minecraft:lit_pumpkin
+        minecraft:lit_redstone_lamp
+        minecraft:log
+        minecraft:log2
+        minecraft:melon_block
+        minecraft:mob_spawner
+        minecraft:monster_egg
+        minecraft:mossy_cobblestone
+        minecraft:nether_brick
+        minecraft:nether_brick_fence
+        minecraft:nether_brick_stairs
+        minecraft:noteblock
+        minecraft:oak_stairs
+        minecraft:obsidian
+        minecraft:planks
+        minecraft:pumpkin
+        minecraft:piston
+        minecraft:piston_extension
+        minecraft:piston_head
+        minecraft:powered_comparator
+        minecraft:powered_repeater
+        minecraft:quartz_block
+        minecraft:quartz_stairs
+        minecraft:rail
+        minecraft:redstone_block
+        minecraft:redstone_torch
+        minecraft:redstone_wire
+        minecraft:sandstone
+        minecraft:sandstone_stairs
+        minecraft:red_sandstone
+        minecraft:red_sandstone_stairs
+        minecraft:skull
+        minecraft:sponge
+        minecraft:spruce_stairs
+        minecraft:stained_hardened_clay
+        minecraft:standing_sign
+        minecraft:stone_brick_stairs
+        minecraft:stone_button
+        minecraft:stone_pressure_plate
+        minecraft:stone_stairs
+        minecraft:stonebrick
+        minecraft:stained_glass
+        minecraft:stained_glass_pane
+        minecraft:sticky_piston
+        minecraft:stone_slab
+        minecraft:stone_slab2
+        minecraft:tnt
+        minecraft:torch
+        minecraft:trapdoor
+        minecraft:trapped_chest
+        minecraft:tripwire
+        minecraft:tripwire_hook
+        minecraft:unlit_redstone_torch
+        minecraft:unpowered_comparator
+        minecraft:unpowered_repeater
+        minecraft:wall_sign
+        minecraft:web
+        minecraft:wooden_button
+        minecraft:acacia_door
+        minecraft:birch_door
+        minecraft:dark_oak_door
+        minecraft:jungle_door
+        minecraft:wooden_door
+        minecraft:spruce_door
+        minecraft:wooden_pressure_plate
+        minecraft:wool
+        minecraft:wooden_slab
+        davincisvessels:marker
+        davincisvessels:floater
+        davincisvessels:balloon
+        davincisvessels:gauge
+        davincisvessels:seat
+        davincisvessels:engine
+        davincisvessels:stickybuffer
+        davincisvessels:anchorpoint
+     >
+    S:allowed_tiles <
+     >
+    S:block_densities <
+        "DavincisVessels:floater=0.04"
+        "DavincisVessels:balloon=0.02"
+     >
+    S:forbidden_blocks <
+        minecraft:dirt
+        minecraft:grass
+        minecraft:sand
+        minecraft:gravel
+        minecraft:clay
+        minecraft:ice
+        minecraft:water
+        minecraft:flowing_water
+        minecraft:lava
+        minecraft:flowing_lava
+        minecraft:snow
+        minecraft:snow_layer
+        minecraft:waterlily
+        minecraft:netherrack
+        minecraft:soul_sand
+        minecraft:tallgrass
+        davincisvessels:buffer
+     >
+    S:forbidden_tiles <
+     >
+    S:material_densities <
+        "minecraft:air=0.0"
+        "minecraft:wool=0.1"
+     >
+    S:overwritable_blocks <
+        minecraft:tallgrass
+        minecraft:waterlily
+        minecraft:snow_layer
+     >
+    S:updatable_tiles <
+        Furnace
+        Hopper
+        Banner
+        EnchantTable
+        DLDetector
+     >
+    B:use_tile_whitelist=false
+    B:use_whitelist=false
+}
+
+

config/NaturaModules.cfg

@@ -0,0 +1,26 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+modules {
+    # Everything that's decorative for Natura. (bookshelfs, etc)
+    B:NaturaDecorative=true
+
+    # The entites added by Natura
+    B:NaturaEntities=true
+
+    # All of the nether blocks including trees
+    B:NaturaNether=true
+
+    # All of the overworld blocks including trees
+    B:NaturaOverworld=true
+
+    # All of the tools + armor added by natura
+    B:NaturaTools=false
+
+    # Everything that's found in the world and worldgen including the netherite dimension
+    B:NaturaWorld=true
+    B:craftingtweaksIntegration=true
+}
+
+

config/NetherEx/Biomes/biomesoplenty/corrupted_sands.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:corrupted_sands",
+    "weight": 8,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/fungi_forest.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:fungi_forest",
+    "weight": 4,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/phantasmagoric_inferno.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:phantasmagoric_inferno",
+    "weight": 6,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/undergarden.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:undergarden",
+    "weight": 4,
+    "enabled": true
+}

config/NetherEx/Biomes/biomesoplenty/visceral_heap.json

@@ -0,0 +1,5 @@
+{
+    "biome": "biomesoplenty:visceral_heap",
+    "weight": 4,
+    "enabled": true
+}

config/NetherEx/Biomes/minecraft/hell.json

@@ -0,0 +1,419 @@
+{
+  "biome": "minecraft:hell",
+  "weight": 10,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "fillerBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "wallBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "ceilingBottomBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "ceilingFillerBlock": {
+      "block": "minecraft:netherrack"
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:ghast",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:zombie_pigman",
+      "creatureType": "monster",
+      "weight": 100,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:magma_cube",
+      "creatureType": "monster",
+      "weight": 2,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:enderman",
+      "creatureType": "monster",
+      "weight": 1,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster_grunt",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "quark:wraith",
+      "creatureType": "monster",
+      "weight": 60,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": true
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "animalium:wild_dog",
+      "creatureType": "monster",
+      "weight": 2,
+      "minGroupCount": 1,
+      "maxGroupCount": 2,
+      "spawn": true
+    },
+    {
+      "entity": "animalium:bear",
+      "creatureType": "monster",
+      "weight": 1,
+      "minGroupCount": 1,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "animalium:rat",
+      "creatureType": "monster",
+      "weight": 2,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "magma_monsters:magma_monster_grunt",
+      "creatureType": "monster",
+      "weight": 2000,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "quark:wraith",
+      "creatureType": "monster",
+      "weight": 60,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": true
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": true
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": true
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "hidden": false,
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:fire"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "placement": "on_ground",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "minecraft:netherrack"
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "minecraft:netherrack"
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "decorate",
+      "blockToSpawn": {
+        "block": "minecraft:red_mushroom"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "placement": "on_ground",
+      "genAttempts": 1,
+      "genProbability": 0.25,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "decorate",
+      "blockToSpawn": {
+        "block": "minecraft:brown_mushroom"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "placement": "on_ground",
+      "genAttempts": 1,
+      "genProbability": 0.25,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "minecraft:quartz_ore"
+      },
+      "blockToReplace": {
+        "block": "minecraft:netherrack"
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:amethyst_ore"
+      },
+      "blockToReplace": {
+        "block": "minecraft:netherrack"
+      },
+      "veinSize": 3,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:magma"
+      },
+      "blockToReplace": {
+        "block": "minecraft:netherrack"
+      },
+      "veinSize": 32,
+      "genAttempts": 4,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 28,
+      "maxGenHeight": 38
+    },
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "minecraft:netherrack"
+      },
+      "hidden": true,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "lex:structure",
+      "genStage": "populate",
+      "structure": "nex:village/tiny_hell_pigtificate_village",
+      "type": "grounded",
+      "genAttempts": 1,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "mirror": "random",
+      "rotation": "random",
+      "ignoredBlock": {
+        "block": "minecraft:structure_void",
+        "properties": {}
+      },
+      "clearancePercentage": 0.75,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 116
+    }
+  ]
+}

config/NetherEx/Biomes/nex/arctic_abyss.json

@@ -0,0 +1,259 @@
+{
+  "biome": "nex:arctic_abyss",
+  "weight": 2,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "nex:frostburn_ice"
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "icy"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "icy"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:frostburn_ice"
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "icy"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:magma"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:ghast",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:zombie_pigman",
+      "creatureType": "monster",
+      "weight": 25,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:bone_spider",
+      "creatureType": "monster",
+      "weight": 35,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:wight",
+      "creatureType": "monster",
+      "weight": 75,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:brute",
+      "creatureType": "monster",
+      "weight": 15,
+      "minGroupCount": 1,
+      "maxGroupCount": 1,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:canis_campestris",
+      "creatureType": "creature",
+      "weight": 6,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": false
+    },
+    {
+      "entity": "primal:bear_black",
+      "creatureType": "creature",
+      "weight": 4,
+      "minGroupCount": 0,
+      "maxGroupCount": 2,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:scatter",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "nex:blue_fire"
+      },
+      "blockToTarget": {
+        "block": "nex:frostburn_ice"
+      },
+      "placement": "on_ground",
+      "genAttempts": 5,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:rime_ore"
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "icy"
+        }
+      },
+      "veinSize": 7,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:pool",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "nex:ichor"
+      },
+      "blockToSurround": {
+        "block": "nex:frostburn_ice"
+      },
+      "genAttempts": 1,
+      "genProbability": 0.125,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 36,
+      "maxGenHeight": 96
+    }
+  ]
+}

config/NetherEx/Biomes/nex/fungi_forest.json

@@ -0,0 +1,260 @@
+{
+  "biome": "nex:fungi_forest",
+  "weight": 4,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "nex:hyphae"
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "lively"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "nex:mogus",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:spore",
+      "creatureType": "monster",
+      "weight": 25,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "nex:spore_creeper",
+      "creatureType": "monster",
+      "weight": 23,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 2,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "netherrack": {
+        "block": "nex:block_netherrack",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "blockToAttachTo": {
+        "block": "minecraft:barrier",
+        "properties": {}
+      },
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "netherrack": {
+        "block": "nex:block_netherrack",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "blockToAttachTo": {
+        "block": "minecraft:barrier",
+        "properties": {}
+      },
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "lively"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:big_mushroom",
+      "genStage": "decorate",
+      "mushroomCap": {
+        "block": "nex:elder_mushroom_cap",
+        "properties": {
+          "type": "brown"
+        }
+      },
+      "mushroomStem": {
+        "block": "nex:elder_mushroom_stem"
+      },
+      "blockToPlaceOn": {
+        "block": "nex:hyphae"
+      },
+      "shape": "flat",
+      "genAttempts": 256,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:big_mushroom",
+      "genStage": "decorate",
+      "mushroomCap": {
+        "block": "nex:elder_mushroom_cap",
+        "properties": {
+          "type": "red"
+        }
+      },
+      "mushroomStem": {
+        "block": "nex:elder_mushroom_stem"
+      },
+      "blockToPlaceOn": {
+        "block": "nex:hyphae"
+      },
+      "shape": "bulb",
+      "genAttempts": 256,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "nex:enoki",
+      "genStage": "decorate",
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 64,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:structure",
+      "genStage": "populate",
+      "structure": "nex:ghast_queen_shrine",
+      "type": "floating",
+      "genAttempts": 1,
+      "genProbability": 0.0125,
+      "randomizeGenAttempts": false,
+      "mirror": "random",
+      "rotation": "random",
+      "ignoredBlock": {
+        "block": "minecraft:structure_void",
+        "properties": {}
+      },
+      "clearancePercentage": 1.0,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 116
+    }
+  ]
+}

config/NetherEx/Biomes/nex/ruthless_sands.json

@@ -0,0 +1,227 @@
+{
+  "biome": "nex:ruthless_sands",
+  "weight": 8,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "minecraft:soul_sand"
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "gloomy"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:wither_skeleton",
+      "creatureType": "monster",
+      "weight": 65,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "minecraft:zombie_pigman",
+      "creatureType": "monster",
+      "weight": 45,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "nex:spinout",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 1,
+      "maxGroupCount": 2,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 2,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "hidden": false,
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 124
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "gloomy"
+        }
+      },
+      "hidden": true,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "nex:thornstalk",
+      "genStage": "decorate",
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 32,
+      "maxGenHeight": 108
+    }
+  ]
+}

config/NetherEx/Biomes/nex/torrid_wasteland.json

@@ -0,0 +1,310 @@
+{
+  "biome": "nex:torrid_wasteland",
+  "weight": 6,
+  "enabled": true,
+  "genDefaultFeatures": true,
+  "blocks": {
+    "topBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "fillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "wallBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "ceilingBottomBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "ceilingFillerBlock": {
+      "block": "nex:netherrack",
+      "properties": {
+        "type": "fiery"
+      }
+    },
+    "oceanBlock": {
+      "block": "minecraft:lava"
+    }
+  },
+  "entities": [
+    {
+      "entity": "minecraft:magma_cube",
+      "creatureType": "monster",
+      "weight": 15,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "nex:ember",
+      "creatureType": "monster",
+      "weight": 25,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "nex:salamander",
+      "creatureType": "monster",
+      "weight": 50,
+      "minGroupCount": 1,
+      "maxGroupCount": 3,
+      "spawn": true
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 20,
+      "minGroupCount": 1,
+      "maxGroupCount": 4,
+      "spawn": true
+    },
+    {
+      "entity": "natura:heatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:babyheatscarspider",
+      "creatureType": "monster",
+      "weight": 10,
+      "minGroupCount": 4,
+      "maxGroupCount": 4,
+      "spawn": false
+    },
+    {
+      "entity": "natura:nitrocreeper",
+      "creatureType": "monster",
+      "weight": 8,
+      "minGroupCount": 4,
+      "maxGroupCount": 6,
+      "spawn": false
+    },
+    {
+      "entity": "primal:creeper_nether",
+      "creatureType": "monster",
+      "weight": 3,
+      "minGroupCount": 0,
+      "maxGroupCount": 1,
+      "spawn": false
+    },
+    {
+      "entity": "natura:imp",
+      "creatureType": "creature",
+      "weight": 10,
+      "minGroupCount": 8,
+      "maxGroupCount": 12,
+      "spawn": false
+    },
+    {
+      "entity": "primal:ovis_atre",
+      "creatureType": "creature",
+      "weight": 90,
+      "minGroupCount": 1,
+      "maxGroupCount": 6,
+      "spawn": false
+    }
+  ],
+  "features": [
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "hidden": false,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:scatter",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:fire"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "placement": "on_ground",
+      "genAttempts": 20,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": true,
+      "generate": true,
+      "minGenHeight": 4,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:cluster",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:glowstone"
+      },
+      "blockToAttachTo": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "direction": "down",
+      "genAttempts": 10,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 1,
+      "maxGenHeight": 128
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "ore",
+      "blockToSpawn": {
+        "block": "nex:quartz_ore",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "veinSize": 14,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "nex:basalt",
+        "properties": {
+          "type": "normal"
+        }
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "veinSize": 24,
+      "genAttempts": 14,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    },
+    {
+      "feature": "lex:ore",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:magma"
+      },
+      "blockToReplace": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "veinSize": 32,
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 28,
+      "maxGenHeight": 38
+    },
+    {
+      "feature": "lex:fluid",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:flowing_lava"
+      },
+      "blockToTarget": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "hidden": true,
+      "genAttempts": 16,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 118
+    },
+    {
+      "feature": "lex:pool",
+      "genStage": "populate",
+      "blockToSpawn": {
+        "block": "minecraft:lava"
+      },
+      "blockToSurround": {
+        "block": "nex:netherrack",
+        "properties": {
+          "type": "fiery"
+        }
+      },
+      "genAttempts": 8,
+      "genProbability": 1.0,
+      "randomizeGenAttempts": false,
+      "generate": true,
+      "minGenHeight": 10,
+      "maxGenHeight": 108
+    }
+  ]
+}

config/NetherEx/Trades/nex/armorsmith.json

@@ -0,0 +1,214 @@
+{
+    "career": "armorsmith",
+    "trades": [
+        {
+            "output": {
+                "item": "nex:salamander_hide",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:iron_ingot",
+                "meta": 0,
+                "minStackSize": 10,
+                "maxStackSize": 20
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:leather",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_nugget",
+                "meta": 0,
+                "minStackSize": 12,
+                "maxStackSize": 24
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_chestplate",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 12,
+                "maxStackSize": 20
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_boots",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 14
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_helmet",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 14
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:chainmail_leggings",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 9,
+                "maxStackSize": 18
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_helmet",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_crystal",
+                "properties": {
+                    "type": "amethyst"
+                },
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_chestplate",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_crystal",
+                "properties": {
+                    "type": "amethyst"
+                },
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_leggings",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_crystal",
+                "properties": {
+                    "type": "amethyst"
+                },
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "nex:salamander_hide_boots",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_block",
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/brewer.json

@@ -0,0 +1,106 @@
+{
+    "career": "brewer",
+    "trades": [
+        {
+            "output": {
+                "item": "nex:spore",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 5
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:magma_cream",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:glass_bottle",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:blaze_powder",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 12
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:nether_wart",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:speckled_melon",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_block",
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/enchanter.json

@@ -0,0 +1,247 @@
+{
+    "career": "enchanter",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 10
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:glowstone_dust",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:blaze_rod",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:unbreaking",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 2
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 8,
+                "maxStackSize": 32
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:protection",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 3
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 8,
+                "maxStackSize": 32
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:sharpness",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 4
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 8,
+                "maxStackSize": 32
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:fire_protection",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 4
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 16,
+                "maxStackSize": 48
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:fortune",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 3
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 24,
+                "maxStackSize": 64
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:enchanted_book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1,
+                "enchantments": [
+                    {
+                        "enchantment": "minecraft:looting",
+                        "minEnchantmentLevel": 1,
+                        "maxEnchantmentLevel": 1
+                    }
+                ]
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "inputTwo": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 24,
+                "maxStackSize": 64
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:experience_bottle",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 16
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/gatherer.json

@@ -0,0 +1,185 @@
+{
+    "career": "gatherer",
+    "trades": [
+        {
+            "output": {
+                "item": "nex:congealed_magma_cream",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputTwo": {
+                "item": "minecraft:magma_cream",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:mushroom_stew",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 12,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "itemBlock": "nex:elder_mushroom",
+                "properties": {
+                    "type": "red"
+                },
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:bone",
+                "meta": 0,
+                "minStackSize": 32,
+                "maxStackSize": 64
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:bread",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 16
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "itemBlock": "nex:elder_mushroom",
+                "properties": {
+                    "type": "brown"
+                },
+                "minStackSize": 4,
+                "maxStackSize": 7
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:enoki_mushroom",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 3
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:quartz_block",
+                "properties": {
+                    "variant": "default"
+                },
+                "minStackSize": 3,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 3,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:nether_wart",
+                "minStackSize": 3,
+                "maxStackSize": 5
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 6,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:melon_block",
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/hunter.json

@@ -0,0 +1,124 @@
+{
+    "career": "hunter",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:rotten_flesh",
+                "meta": 0,
+                "minStackSize": 9,
+                "maxStackSize": 15
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:spider_eye",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:magma_cream",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:cooked_rabbit",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 7
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 2
+            },
+            "inputOne": {
+                "item": "nex:ghast_meat_raw",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "nex:ghast_meat_cooked",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:ender_pearl",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 7
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/Trades/nex/scavenger.json

@@ -0,0 +1,177 @@
+{
+    "career": "scavenger",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:cobblestone",
+                "minStackSize": 4,
+                "maxStackSize": 16
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:stone",
+                "properties": {
+                    "variant": "stone"
+                },
+                "minStackSize": 16,
+                "maxStackSize": 28
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:dirt",
+                "properties": {
+                    "variant": "dirt"
+                },
+                "minStackSize": 1,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:gravel",
+                "minStackSize": 8,
+                "maxStackSize": 16
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 16,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:log",
+                "properties": {
+                    "variant": "oak"
+                },
+                "minStackSize": 1,
+                "maxStackSize": 4
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 3,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_ingot",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 2
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:coal_ore",
+                "minStackSize": 3,
+                "maxStackSize": 7
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:diamond",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 9
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 3,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:book",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 10
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 3
+        },
+        {
+            "output": {
+                "item": "minecraft:potion",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "itemBlock": "nex:amethyst_block",
+                "minStackSize": 1,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 3,
+            "tradeLevel": 4
+        }
+    ]
+}

config/NetherEx/Trades/nex/toolsmith.json

@@ -0,0 +1,192 @@
+{
+    "career": "toolsmith",
+    "trades": [
+        {
+            "output": {
+                "item": "minecraft:iron_nugget",
+                "meta": 0,
+                "minStackSize": 10,
+                "maxStackSize": 24
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "minTradesAvailable": 4,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "minecraft:gold_ingot",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 8
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 8,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:stone_pickaxe",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:stone_sword",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:stone_shovel",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 3
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 1
+        },
+        {
+            "output": {
+                "item": "minecraft:diamond",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 2,
+                "maxStackSize": 4
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_pickaxe",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 6
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_axe",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_sword",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 5,
+                "maxStackSize": 7
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:iron_shovel",
+                "meta": 0,
+                "minStackSize": 1,
+                "maxStackSize": 1
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 4,
+                "maxStackSize": 5
+            },
+            "minTradesAvailable": 1,
+            "maxTradesAvailable": 2,
+            "tradeLevel": 2
+        },
+        {
+            "output": {
+                "item": "minecraft:gold_nugget",
+                "meta": 0,
+                "minStackSize": 12,
+                "maxStackSize": 28
+            },
+            "inputOne": {
+                "item": "nex:amethyst_crystal",
+                "meta": 0,
+                "minStackSize": 6,
+                "maxStackSize": 9
+            },
+            "minTradesAvailable": 2,
+            "maxTradesAvailable": 4,
+            "tradeLevel": 3
+        }
+    ]
+}

config/NetherEx/nex.cfg

@@ -0,0 +1,312 @@
+# Configuration file
+
+nex {
+
+    client {
+
+        visual {
+            B:disableNetherFog=true
+        }
+
+    }
+
+    compatibility {
+
+        biomesoplenty {
+            B:enableCompat=true
+        }
+
+    }
+
+    dimension {
+
+        nether {
+            B:generateGravel=false
+            B:generateSoulSand=false
+            B:isLavaInfinite=false
+            B:overrideNether=true
+        }
+
+    }
+
+    block {
+
+        nether_portal {
+            # The higher the number, the rarer it is for Pigman to spawn
+            # The lower the number, the more common it is for Pigman to spawn
+            # If set to 0, Pigman won't spawn
+            # Min: 0
+            # Max: 2147483647
+            I:pigmanSpawnRarity=2000
+        }
+
+        netherrack {
+            B:allowAllShovelsToFlatten=false
+        }
+
+        soul_sand {
+            B:allowAllHoesToTill=false
+            B:useLavaInsteadOfIchorToMoisten=false
+        }
+
+        magma {
+            B:turnIntoLava=false
+            B:turnIntoLavaWhenBroken=false
+        }
+
+        rime {
+            B:canFreezeLava=true
+            B:canFreezeMobs=true
+            B:canFreezeWater=true
+        }
+
+        thornstalk {
+            B:canDestroyItems=false
+
+            # Mobs Thornstalk won't hurt
+            S:mobBlacklist <
+                minecraft:wither_skeleton
+                minecraft:zombie_pigman
+                nex:spinout
+             >
+        }
+
+        hyphae {
+            B:shouldSpread=false
+        }
+
+        nether_wart {
+            B:growLikeCrops=true
+
+            # The higher the number, the slower Nether Wart grows
+            # The lower the number, the faster Nether Wart grows
+            # If set to 0, Nether Wart growth will default to Vanilla speed
+            # Min: 0
+            # Max: 2147483647
+            I:growthTickSpeed=0
+        }
+
+    }
+
+    potion_effect {
+
+        freeze {
+            # Mobs that won't freeze
+            S:mobBlacklist <
+                minecraft:blaze
+                minecraft:ghast
+                minecraft:wither_skeleton
+                minecraft:polar_bear
+                nex:wight
+                nex:ember
+                nex:spinout
+                nex:bone_spider
+                nex:brute
+             >
+
+            # The higher the number, the rarer it is to thaw
+            # The lower the number, the more common it is to thaw
+            # Min: 1
+            # Max: 2147483647
+            I:thawRarity=1024
+        }
+
+        spore {
+            # Mobs that shouldn't spawn Spores
+            S:mobBlacklist <
+                nex:spore_creeper
+                nex:spore
+                nex:mogus
+             >
+
+            # The higher the number, the rarer it is to spawn a Spore
+            # The lower the number, the more common it is to spawn a Spore
+            # Min: 1
+            # Max: 2147483647
+            I:sporeSpawnRarity=128
+        }
+
+        lost {
+            # The higher the number, the rarer it is to spawn a Ghastling
+            # The lower the number, the more common it is to spawn a Ghastling
+            # Min: 1
+            # Max: 2147483647
+            I:ghastlingSpawnRarity=256
+        }
+
+    }
+
+    entity {
+
+        ember {
+            # The higher the number, the rarer it is to set a player on fire
+            # The lower the number, the more common it is to set a player on fire
+            # If set to 0, Embers won't set Players on fire
+            # Min: 0
+            # Max: 2147483647
+            I:setPlayerOnFireRarity=1
+        }
+
+        nethermite {
+            # Blocks the Nethermite will spawn from
+            S:blockWhitelist <
+                minecraft:quartz_ore
+                nex:ore_quartz
+                nex:ore_amethyst
+                nex:ore_rime
+                tconstruct:ore
+                nethermetals:nether_coal_ore
+                nethermetals:nether_redstone_ore
+                nethermetals:nether_diamond_ore
+                nethermetals:nether_emerald_ore
+                nethermetals:nether_gold_ore
+                nethermetals:nether_iron_ore
+                nethermetals:nether_lapis_ore
+                nethermetals:nether_antimony_ore
+                nethermetals:nether_bismuth_ore
+                nethermetals:nether_copper_ore
+                nethermetals:nether_lead_ore
+                nethermetals:nether_mercury_ore
+                nethermetals:nether_nickel_ore
+                nethermetals:nether_platnium_ore
+                nethermetals:nether_silver_ore
+                nethermetals:nether_tin_ore
+                nethermetals:nether_zinc_ore
+                nethermetals:nether_aluminum_ore
+                nethermetals:nether_cadmium_ore
+                nethermetals:nether_chromium_ore
+                nethermetals:nether_iridium_ore
+                nethermetals:nether_magnesium_ore
+                nethermetals:nether_magnanese_ore
+                nethermetals:nether_osmium_ore
+                nethermetals:nether_plutonium_ore
+                nethermetals:nether_rutile_ore
+                nethermetals:nether_tantalum_ore
+                nethermetals:nether_titanium_ore
+                nethermetals:nether_tungsten_ore
+                nethermetals:nether_uramium_ore
+                nethermetals:nether_zirconium_ore
+             >
+
+            # The higher the number, the rarer it is for a Nethermite to spawn
+            # The lower the number, the more common it is for a Nethermite to spawn
+            # If set to 0, Nethermites won't spawn
+            # Min: 0
+            # Max: 2147483647
+            I:spawnRarity=64
+        }
+
+        spinout {
+            # The lower the number, the less time a Spinout goes without spinning
+            # The higher the number, the more time a Spinout goes without spinning
+            # Min: 1
+            # Max: 2147483647
+            I:spinCooldown=2
+
+            # The lower the number, the less time a Spinout spins
+            # The higher the number, the more time a Spinout spins
+            # Min: 1
+            # Max: 2147483647
+            I:spinTime=6
+        }
+
+        spore_creeper {
+            # The higher the number, the rarer it is for a Spore Creeper to spawn a Spore on death
+            # The lower the number, the more common it is for a Spore Creeper to spawn a Spore on death
+            # Min: 1
+            # Max: 2147483647
+            I:sporeSpawnRarity=12
+        }
+
+        spore {
+            # The lower the number, the less Spore Creepers spawn from a Spore
+            # The higher the number, the more Spore Creepers spawn from a Spore
+            # Min: 1
+            # Max: 2147483647
+            I:creeperSpawnAmount=3
+
+            # The lower the number, the less it takes a Spore to grow
+            # The higher the number, the more time it takes for a Spore to grow
+            # Min: 1
+            # Max: 2147483647
+            I:growthTime=60
+        }
+
+        brute {
+            # The lower the number, the less cooldown the Brute has after charging
+            # The higher the number, the more cooldown the Brute has after charging
+            # Min: 1
+            # Max: 2147483647
+            I:chargeCooldown=2
+        }
+
+        ghast_queen {
+            # The lower the number, the less Ghastling spawn
+            # The higher the number, the more Ghastling spawn
+            # Min: 1
+            # Max: 2147483647
+            I:ghastlingSpawnAmount=4
+
+            # The lower the number, the less cooldown the Ghast Queen has after spawning Ghastlings
+            # The higher the number, the more cooldown the Ghast Queen has after spawning Ghastlings
+            # Min: 1
+            # Max: 2147483647
+            I:ghastlingSpawnCooldown=10
+        }
+
+        ghast {
+            # The lower the number, the more common it is for Ghast Meat to drop
+            # The higher the number, the rarer it is for Ghast Meat to drop
+            # If set to 0, Ghast Meat does not drop
+            # Min: 0
+            # Max: 2147483647
+            I:meatDropRarity=1
+        }
+
+        wither_skeleton {
+            # The lower the number, the more common it is for a Bone to drop
+            # The higher the number, the rarer it is for a Bone drop
+            # If set to 0, Bones do not drop
+            # Min: 0
+            # Max: 2147483647
+            I:boneDropRarity=4
+        }
+
+    }
+
+    biome {
+
+        hell {
+        }
+
+        ruthless_sands {
+            B:generateThornstalk=true
+            I:thornstalkRarity=10
+        }
+
+        fungi_forest {
+            I:elderMushroomRarity=32
+            I:enokiMushroomRarity=4
+            B:generateElderMushrooms=true
+            B:generateEnokiMushrooms=true
+        }
+
+        torrid_wasteland {
+        }
+
+        arctic_abyss {
+            # Whether or not players can freeze in the Arctic Abyss
+            B:canPlayersFreeze=false
+
+            # The higher the number, the rarer it is for mobs to freeze in the Arctic Abyss biome
+            # The lower the number, the more common it is for mobs to freeze in the Arctic Abyss biome
+            # Min: 1
+            # Max: 2147483647
+            I:mobFreezeRarity=512
+        }
+
+    }
+
+}
+
+